mirror of
https://github.com/nicbarker/clay.git
synced 2025-12-26 11:01:05 +00:00
Compare commits
22 commits
0705dfc810
...
d2953e04f5
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
d2953e04f5 | ||
|
|
37675089e3 | ||
|
|
1cbc56cbf2 | ||
|
|
be99977da6 | ||
|
|
f950d317c9 | ||
|
|
c44d6b9309 | ||
|
|
2cfab84034 | ||
|
|
31bf0ad2dd | ||
|
|
f8b13b5978 | ||
|
|
9bc743fd12 | ||
|
|
672927d387 | ||
|
|
b7e1d69ca6 | ||
|
|
e9522005db | ||
|
|
409bf1c3bf | ||
|
|
f0fec168a2 | ||
|
|
bc31e8d332 | ||
|
|
697adce4a9 | ||
|
|
1936afd184 | ||
|
|
678bcf2ad0 | ||
|
|
11e3f91220 | ||
|
|
eb1ee390bb | ||
|
|
4699018599 |
5
bindings/jai/.gitignore
vendored
Normal file
5
bindings/jai/.gitignore
vendored
Normal file
|
|
@ -0,0 +1,5 @@
|
|||
.build/
|
||||
main.exe
|
||||
main.pdb
|
||||
main.rdi
|
||||
main
|
||||
116
bindings/jai/README.md
Normal file
116
bindings/jai/README.md
Normal file
|
|
@ -0,0 +1,116 @@
|
|||
### Jai Language Bindings
|
||||
|
||||
This directory contains bindings for the [Jai](https://jai.community/t/overview-of-jai/128) programming language, as well as an example implementation of the Clay demo from the video in Jai.
|
||||
|
||||
If you haven't taken a look at the [full documentation for clay](https://github.com/nicbarker/clay/blob/main/README.md), it's recommended that you take a look there first to familiarise yourself with the general concepts. This README is abbreviated and applies to using clay in Jai specifically.
|
||||
|
||||
The **most notable difference** between the C API and the Jai bindings is the use of for statements to create the scope for declaring child elements. This is done using some [for_expansion](https://jai.community/t/loops/147) magic.
|
||||
When using the equivalent of the [Element Macros](https://github.com/nicbarker/clay/blob/main/README.md#element-macros):
|
||||
|
||||
```C
|
||||
// C form of element macros
|
||||
// Parent element with 8px of padding
|
||||
CLAY(CLAY_LAYOUT({ .padding = 8 })) {
|
||||
// Child element 1
|
||||
CLAY_TEXT(CLAY_STRING("Hello World"), CLAY_TEXT_CONFIG({ .fontSize = 16 }));
|
||||
// Child element 2 with red background
|
||||
CLAY(CLAY_RECTANGLE({ .color = COLOR_RED })) {
|
||||
// etc
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
```Jai
|
||||
// Jai form of element macros
|
||||
// Parent element with 8px of padding
|
||||
for Clay.Element(Clay.Layout(.{padding = 8})) {
|
||||
// Child element 1
|
||||
Clay.Text("Hello World", Clay.TextConfig(.{fontSize = 16}));
|
||||
// Child element 2 with red background
|
||||
for Clay.Element(Clay.Rectangle(.{color = COLOR_RED})) {
|
||||
// etc
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
> [!WARNING]
|
||||
> For now, the Jai and Odin bindings are missing the OnHover() and Hovered() functions.
|
||||
> You can you PointerOver instead, an example of that is in `examples/introducing_clay_video_demo`.
|
||||
|
||||
### Quick Start
|
||||
|
||||
1. Download the clay-jai directory and copy it into your modules folder.
|
||||
|
||||
```Jai
|
||||
Clay :: #import "clay-jai";
|
||||
```
|
||||
|
||||
1. Ask clay for how much static memory it needs using [Clay.MinMemorySize()](https://github.com/nicbarker/clay/blob/main/README.md#clay_minmemorysize), create an Arena for it to use with [Clay.CreateArenaWithCapacityAndMemory()](https://github.com/nicbarker/clay/blob/main/README.md#clay_createarenawithcapacityandmemory), and initialize it with [Clay.Initialize()](https://github.com/nicbarker/clay/blob/main/README.md#clay_initialize).
|
||||
|
||||
```Jai
|
||||
clay_required_memory := Clay.MinMemorySize();
|
||||
memory := alloc(clay_required_memory);
|
||||
clay_memory := Clay.CreateArenaWithCapacityAndMemory(clay_required_memory, memory);
|
||||
Clay.Initialize(
|
||||
clay_memory,
|
||||
Clay.Dimensions.{cast(float, GetScreenWidth()), cast(float, GetScreenHeight())},
|
||||
.{handle_clay_errors, 0}
|
||||
);
|
||||
```
|
||||
|
||||
3. Provide a `measure_text(text, config)` proc marked with `#c_call` with [Clay.SetMeasureTextFunction(function)](https://github.com/nicbarker/clay/blob/main/README.md#clay_setmeasuretextfunction) so that clay can measure and wrap text.
|
||||
|
||||
```Jai
|
||||
// Example measure text function
|
||||
measure_text :: (text: *Clay.String, config: *Clay.TextElementConfig) -> Clay.Dimensions #c_call {
|
||||
}
|
||||
|
||||
// Tell clay how to measure text
|
||||
Clay.SetMeasureTextFunction(measure_text)
|
||||
```
|
||||
|
||||
4. **Optional** - Call [Clay.SetPointerPosition(pointerPosition)](https://github.com/nicbarker/clay/blob/main/README.md#clay_setpointerposition) if you want to use mouse interactions.
|
||||
|
||||
```Jai
|
||||
// Update internal pointer position for handling mouseover / click / touch events
|
||||
Clay.SetPointerPosition(.{ mousePositionX, mousePositionY })
|
||||
```
|
||||
|
||||
5. Call [Clay.BeginLayout(screenWidth, screenHeight)](https://github.com/nicbarker/clay/blob/main/README.md#clay_beginlayout) and declare your layout using the provided macros.
|
||||
|
||||
```Jai
|
||||
// An example function to begin the "root" of your layout tree
|
||||
CreateLayout :: () -> Clay.RenderCommandArray {
|
||||
Clay.BeginLayout(windowWidth, windowHeight);
|
||||
|
||||
for Clay.Element(
|
||||
Clay.ID("OuterContainer"),
|
||||
Clay.Layout(.{
|
||||
sizing = .{Clay.SizingGrow(), Clay.SizingGrow()},
|
||||
padding = .{16, 16},
|
||||
childGap = 16
|
||||
}),
|
||||
Clay.Rectangle(.{color = .{250, 250, 255, 255}}),
|
||||
) {
|
||||
// ...
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
1. Call [Clay.EndLayout()](https://github.com/nicbarker/clay/blob/main/README.md#clay_endlayout) and process the resulting [Clay.RenderCommandArray](https://github.com/nicbarker/clay/blob/main/README.md#clay_rendercommandarray) in your choice of renderer.
|
||||
|
||||
```Jai
|
||||
render_commands: Clay.RenderCommandArray = Clay.EndLayout();
|
||||
|
||||
for 0..render_commands.length - 1 {
|
||||
render_command := Clay.RenderCommandArray_Get(*render_commands, cast(s32) it);
|
||||
|
||||
if #complete render_command.commandType == {
|
||||
case .RECTANGLE;
|
||||
DrawRectangle(render_command.boundingBox, render_command.config.rectangleElementConfig.color)
|
||||
// ... Implement handling of other command types
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
Please see the [full C documentation for clay](https://github.com/nicbarker/clay/blob/main/README.md) for API details. All public C functions and Macros have Jai binding equivalents, generally of the form `CLAY_RECTANGLE` (C) -> `Clay.Rectangle` (Jai)
|
||||
1
bindings/jai/clay-jai/.gitignore
vendored
Normal file
1
bindings/jai/clay-jai/.gitignore
vendored
Normal file
|
|
@ -0,0 +1 @@
|
|||
source/clay.h
|
||||
164
bindings/jai/clay-jai/generate.jai
Normal file
164
bindings/jai/clay-jai/generate.jai
Normal file
|
|
@ -0,0 +1,164 @@
|
|||
AT_COMPILE_TIME :: true;
|
||||
|
||||
SOURCE_PATH :: "source";
|
||||
|
||||
DECLARATIONS_TO_OMIT :: string.[
|
||||
// These have custom declaration in module.jai
|
||||
"Clay_Vector2",
|
||||
"Clay__ElementConfigType",
|
||||
"Clay__AlignClay__ElementConfigType",
|
||||
"Clay_Border",
|
||||
"Clay__AlignClay_Border",
|
||||
"Clay_BorderElementConfig",
|
||||
"Clay__AlignClay_BorderElementConfig",
|
||||
|
||||
// These are not supported yet
|
||||
"Clay_OnHover",
|
||||
"Clay_Hovered",
|
||||
];
|
||||
|
||||
#if AT_COMPILE_TIME {
|
||||
#if !#exists(JAILS_DIAGNOSTICS_BUILD) {
|
||||
#run,stallable {
|
||||
Compiler.set_build_options_dc(.{do_output=false});
|
||||
options := Compiler.get_build_options();
|
||||
args := options.compile_time_command_line;
|
||||
if !generate_bindings(args, options.minimum_os_version) {
|
||||
Compiler.compiler_set_workspace_status(.FAILED);
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
#import "System";
|
||||
|
||||
main :: () {
|
||||
set_working_directory(path_strip_filename(get_path_of_running_executable()));
|
||||
if !generate_bindings(get_command_line_arguments(), #run get_build_options().minimum_os_version) {
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
generate_bindings :: (args: [] string, minimum_os_version: type_of(Compiler.Build_Options.minimum_os_version)) -> bool {
|
||||
compile := array_find(args, "-compile");
|
||||
compile_debug := array_find(args, "-debug");
|
||||
|
||||
could_copy := FileUtils.copy_file("../../../clay.h", "source/clay.h");
|
||||
if !could_copy then return false;
|
||||
defer if !compile_debug then File.file_delete("source/clay.h");
|
||||
|
||||
if compile {
|
||||
source_file := tprint("%/clay.c", SOURCE_PATH);
|
||||
|
||||
success := true;
|
||||
#if OS == .WINDOWS {
|
||||
// TODO try to use BuildCpp module again
|
||||
File.make_directory_if_it_does_not_exist("windows", true);
|
||||
|
||||
command := ifx compile_debug {
|
||||
write_string("Compiling debug...\n");
|
||||
Process.break_command_into_strings("clang -g -gcodeview -c source\\clay.c");
|
||||
} else {
|
||||
write_string("Compiling release...\n");
|
||||
Process.break_command_into_strings("clang -O3 -c source\\clay.c");
|
||||
}
|
||||
result := Process.run_command(..command, capture_and_return_output=true, print_captured_output=true);
|
||||
if result.exit_code != 0 then return false;
|
||||
defer File.file_delete("clay.o");
|
||||
|
||||
write_string("Linking...\n");
|
||||
command = Process.break_command_into_strings("llvm-ar -rcs windows/clay.lib clay.o");
|
||||
result = Process.run_command(..command, capture_and_return_output=true, print_captured_output=true);
|
||||
if result.exit_code != 0 then return false;
|
||||
} else #if OS == .LINUX {
|
||||
File.make_directory_if_it_does_not_exist("linux", true);
|
||||
|
||||
could_build := BuildCpp.build_cpp_static_lib("linux/clay", "source/clay.c",
|
||||
debug = compile_debug,
|
||||
);
|
||||
assert(could_build);
|
||||
} else {
|
||||
// TODO MacOS
|
||||
assert(false);
|
||||
}
|
||||
|
||||
if !success then return false;
|
||||
write_string("Succesfully built clay\n");
|
||||
}
|
||||
|
||||
output_filename: string;
|
||||
options: Generator.Generate_Bindings_Options;
|
||||
{
|
||||
write_string("Generating bindings...\n");
|
||||
|
||||
using options;
|
||||
|
||||
#if OS == .WINDOWS {
|
||||
array_add(*libpaths, "windows");
|
||||
output_filename = "windows.jai";
|
||||
} else #if OS == .LINUX {
|
||||
array_add(*libpaths, "linux");
|
||||
output_filename = "linux.jai";
|
||||
} else {
|
||||
assert(false);
|
||||
}
|
||||
|
||||
array_add(*libnames, "clay");
|
||||
array_add(*include_paths, SOURCE_PATH);
|
||||
array_add(*source_files, tprint("%/clay.h", SOURCE_PATH));
|
||||
array_add(*strip_prefixes, "Clay_");
|
||||
|
||||
auto_detect_enum_prefixes = true;
|
||||
log_stripped_declarations = true;
|
||||
generate_compile_time_struct_checks = true;
|
||||
|
||||
visitor = clay_visitor;
|
||||
}
|
||||
|
||||
could_generate := Generator.generate_bindings(options, output_filename);
|
||||
|
||||
return could_generate;
|
||||
}
|
||||
|
||||
clay_visitor :: (decl: *Generator.Declaration, parent_decl: *Generator.Declaration) -> Generator.Declaration_Visit_Result {
|
||||
if !parent_decl {
|
||||
if array_find(DECLARATIONS_TO_OMIT, decl.name) {
|
||||
decl.decl_flags |= .OMIT_FROM_OUTPUT;
|
||||
return .STOP;
|
||||
}
|
||||
|
||||
// We don't want the align and wrapper strucs
|
||||
if String.begins_with(decl.name, "Clay__Align") || String.ends_with(decl.name, "Wrapper") {
|
||||
decl.decl_flags |= .OMIT_FROM_OUTPUT;
|
||||
return .STOP;
|
||||
}
|
||||
|
||||
if String.begins_with(decl.name, "Clay__") {
|
||||
// The way bindings generator strip prefixes mean that something like `Clay__Foo` will be turned to `Foo`
|
||||
// but what we want is `_Foo`
|
||||
decl.output_name = String.slice(decl.name, 5, decl.name.count - 5);
|
||||
}
|
||||
}
|
||||
|
||||
return .RECURSE;
|
||||
}
|
||||
|
||||
#scope_file
|
||||
|
||||
using Basic :: #import "Basic";
|
||||
Generator :: #import "Bindings_Generator";
|
||||
Compiler :: #import "Compiler";
|
||||
File :: #import "File";
|
||||
FileUtils :: #import "File_Utilities";
|
||||
BuildCpp :: #import "BuildCpp";
|
||||
Process :: #import "Process";
|
||||
String :: #import "String";
|
||||
|
||||
#if OS == .WINDOWS {
|
||||
Windows :: #import "Windows";
|
||||
WindowsResources :: #import "Windows_Resources";
|
||||
getenv :: Windows.getenv;
|
||||
} else {
|
||||
Posix :: #import "POSIX";
|
||||
getenv :: Posix.getenv;
|
||||
}
|
||||
711
bindings/jai/clay-jai/linux.jai
Normal file
711
bindings/jai/clay-jai/linux.jai
Normal file
|
|
@ -0,0 +1,711 @@
|
|||
//
|
||||
// This file was auto-generated using the following command:
|
||||
//
|
||||
// jai generate.jai - -compile
|
||||
//
|
||||
|
||||
|
||||
|
||||
// Utility Structs -------------------------
|
||||
// Note: Clay_String is not guaranteed to be null terminated. It may be if created from a literal C string,
|
||||
// but it is also used to represent slices.
|
||||
String :: struct {
|
||||
length: s32;
|
||||
chars: *u8;
|
||||
}
|
||||
|
||||
_StringArray :: struct {
|
||||
capacity: s32;
|
||||
length: s32;
|
||||
internalArray: *String;
|
||||
}
|
||||
|
||||
Context :: struct {}
|
||||
|
||||
Arena :: struct {
|
||||
nextAllocation: u64;
|
||||
capacity: u64;
|
||||
memory: *u8;
|
||||
}
|
||||
|
||||
Dimensions :: struct {
|
||||
width: float;
|
||||
height: float;
|
||||
}
|
||||
|
||||
Color :: struct {
|
||||
r: float;
|
||||
g: float;
|
||||
b: float;
|
||||
a: float;
|
||||
}
|
||||
|
||||
BoundingBox :: struct {
|
||||
x: float;
|
||||
y: float;
|
||||
width: float;
|
||||
height: float;
|
||||
}
|
||||
|
||||
// baseId + offset = id
|
||||
ElementId :: struct {
|
||||
id: u32;
|
||||
offset: u32;
|
||||
baseId: u32;
|
||||
stringId: String;
|
||||
}
|
||||
|
||||
CornerRadius :: struct {
|
||||
topLeft: float;
|
||||
topRight: float;
|
||||
bottomLeft: float;
|
||||
bottomRight: float;
|
||||
}
|
||||
|
||||
LayoutDirection :: enum u8 {
|
||||
LEFT_TO_RIGHT :: 0;
|
||||
TOP_TO_BOTTOM :: 1;
|
||||
CLAY_LEFT_TO_RIGHT :: LEFT_TO_RIGHT;
|
||||
CLAY_TOP_TO_BOTTOM :: TOP_TO_BOTTOM;
|
||||
}
|
||||
|
||||
LayoutAlignmentX :: enum u8 {
|
||||
LEFT :: 0;
|
||||
RIGHT :: 1;
|
||||
CENTER :: 2;
|
||||
CLAY_ALIGN_X_LEFT :: LEFT;
|
||||
CLAY_ALIGN_X_RIGHT :: RIGHT;
|
||||
CLAY_ALIGN_X_CENTER :: CENTER;
|
||||
}
|
||||
|
||||
LayoutAlignmentY :: enum u8 {
|
||||
TOP :: 0;
|
||||
BOTTOM :: 1;
|
||||
CENTER :: 2;
|
||||
CLAY_ALIGN_Y_TOP :: TOP;
|
||||
CLAY_ALIGN_Y_BOTTOM :: BOTTOM;
|
||||
CLAY_ALIGN_Y_CENTER :: CENTER;
|
||||
}
|
||||
|
||||
_SizingType :: enum u8 {
|
||||
FIT :: 0;
|
||||
GROW :: 1;
|
||||
PERCENT :: 2;
|
||||
FIXED :: 3;
|
||||
CLAY__SIZING_TYPE_FIT :: FIT;
|
||||
CLAY__SIZING_TYPE_GROW :: GROW;
|
||||
CLAY__SIZING_TYPE_PERCENT :: PERCENT;
|
||||
CLAY__SIZING_TYPE_FIXED :: FIXED;
|
||||
}
|
||||
|
||||
ChildAlignment :: struct {
|
||||
x: LayoutAlignmentX;
|
||||
y: LayoutAlignmentY;
|
||||
}
|
||||
|
||||
SizingMinMax :: struct {
|
||||
min: float;
|
||||
max: float;
|
||||
}
|
||||
|
||||
SizingAxis :: struct {
|
||||
size: union {
|
||||
minMax: SizingMinMax;
|
||||
percent: float;
|
||||
};
|
||||
type: _SizingType;
|
||||
}
|
||||
|
||||
Sizing :: struct {
|
||||
width: SizingAxis;
|
||||
height: SizingAxis;
|
||||
}
|
||||
|
||||
Padding :: struct {
|
||||
x: u16;
|
||||
y: u16;
|
||||
}
|
||||
|
||||
LayoutConfig :: struct {
|
||||
sizing: Sizing;
|
||||
padding: Padding;
|
||||
childGap: u16;
|
||||
childAlignment: ChildAlignment;
|
||||
layoutDirection: LayoutDirection;
|
||||
}
|
||||
|
||||
CLAY_LAYOUT_DEFAULT: LayoutConfig #elsewhere clay;
|
||||
|
||||
// Rectangle
|
||||
// NOTE: Not declared in the typedef as an ifdef inside macro arguments is UB
|
||||
RectangleElementConfig :: struct {
|
||||
color: Color;
|
||||
cornerRadius: CornerRadius;
|
||||
}
|
||||
|
||||
// Text
|
||||
TextElementConfigWrapMode :: enum u32 {
|
||||
WORDS :: 0;
|
||||
NEWLINES :: 1;
|
||||
NONE :: 2;
|
||||
CLAY_TEXT_WRAP_WORDS :: WORDS;
|
||||
CLAY_TEXT_WRAP_NEWLINES :: NEWLINES;
|
||||
CLAY_TEXT_WRAP_NONE :: NONE;
|
||||
}
|
||||
|
||||
TextElementConfig :: struct {
|
||||
textColor: Color;
|
||||
fontId: u16;
|
||||
fontSize: u16;
|
||||
letterSpacing: u16;
|
||||
lineHeight: u16;
|
||||
wrapMode: TextElementConfigWrapMode;
|
||||
}
|
||||
|
||||
// Image
|
||||
ImageElementConfig :: struct {
|
||||
imageData: *void;
|
||||
sourceDimensions: Dimensions;
|
||||
}
|
||||
|
||||
FloatingAttachPointType :: enum u8 {
|
||||
LEFT_TOP :: 0;
|
||||
LEFT_CENTER :: 1;
|
||||
LEFT_BOTTOM :: 2;
|
||||
CENTER_TOP :: 3;
|
||||
CENTER_CENTER :: 4;
|
||||
CENTER_BOTTOM :: 5;
|
||||
RIGHT_TOP :: 6;
|
||||
RIGHT_CENTER :: 7;
|
||||
RIGHT_BOTTOM :: 8;
|
||||
CLAY_ATTACH_POINT_LEFT_TOP :: LEFT_TOP;
|
||||
CLAY_ATTACH_POINT_LEFT_CENTER :: LEFT_CENTER;
|
||||
CLAY_ATTACH_POINT_LEFT_BOTTOM :: LEFT_BOTTOM;
|
||||
CLAY_ATTACH_POINT_CENTER_TOP :: CENTER_TOP;
|
||||
CLAY_ATTACH_POINT_CENTER_CENTER :: CENTER_CENTER;
|
||||
CLAY_ATTACH_POINT_CENTER_BOTTOM :: CENTER_BOTTOM;
|
||||
CLAY_ATTACH_POINT_RIGHT_TOP :: RIGHT_TOP;
|
||||
CLAY_ATTACH_POINT_RIGHT_CENTER :: RIGHT_CENTER;
|
||||
CLAY_ATTACH_POINT_RIGHT_BOTTOM :: RIGHT_BOTTOM;
|
||||
}
|
||||
|
||||
FloatingAttachPoints :: struct {
|
||||
element: FloatingAttachPointType;
|
||||
parent: FloatingAttachPointType;
|
||||
}
|
||||
|
||||
PointerCaptureMode :: enum u32 {
|
||||
CAPTURE :: 0;
|
||||
PASSTHROUGH :: 1;
|
||||
CLAY_POINTER_CAPTURE_MODE_CAPTURE :: CAPTURE;
|
||||
CLAY_POINTER_CAPTURE_MODE_PASSTHROUGH :: PASSTHROUGH;
|
||||
}
|
||||
|
||||
FloatingElementConfig :: struct {
|
||||
offset: Vector2;
|
||||
expand: Dimensions;
|
||||
zIndex: u16;
|
||||
parentId: u32;
|
||||
attachment: FloatingAttachPoints;
|
||||
pointerCaptureMode: PointerCaptureMode;
|
||||
}
|
||||
|
||||
// Custom
|
||||
CustomElementConfig :: struct {
|
||||
customData: *void;
|
||||
}
|
||||
|
||||
// Scroll
|
||||
ScrollElementConfig :: struct {
|
||||
horizontal: bool;
|
||||
vertical: bool;
|
||||
}
|
||||
|
||||
ElementConfigUnion :: union {
|
||||
rectangleElementConfig: *RectangleElementConfig;
|
||||
textElementConfig: *TextElementConfig;
|
||||
imageElementConfig: *ImageElementConfig;
|
||||
floatingElementConfig: *FloatingElementConfig;
|
||||
customElementConfig: *CustomElementConfig;
|
||||
scrollElementConfig: *ScrollElementConfig;
|
||||
borderElementConfig: *BorderElementConfig;
|
||||
}
|
||||
|
||||
ElementConfig :: struct {
|
||||
type: ElementConfigType;
|
||||
config: ElementConfigUnion;
|
||||
}
|
||||
|
||||
// Miscellaneous Structs & Enums ---------------------------------
|
||||
ScrollContainerData :: struct {
|
||||
// Note: This is a pointer to the real internal scroll position, mutating it may cause a change in final layout.
|
||||
// Intended for use with external functionality that modifies scroll position, such as scroll bars or auto scrolling.
|
||||
scrollPosition: *Vector2;
|
||||
scrollContainerDimensions: Dimensions;
|
||||
contentDimensions: Dimensions;
|
||||
config: ScrollElementConfig;
|
||||
found: bool;
|
||||
}
|
||||
|
||||
RenderCommandType :: enum u8 {
|
||||
NONE :: 0;
|
||||
RECTANGLE :: 1;
|
||||
BORDER :: 2;
|
||||
TEXT :: 3;
|
||||
IMAGE :: 4;
|
||||
SCISSOR_START :: 5;
|
||||
SCISSOR_END :: 6;
|
||||
CUSTOM :: 7;
|
||||
CLAY_RENDER_COMMAND_TYPE_NONE :: NONE;
|
||||
CLAY_RENDER_COMMAND_TYPE_RECTANGLE :: RECTANGLE;
|
||||
CLAY_RENDER_COMMAND_TYPE_BORDER :: BORDER;
|
||||
CLAY_RENDER_COMMAND_TYPE_TEXT :: TEXT;
|
||||
CLAY_RENDER_COMMAND_TYPE_IMAGE :: IMAGE;
|
||||
CLAY_RENDER_COMMAND_TYPE_SCISSOR_START :: SCISSOR_START;
|
||||
CLAY_RENDER_COMMAND_TYPE_SCISSOR_END :: SCISSOR_END;
|
||||
CLAY_RENDER_COMMAND_TYPE_CUSTOM :: CUSTOM;
|
||||
}
|
||||
|
||||
RenderCommand :: struct {
|
||||
boundingBox: BoundingBox;
|
||||
config: ElementConfigUnion;
|
||||
text: String; // TODO I wish there was a way to avoid having to have this on every render command
|
||||
id: u32;
|
||||
commandType: RenderCommandType;
|
||||
}
|
||||
|
||||
RenderCommandArray :: struct {
|
||||
capacity: s32;
|
||||
length: s32;
|
||||
internalArray: *RenderCommand;
|
||||
}
|
||||
|
||||
PointerDataInteractionState :: enum u32 {
|
||||
PRESSED_THIS_FRAME :: 0;
|
||||
PRESSED :: 1;
|
||||
RELEASED_THIS_FRAME :: 2;
|
||||
RELEASED :: 3;
|
||||
CLAY_POINTER_DATA_PRESSED_THIS_FRAME :: PRESSED_THIS_FRAME;
|
||||
CLAY_POINTER_DATA_PRESSED :: PRESSED;
|
||||
CLAY_POINTER_DATA_RELEASED_THIS_FRAME :: RELEASED_THIS_FRAME;
|
||||
CLAY_POINTER_DATA_RELEASED :: RELEASED;
|
||||
}
|
||||
|
||||
PointerData :: struct {
|
||||
position: Vector2;
|
||||
state: PointerDataInteractionState;
|
||||
}
|
||||
|
||||
ErrorType :: enum u32 {
|
||||
TEXT_MEASUREMENT_FUNCTION_NOT_PROVIDED :: 0;
|
||||
ARENA_CAPACITY_EXCEEDED :: 1;
|
||||
ELEMENTS_CAPACITY_EXCEEDED :: 2;
|
||||
TEXT_MEASUREMENT_CAPACITY_EXCEEDED :: 3;
|
||||
DUPLICATE_ID :: 4;
|
||||
FLOATING_CONTAINER_PARENT_NOT_FOUND :: 5;
|
||||
INTERNAL_ERROR :: 6;
|
||||
CLAY_ERROR_TYPE_TEXT_MEASUREMENT_FUNCTION_NOT_PROVIDED :: TEXT_MEASUREMENT_FUNCTION_NOT_PROVIDED;
|
||||
CLAY_ERROR_TYPE_ARENA_CAPACITY_EXCEEDED :: ARENA_CAPACITY_EXCEEDED;
|
||||
CLAY_ERROR_TYPE_ELEMENTS_CAPACITY_EXCEEDED :: ELEMENTS_CAPACITY_EXCEEDED;
|
||||
CLAY_ERROR_TYPE_TEXT_MEASUREMENT_CAPACITY_EXCEEDED :: TEXT_MEASUREMENT_CAPACITY_EXCEEDED;
|
||||
CLAY_ERROR_TYPE_DUPLICATE_ID :: DUPLICATE_ID;
|
||||
CLAY_ERROR_TYPE_FLOATING_CONTAINER_PARENT_NOT_FOUND :: FLOATING_CONTAINER_PARENT_NOT_FOUND;
|
||||
CLAY_ERROR_TYPE_INTERNAL_ERROR :: INTERNAL_ERROR;
|
||||
}
|
||||
|
||||
ErrorData :: struct {
|
||||
errorType: ErrorType;
|
||||
errorText: String;
|
||||
userData: u64;
|
||||
}
|
||||
|
||||
ErrorHandler :: struct {
|
||||
errorHandlerFunction: #type (errorText: ErrorData) -> void #c_call;
|
||||
userData: u64;
|
||||
}
|
||||
|
||||
// Function Forward Declarations ---------------------------------
|
||||
// Public API functions ---
|
||||
MinMemorySize :: () -> u32 #foreign clay "Clay_MinMemorySize";
|
||||
CreateArenaWithCapacityAndMemory :: (capacity: u32, offset: *void) -> Arena #foreign clay "Clay_CreateArenaWithCapacityAndMemory";
|
||||
SetPointerState :: (position: Vector2, pointerDown: bool) -> void #foreign clay "Clay_SetPointerState";
|
||||
Initialize :: (arena: Arena, layoutDimensions: Dimensions, errorHandler: ErrorHandler) -> *Context #foreign clay "Clay_Initialize";
|
||||
GetCurrentContext :: () -> *Context #foreign clay "Clay_GetCurrentContext";
|
||||
SetCurrentContext :: (_context: *Context) -> void #foreign clay "Clay_SetCurrentContext";
|
||||
UpdateScrollContainers :: (enableDragScrolling: bool, scrollDelta: Vector2, deltaTime: float) -> void #foreign clay "Clay_UpdateScrollContainers";
|
||||
SetLayoutDimensions :: (dimensions: Dimensions) -> void #foreign clay "Clay_SetLayoutDimensions";
|
||||
BeginLayout :: () -> void #foreign clay "Clay_BeginLayout";
|
||||
EndLayout :: () -> RenderCommandArray #foreign clay "Clay_EndLayout";
|
||||
GetElementId :: (idString: String) -> ElementId #foreign clay "Clay_GetElementId";
|
||||
GetElementIdWithIndex :: (idString: String, index: u32) -> ElementId #foreign clay "Clay_GetElementIdWithIndex";
|
||||
|
||||
PointerOver :: (elementId: ElementId) -> bool #foreign clay "Clay_PointerOver";
|
||||
GetScrollContainerData :: (id: ElementId) -> ScrollContainerData #foreign clay "Clay_GetScrollContainerData";
|
||||
SetMeasureTextFunction :: (measureTextFunction: #type (text: *String, config: *TextElementConfig) -> Dimensions #c_call) -> void #foreign clay "Clay_SetMeasureTextFunction";
|
||||
SetQueryScrollOffsetFunction :: (queryScrollOffsetFunction: #type (elementId: u32) -> Vector2 #c_call) -> void #foreign clay "Clay_SetQueryScrollOffsetFunction";
|
||||
RenderCommandArray_Get :: (array: *RenderCommandArray, index: s32) -> *RenderCommand #foreign clay "Clay_RenderCommandArray_Get";
|
||||
SetDebugModeEnabled :: (enabled: bool) -> void #foreign clay "Clay_SetDebugModeEnabled";
|
||||
IsDebugModeEnabled :: () -> bool #foreign clay "Clay_IsDebugModeEnabled";
|
||||
SetCullingEnabled :: (enabled: bool) -> void #foreign clay "Clay_SetCullingEnabled";
|
||||
GetMaxElementCount :: () -> s32 #foreign clay "Clay_GetMaxElementCount";
|
||||
SetMaxElementCount :: (maxElementCount: s32) -> void #foreign clay "Clay_SetMaxElementCount";
|
||||
GetMaxMeasureTextCacheWordCount :: () -> s32 #foreign clay "Clay_GetMaxMeasureTextCacheWordCount";
|
||||
SetMaxMeasureTextCacheWordCount :: (maxMeasureTextCacheWordCount: s32) -> void #foreign clay "Clay_SetMaxMeasureTextCacheWordCount";
|
||||
|
||||
// Internal API functions required by macros
|
||||
_OpenElement :: () -> void #foreign clay "Clay__OpenElement";
|
||||
_CloseElement :: () -> void #foreign clay "Clay__CloseElement";
|
||||
_StoreLayoutConfig :: (config: LayoutConfig) -> *LayoutConfig #foreign clay "Clay__StoreLayoutConfig";
|
||||
_ElementPostConfiguration :: () -> void #foreign clay "Clay__ElementPostConfiguration";
|
||||
_AttachId :: (id: ElementId) -> void #foreign clay "Clay__AttachId";
|
||||
_AttachLayoutConfig :: (config: *LayoutConfig) -> void #foreign clay "Clay__AttachLayoutConfig";
|
||||
_AttachElementConfig :: (config: ElementConfigUnion, type: ElementConfigType) -> void #foreign clay "Clay__AttachElementConfig";
|
||||
_StoreRectangleElementConfig :: (config: RectangleElementConfig) -> *RectangleElementConfig #foreign clay "Clay__StoreRectangleElementConfig";
|
||||
_StoreTextElementConfig :: (config: TextElementConfig) -> *TextElementConfig #foreign clay "Clay__StoreTextElementConfig";
|
||||
_StoreImageElementConfig :: (config: ImageElementConfig) -> *ImageElementConfig #foreign clay "Clay__StoreImageElementConfig";
|
||||
_StoreFloatingElementConfig :: (config: FloatingElementConfig) -> *FloatingElementConfig #foreign clay "Clay__StoreFloatingElementConfig";
|
||||
_StoreCustomElementConfig :: (config: CustomElementConfig) -> *CustomElementConfig #foreign clay "Clay__StoreCustomElementConfig";
|
||||
_StoreScrollElementConfig :: (config: ScrollElementConfig) -> *ScrollElementConfig #foreign clay "Clay__StoreScrollElementConfig";
|
||||
_StoreBorderElementConfig :: (config: BorderElementConfig) -> *BorderElementConfig #foreign clay "Clay__StoreBorderElementConfig";
|
||||
_HashString :: (key: String, offset: u32, seed: u32) -> ElementId #foreign clay "Clay__HashString";
|
||||
_OpenTextElement :: (text: String, textConfig: *TextElementConfig) -> void #foreign clay "Clay__OpenTextElement";
|
||||
_GetParentElementId :: () -> u32 #foreign clay "Clay__GetParentElementId";
|
||||
|
||||
_debugViewHighlightColor: Color #elsewhere clay "Clay__debugViewHighlightColor";
|
||||
_debugViewWidth: u32 #elsewhere clay "Clay__debugViewWidth";
|
||||
|
||||
#scope_file
|
||||
|
||||
#import "Basic"; // For assert
|
||||
|
||||
clay :: #library,no_dll "linux/clay";
|
||||
|
||||
#run {
|
||||
{
|
||||
instance: String;
|
||||
assert(((cast(*void)(*instance.length)) - cast(*void)(*instance)) == 0, "String.length has unexpected offset % instead of 0", ((cast(*void)(*instance.length)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(String.length)) == 4, "String.length has unexpected size % instead of 4", size_of(type_of(String.length)));
|
||||
assert(((cast(*void)(*instance.chars)) - cast(*void)(*instance)) == 8, "String.chars has unexpected offset % instead of 8", ((cast(*void)(*instance.chars)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(String.chars)) == 8, "String.chars has unexpected size % instead of 8", size_of(type_of(String.chars)));
|
||||
assert(size_of(String) == 16, "String has size % instead of 16", size_of(String));
|
||||
}
|
||||
|
||||
{
|
||||
instance: _StringArray;
|
||||
assert(((cast(*void)(*instance.capacity)) - cast(*void)(*instance)) == 0, "_StringArray.capacity has unexpected offset % instead of 0", ((cast(*void)(*instance.capacity)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(_StringArray.capacity)) == 4, "_StringArray.capacity has unexpected size % instead of 4", size_of(type_of(_StringArray.capacity)));
|
||||
assert(((cast(*void)(*instance.length)) - cast(*void)(*instance)) == 4, "_StringArray.length has unexpected offset % instead of 4", ((cast(*void)(*instance.length)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(_StringArray.length)) == 4, "_StringArray.length has unexpected size % instead of 4", size_of(type_of(_StringArray.length)));
|
||||
assert(((cast(*void)(*instance.internalArray)) - cast(*void)(*instance)) == 8, "_StringArray.internalArray has unexpected offset % instead of 8", ((cast(*void)(*instance.internalArray)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(_StringArray.internalArray)) == 8, "_StringArray.internalArray has unexpected size % instead of 8", size_of(type_of(_StringArray.internalArray)));
|
||||
assert(size_of(_StringArray) == 16, "_StringArray has size % instead of 16", size_of(_StringArray));
|
||||
}
|
||||
|
||||
{
|
||||
instance: Arena;
|
||||
assert(((cast(*void)(*instance.nextAllocation)) - cast(*void)(*instance)) == 0, "Arena.nextAllocation has unexpected offset % instead of 0", ((cast(*void)(*instance.nextAllocation)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Arena.nextAllocation)) == 8, "Arena.nextAllocation has unexpected size % instead of 8", size_of(type_of(Arena.nextAllocation)));
|
||||
assert(((cast(*void)(*instance.capacity)) - cast(*void)(*instance)) == 8, "Arena.capacity has unexpected offset % instead of 8", ((cast(*void)(*instance.capacity)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Arena.capacity)) == 8, "Arena.capacity has unexpected size % instead of 8", size_of(type_of(Arena.capacity)));
|
||||
assert(((cast(*void)(*instance.memory)) - cast(*void)(*instance)) == 16, "Arena.memory has unexpected offset % instead of 16", ((cast(*void)(*instance.memory)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Arena.memory)) == 8, "Arena.memory has unexpected size % instead of 8", size_of(type_of(Arena.memory)));
|
||||
assert(size_of(Arena) == 24, "Arena has size % instead of 24", size_of(Arena));
|
||||
}
|
||||
|
||||
{
|
||||
instance: Dimensions;
|
||||
assert(((cast(*void)(*instance.width)) - cast(*void)(*instance)) == 0, "Dimensions.width has unexpected offset % instead of 0", ((cast(*void)(*instance.width)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Dimensions.width)) == 4, "Dimensions.width has unexpected size % instead of 4", size_of(type_of(Dimensions.width)));
|
||||
assert(((cast(*void)(*instance.height)) - cast(*void)(*instance)) == 4, "Dimensions.height has unexpected offset % instead of 4", ((cast(*void)(*instance.height)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Dimensions.height)) == 4, "Dimensions.height has unexpected size % instead of 4", size_of(type_of(Dimensions.height)));
|
||||
assert(size_of(Dimensions) == 8, "Dimensions has size % instead of 8", size_of(Dimensions));
|
||||
}
|
||||
|
||||
{
|
||||
instance: Color;
|
||||
assert(((cast(*void)(*instance.r)) - cast(*void)(*instance)) == 0, "Color.r has unexpected offset % instead of 0", ((cast(*void)(*instance.r)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Color.r)) == 4, "Color.r has unexpected size % instead of 4", size_of(type_of(Color.r)));
|
||||
assert(((cast(*void)(*instance.g)) - cast(*void)(*instance)) == 4, "Color.g has unexpected offset % instead of 4", ((cast(*void)(*instance.g)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Color.g)) == 4, "Color.g has unexpected size % instead of 4", size_of(type_of(Color.g)));
|
||||
assert(((cast(*void)(*instance.b)) - cast(*void)(*instance)) == 8, "Color.b has unexpected offset % instead of 8", ((cast(*void)(*instance.b)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Color.b)) == 4, "Color.b has unexpected size % instead of 4", size_of(type_of(Color.b)));
|
||||
assert(((cast(*void)(*instance.a)) - cast(*void)(*instance)) == 12, "Color.a has unexpected offset % instead of 12", ((cast(*void)(*instance.a)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Color.a)) == 4, "Color.a has unexpected size % instead of 4", size_of(type_of(Color.a)));
|
||||
assert(size_of(Color) == 16, "Color has size % instead of 16", size_of(Color));
|
||||
}
|
||||
|
||||
{
|
||||
instance: BoundingBox;
|
||||
assert(((cast(*void)(*instance.x)) - cast(*void)(*instance)) == 0, "BoundingBox.x has unexpected offset % instead of 0", ((cast(*void)(*instance.x)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(BoundingBox.x)) == 4, "BoundingBox.x has unexpected size % instead of 4", size_of(type_of(BoundingBox.x)));
|
||||
assert(((cast(*void)(*instance.y)) - cast(*void)(*instance)) == 4, "BoundingBox.y has unexpected offset % instead of 4", ((cast(*void)(*instance.y)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(BoundingBox.y)) == 4, "BoundingBox.y has unexpected size % instead of 4", size_of(type_of(BoundingBox.y)));
|
||||
assert(((cast(*void)(*instance.width)) - cast(*void)(*instance)) == 8, "BoundingBox.width has unexpected offset % instead of 8", ((cast(*void)(*instance.width)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(BoundingBox.width)) == 4, "BoundingBox.width has unexpected size % instead of 4", size_of(type_of(BoundingBox.width)));
|
||||
assert(((cast(*void)(*instance.height)) - cast(*void)(*instance)) == 12, "BoundingBox.height has unexpected offset % instead of 12", ((cast(*void)(*instance.height)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(BoundingBox.height)) == 4, "BoundingBox.height has unexpected size % instead of 4", size_of(type_of(BoundingBox.height)));
|
||||
assert(size_of(BoundingBox) == 16, "BoundingBox has size % instead of 16", size_of(BoundingBox));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ElementId;
|
||||
assert(((cast(*void)(*instance.id)) - cast(*void)(*instance)) == 0, "ElementId.id has unexpected offset % instead of 0", ((cast(*void)(*instance.id)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementId.id)) == 4, "ElementId.id has unexpected size % instead of 4", size_of(type_of(ElementId.id)));
|
||||
assert(((cast(*void)(*instance.offset)) - cast(*void)(*instance)) == 4, "ElementId.offset has unexpected offset % instead of 4", ((cast(*void)(*instance.offset)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementId.offset)) == 4, "ElementId.offset has unexpected size % instead of 4", size_of(type_of(ElementId.offset)));
|
||||
assert(((cast(*void)(*instance.baseId)) - cast(*void)(*instance)) == 8, "ElementId.baseId has unexpected offset % instead of 8", ((cast(*void)(*instance.baseId)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementId.baseId)) == 4, "ElementId.baseId has unexpected size % instead of 4", size_of(type_of(ElementId.baseId)));
|
||||
assert(((cast(*void)(*instance.stringId)) - cast(*void)(*instance)) == 16, "ElementId.stringId has unexpected offset % instead of 16", ((cast(*void)(*instance.stringId)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementId.stringId)) == 16, "ElementId.stringId has unexpected size % instead of 16", size_of(type_of(ElementId.stringId)));
|
||||
assert(size_of(ElementId) == 32, "ElementId has size % instead of 32", size_of(ElementId));
|
||||
}
|
||||
|
||||
{
|
||||
instance: CornerRadius;
|
||||
assert(((cast(*void)(*instance.topLeft)) - cast(*void)(*instance)) == 0, "CornerRadius.topLeft has unexpected offset % instead of 0", ((cast(*void)(*instance.topLeft)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(CornerRadius.topLeft)) == 4, "CornerRadius.topLeft has unexpected size % instead of 4", size_of(type_of(CornerRadius.topLeft)));
|
||||
assert(((cast(*void)(*instance.topRight)) - cast(*void)(*instance)) == 4, "CornerRadius.topRight has unexpected offset % instead of 4", ((cast(*void)(*instance.topRight)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(CornerRadius.topRight)) == 4, "CornerRadius.topRight has unexpected size % instead of 4", size_of(type_of(CornerRadius.topRight)));
|
||||
assert(((cast(*void)(*instance.bottomLeft)) - cast(*void)(*instance)) == 8, "CornerRadius.bottomLeft has unexpected offset % instead of 8", ((cast(*void)(*instance.bottomLeft)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(CornerRadius.bottomLeft)) == 4, "CornerRadius.bottomLeft has unexpected size % instead of 4", size_of(type_of(CornerRadius.bottomLeft)));
|
||||
assert(((cast(*void)(*instance.bottomRight)) - cast(*void)(*instance)) == 12, "CornerRadius.bottomRight has unexpected offset % instead of 12", ((cast(*void)(*instance.bottomRight)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(CornerRadius.bottomRight)) == 4, "CornerRadius.bottomRight has unexpected size % instead of 4", size_of(type_of(CornerRadius.bottomRight)));
|
||||
assert(size_of(CornerRadius) == 16, "CornerRadius has size % instead of 16", size_of(CornerRadius));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ChildAlignment;
|
||||
assert(((cast(*void)(*instance.x)) - cast(*void)(*instance)) == 0, "ChildAlignment.x has unexpected offset % instead of 0", ((cast(*void)(*instance.x)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ChildAlignment.x)) == 1, "ChildAlignment.x has unexpected size % instead of 1", size_of(type_of(ChildAlignment.x)));
|
||||
assert(((cast(*void)(*instance.y)) - cast(*void)(*instance)) == 1, "ChildAlignment.y has unexpected offset % instead of 1", ((cast(*void)(*instance.y)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ChildAlignment.y)) == 1, "ChildAlignment.y has unexpected size % instead of 1", size_of(type_of(ChildAlignment.y)));
|
||||
assert(size_of(ChildAlignment) == 2, "ChildAlignment has size % instead of 2", size_of(ChildAlignment));
|
||||
}
|
||||
|
||||
{
|
||||
instance: SizingMinMax;
|
||||
assert(((cast(*void)(*instance.min)) - cast(*void)(*instance)) == 0, "SizingMinMax.min has unexpected offset % instead of 0", ((cast(*void)(*instance.min)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(SizingMinMax.min)) == 4, "SizingMinMax.min has unexpected size % instead of 4", size_of(type_of(SizingMinMax.min)));
|
||||
assert(((cast(*void)(*instance.max)) - cast(*void)(*instance)) == 4, "SizingMinMax.max has unexpected offset % instead of 4", ((cast(*void)(*instance.max)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(SizingMinMax.max)) == 4, "SizingMinMax.max has unexpected size % instead of 4", size_of(type_of(SizingMinMax.max)));
|
||||
assert(size_of(SizingMinMax) == 8, "SizingMinMax has size % instead of 8", size_of(SizingMinMax));
|
||||
}
|
||||
|
||||
{
|
||||
instance: SizingAxis;
|
||||
assert(((cast(*void)(*instance.size)) - cast(*void)(*instance)) == 0, "SizingAxis.size has unexpected offset % instead of 0", ((cast(*void)(*instance.size)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(SizingAxis.size)) == 8, "SizingAxis.size has unexpected size % instead of 8", size_of(type_of(SizingAxis.size)));
|
||||
assert(((cast(*void)(*instance.type)) - cast(*void)(*instance)) == 8, "SizingAxis.type has unexpected offset % instead of 8", ((cast(*void)(*instance.type)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(SizingAxis.type)) == 1, "SizingAxis.type has unexpected size % instead of 1", size_of(type_of(SizingAxis.type)));
|
||||
assert(size_of(SizingAxis) == 12, "SizingAxis has size % instead of 12", size_of(SizingAxis));
|
||||
}
|
||||
|
||||
{
|
||||
instance: Sizing;
|
||||
assert(((cast(*void)(*instance.width)) - cast(*void)(*instance)) == 0, "Sizing.width has unexpected offset % instead of 0", ((cast(*void)(*instance.width)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Sizing.width)) == 12, "Sizing.width has unexpected size % instead of 12", size_of(type_of(Sizing.width)));
|
||||
assert(((cast(*void)(*instance.height)) - cast(*void)(*instance)) == 12, "Sizing.height has unexpected offset % instead of 12", ((cast(*void)(*instance.height)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Sizing.height)) == 12, "Sizing.height has unexpected size % instead of 12", size_of(type_of(Sizing.height)));
|
||||
assert(size_of(Sizing) == 24, "Sizing has size % instead of 24", size_of(Sizing));
|
||||
}
|
||||
|
||||
{
|
||||
instance: Padding;
|
||||
assert(((cast(*void)(*instance.x)) - cast(*void)(*instance)) == 0, "Padding.x has unexpected offset % instead of 0", ((cast(*void)(*instance.x)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Padding.x)) == 2, "Padding.x has unexpected size % instead of 2", size_of(type_of(Padding.x)));
|
||||
assert(((cast(*void)(*instance.y)) - cast(*void)(*instance)) == 2, "Padding.y has unexpected offset % instead of 2", ((cast(*void)(*instance.y)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(Padding.y)) == 2, "Padding.y has unexpected size % instead of 2", size_of(type_of(Padding.y)));
|
||||
assert(size_of(Padding) == 4, "Padding has size % instead of 4", size_of(Padding));
|
||||
}
|
||||
|
||||
{
|
||||
instance: LayoutConfig;
|
||||
assert(((cast(*void)(*instance.sizing)) - cast(*void)(*instance)) == 0, "LayoutConfig.sizing has unexpected offset % instead of 0", ((cast(*void)(*instance.sizing)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(LayoutConfig.sizing)) == 24, "LayoutConfig.sizing has unexpected size % instead of 24", size_of(type_of(LayoutConfig.sizing)));
|
||||
assert(((cast(*void)(*instance.padding)) - cast(*void)(*instance)) == 24, "LayoutConfig.padding has unexpected offset % instead of 24", ((cast(*void)(*instance.padding)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(LayoutConfig.padding)) == 4, "LayoutConfig.padding has unexpected size % instead of 4", size_of(type_of(LayoutConfig.padding)));
|
||||
assert(((cast(*void)(*instance.childGap)) - cast(*void)(*instance)) == 28, "LayoutConfig.childGap has unexpected offset % instead of 28", ((cast(*void)(*instance.childGap)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(LayoutConfig.childGap)) == 2, "LayoutConfig.childGap has unexpected size % instead of 2", size_of(type_of(LayoutConfig.childGap)));
|
||||
assert(((cast(*void)(*instance.childAlignment)) - cast(*void)(*instance)) == 30, "LayoutConfig.childAlignment has unexpected offset % instead of 30", ((cast(*void)(*instance.childAlignment)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(LayoutConfig.childAlignment)) == 2, "LayoutConfig.childAlignment has unexpected size % instead of 2", size_of(type_of(LayoutConfig.childAlignment)));
|
||||
assert(((cast(*void)(*instance.layoutDirection)) - cast(*void)(*instance)) == 32, "LayoutConfig.layoutDirection has unexpected offset % instead of 32", ((cast(*void)(*instance.layoutDirection)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(LayoutConfig.layoutDirection)) == 1, "LayoutConfig.layoutDirection has unexpected size % instead of 1", size_of(type_of(LayoutConfig.layoutDirection)));
|
||||
assert(size_of(LayoutConfig) == 36, "LayoutConfig has size % instead of 36", size_of(LayoutConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: RectangleElementConfig;
|
||||
assert(((cast(*void)(*instance.color)) - cast(*void)(*instance)) == 0, "RectangleElementConfig.color has unexpected offset % instead of 0", ((cast(*void)(*instance.color)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RectangleElementConfig.color)) == 16, "RectangleElementConfig.color has unexpected size % instead of 16", size_of(type_of(RectangleElementConfig.color)));
|
||||
assert(((cast(*void)(*instance.cornerRadius)) - cast(*void)(*instance)) == 16, "RectangleElementConfig.cornerRadius has unexpected offset % instead of 16", ((cast(*void)(*instance.cornerRadius)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RectangleElementConfig.cornerRadius)) == 16, "RectangleElementConfig.cornerRadius has unexpected size % instead of 16", size_of(type_of(RectangleElementConfig.cornerRadius)));
|
||||
assert(size_of(RectangleElementConfig) == 32, "RectangleElementConfig has size % instead of 32", size_of(RectangleElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: TextElementConfig;
|
||||
assert(((cast(*void)(*instance.textColor)) - cast(*void)(*instance)) == 0, "TextElementConfig.textColor has unexpected offset % instead of 0", ((cast(*void)(*instance.textColor)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.textColor)) == 16, "TextElementConfig.textColor has unexpected size % instead of 16", size_of(type_of(TextElementConfig.textColor)));
|
||||
assert(((cast(*void)(*instance.fontId)) - cast(*void)(*instance)) == 16, "TextElementConfig.fontId has unexpected offset % instead of 16", ((cast(*void)(*instance.fontId)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.fontId)) == 2, "TextElementConfig.fontId has unexpected size % instead of 2", size_of(type_of(TextElementConfig.fontId)));
|
||||
assert(((cast(*void)(*instance.fontSize)) - cast(*void)(*instance)) == 18, "TextElementConfig.fontSize has unexpected offset % instead of 18", ((cast(*void)(*instance.fontSize)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.fontSize)) == 2, "TextElementConfig.fontSize has unexpected size % instead of 2", size_of(type_of(TextElementConfig.fontSize)));
|
||||
assert(((cast(*void)(*instance.letterSpacing)) - cast(*void)(*instance)) == 20, "TextElementConfig.letterSpacing has unexpected offset % instead of 20", ((cast(*void)(*instance.letterSpacing)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.letterSpacing)) == 2, "TextElementConfig.letterSpacing has unexpected size % instead of 2", size_of(type_of(TextElementConfig.letterSpacing)));
|
||||
assert(((cast(*void)(*instance.lineHeight)) - cast(*void)(*instance)) == 22, "TextElementConfig.lineHeight has unexpected offset % instead of 22", ((cast(*void)(*instance.lineHeight)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.lineHeight)) == 2, "TextElementConfig.lineHeight has unexpected size % instead of 2", size_of(type_of(TextElementConfig.lineHeight)));
|
||||
assert(((cast(*void)(*instance.wrapMode)) - cast(*void)(*instance)) == 24, "TextElementConfig.wrapMode has unexpected offset % instead of 24", ((cast(*void)(*instance.wrapMode)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(TextElementConfig.wrapMode)) == 4, "TextElementConfig.wrapMode has unexpected size % instead of 4", size_of(type_of(TextElementConfig.wrapMode)));
|
||||
assert(size_of(TextElementConfig) == 28, "TextElementConfig has size % instead of 28", size_of(TextElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ImageElementConfig;
|
||||
assert(((cast(*void)(*instance.imageData)) - cast(*void)(*instance)) == 0, "ImageElementConfig.imageData has unexpected offset % instead of 0", ((cast(*void)(*instance.imageData)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ImageElementConfig.imageData)) == 8, "ImageElementConfig.imageData has unexpected size % instead of 8", size_of(type_of(ImageElementConfig.imageData)));
|
||||
assert(((cast(*void)(*instance.sourceDimensions)) - cast(*void)(*instance)) == 8, "ImageElementConfig.sourceDimensions has unexpected offset % instead of 8", ((cast(*void)(*instance.sourceDimensions)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ImageElementConfig.sourceDimensions)) == 8, "ImageElementConfig.sourceDimensions has unexpected size % instead of 8", size_of(type_of(ImageElementConfig.sourceDimensions)));
|
||||
assert(size_of(ImageElementConfig) == 16, "ImageElementConfig has size % instead of 16", size_of(ImageElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: FloatingAttachPoints;
|
||||
assert(((cast(*void)(*instance.element)) - cast(*void)(*instance)) == 0, "FloatingAttachPoints.element has unexpected offset % instead of 0", ((cast(*void)(*instance.element)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingAttachPoints.element)) == 1, "FloatingAttachPoints.element has unexpected size % instead of 1", size_of(type_of(FloatingAttachPoints.element)));
|
||||
assert(((cast(*void)(*instance.parent)) - cast(*void)(*instance)) == 1, "FloatingAttachPoints.parent has unexpected offset % instead of 1", ((cast(*void)(*instance.parent)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingAttachPoints.parent)) == 1, "FloatingAttachPoints.parent has unexpected size % instead of 1", size_of(type_of(FloatingAttachPoints.parent)));
|
||||
assert(size_of(FloatingAttachPoints) == 2, "FloatingAttachPoints has size % instead of 2", size_of(FloatingAttachPoints));
|
||||
}
|
||||
|
||||
{
|
||||
instance: FloatingElementConfig;
|
||||
assert(((cast(*void)(*instance.offset)) - cast(*void)(*instance)) == 0, "FloatingElementConfig.offset has unexpected offset % instead of 0", ((cast(*void)(*instance.offset)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.offset)) == 8, "FloatingElementConfig.offset has unexpected size % instead of 8", size_of(type_of(FloatingElementConfig.offset)));
|
||||
assert(((cast(*void)(*instance.expand)) - cast(*void)(*instance)) == 8, "FloatingElementConfig.expand has unexpected offset % instead of 8", ((cast(*void)(*instance.expand)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.expand)) == 8, "FloatingElementConfig.expand has unexpected size % instead of 8", size_of(type_of(FloatingElementConfig.expand)));
|
||||
assert(((cast(*void)(*instance.zIndex)) - cast(*void)(*instance)) == 16, "FloatingElementConfig.zIndex has unexpected offset % instead of 16", ((cast(*void)(*instance.zIndex)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.zIndex)) == 2, "FloatingElementConfig.zIndex has unexpected size % instead of 2", size_of(type_of(FloatingElementConfig.zIndex)));
|
||||
assert(((cast(*void)(*instance.parentId)) - cast(*void)(*instance)) == 20, "FloatingElementConfig.parentId has unexpected offset % instead of 20", ((cast(*void)(*instance.parentId)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.parentId)) == 4, "FloatingElementConfig.parentId has unexpected size % instead of 4", size_of(type_of(FloatingElementConfig.parentId)));
|
||||
assert(((cast(*void)(*instance.attachment)) - cast(*void)(*instance)) == 24, "FloatingElementConfig.attachment has unexpected offset % instead of 24", ((cast(*void)(*instance.attachment)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.attachment)) == 2, "FloatingElementConfig.attachment has unexpected size % instead of 2", size_of(type_of(FloatingElementConfig.attachment)));
|
||||
assert(((cast(*void)(*instance.pointerCaptureMode)) - cast(*void)(*instance)) == 28, "FloatingElementConfig.pointerCaptureMode has unexpected offset % instead of 28", ((cast(*void)(*instance.pointerCaptureMode)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(FloatingElementConfig.pointerCaptureMode)) == 4, "FloatingElementConfig.pointerCaptureMode has unexpected size % instead of 4", size_of(type_of(FloatingElementConfig.pointerCaptureMode)));
|
||||
assert(size_of(FloatingElementConfig) == 32, "FloatingElementConfig has size % instead of 32", size_of(FloatingElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: CustomElementConfig;
|
||||
assert(((cast(*void)(*instance.customData)) - cast(*void)(*instance)) == 0, "CustomElementConfig.customData has unexpected offset % instead of 0", ((cast(*void)(*instance.customData)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(CustomElementConfig.customData)) == 8, "CustomElementConfig.customData has unexpected size % instead of 8", size_of(type_of(CustomElementConfig.customData)));
|
||||
assert(size_of(CustomElementConfig) == 8, "CustomElementConfig has size % instead of 8", size_of(CustomElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ScrollElementConfig;
|
||||
assert(((cast(*void)(*instance.horizontal)) - cast(*void)(*instance)) == 0, "ScrollElementConfig.horizontal has unexpected offset % instead of 0", ((cast(*void)(*instance.horizontal)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollElementConfig.horizontal)) == 1, "ScrollElementConfig.horizontal has unexpected size % instead of 1", size_of(type_of(ScrollElementConfig.horizontal)));
|
||||
assert(((cast(*void)(*instance.vertical)) - cast(*void)(*instance)) == 1, "ScrollElementConfig.vertical has unexpected offset % instead of 1", ((cast(*void)(*instance.vertical)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollElementConfig.vertical)) == 1, "ScrollElementConfig.vertical has unexpected size % instead of 1", size_of(type_of(ScrollElementConfig.vertical)));
|
||||
assert(size_of(ScrollElementConfig) == 2, "ScrollElementConfig has size % instead of 2", size_of(ScrollElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ElementConfigUnion;
|
||||
assert(((cast(*void)(*instance.rectangleElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.rectangleElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.rectangleElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.rectangleElementConfig)) == 8, "ElementConfigUnion.rectangleElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.rectangleElementConfig)));
|
||||
assert(((cast(*void)(*instance.textElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.textElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.textElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.textElementConfig)) == 8, "ElementConfigUnion.textElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.textElementConfig)));
|
||||
assert(((cast(*void)(*instance.imageElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.imageElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.imageElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.imageElementConfig)) == 8, "ElementConfigUnion.imageElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.imageElementConfig)));
|
||||
assert(((cast(*void)(*instance.floatingElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.floatingElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.floatingElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.floatingElementConfig)) == 8, "ElementConfigUnion.floatingElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.floatingElementConfig)));
|
||||
assert(((cast(*void)(*instance.customElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.customElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.customElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.customElementConfig)) == 8, "ElementConfigUnion.customElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.customElementConfig)));
|
||||
assert(((cast(*void)(*instance.scrollElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.scrollElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.scrollElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.scrollElementConfig)) == 8, "ElementConfigUnion.scrollElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.scrollElementConfig)));
|
||||
assert(((cast(*void)(*instance.borderElementConfig)) - cast(*void)(*instance)) == 0, "ElementConfigUnion.borderElementConfig has unexpected offset % instead of 0", ((cast(*void)(*instance.borderElementConfig)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfigUnion.borderElementConfig)) == 8, "ElementConfigUnion.borderElementConfig has unexpected size % instead of 8", size_of(type_of(ElementConfigUnion.borderElementConfig)));
|
||||
assert(size_of(ElementConfigUnion) == 8, "ElementConfigUnion has size % instead of 8", size_of(ElementConfigUnion));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ElementConfig;
|
||||
assert(((cast(*void)(*instance.type)) - cast(*void)(*instance)) == 0, "ElementConfig.type has unexpected offset % instead of 0", ((cast(*void)(*instance.type)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfig.type)) == 1, "ElementConfig.type has unexpected size % instead of 1", size_of(type_of(ElementConfig.type)));
|
||||
assert(((cast(*void)(*instance.config)) - cast(*void)(*instance)) == 8, "ElementConfig.config has unexpected offset % instead of 8", ((cast(*void)(*instance.config)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ElementConfig.config)) == 8, "ElementConfig.config has unexpected size % instead of 8", size_of(type_of(ElementConfig.config)));
|
||||
assert(size_of(ElementConfig) == 16, "ElementConfig has size % instead of 16", size_of(ElementConfig));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ScrollContainerData;
|
||||
assert(((cast(*void)(*instance.scrollPosition)) - cast(*void)(*instance)) == 0, "ScrollContainerData.scrollPosition has unexpected offset % instead of 0", ((cast(*void)(*instance.scrollPosition)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollContainerData.scrollPosition)) == 8, "ScrollContainerData.scrollPosition has unexpected size % instead of 8", size_of(type_of(ScrollContainerData.scrollPosition)));
|
||||
assert(((cast(*void)(*instance.scrollContainerDimensions)) - cast(*void)(*instance)) == 8, "ScrollContainerData.scrollContainerDimensions has unexpected offset % instead of 8", ((cast(*void)(*instance.scrollContainerDimensions)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollContainerData.scrollContainerDimensions)) == 8, "ScrollContainerData.scrollContainerDimensions has unexpected size % instead of 8", size_of(type_of(ScrollContainerData.scrollContainerDimensions)));
|
||||
assert(((cast(*void)(*instance.contentDimensions)) - cast(*void)(*instance)) == 16, "ScrollContainerData.contentDimensions has unexpected offset % instead of 16", ((cast(*void)(*instance.contentDimensions)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollContainerData.contentDimensions)) == 8, "ScrollContainerData.contentDimensions has unexpected size % instead of 8", size_of(type_of(ScrollContainerData.contentDimensions)));
|
||||
assert(((cast(*void)(*instance.config)) - cast(*void)(*instance)) == 24, "ScrollContainerData.config has unexpected offset % instead of 24", ((cast(*void)(*instance.config)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollContainerData.config)) == 2, "ScrollContainerData.config has unexpected size % instead of 2", size_of(type_of(ScrollContainerData.config)));
|
||||
assert(((cast(*void)(*instance.found)) - cast(*void)(*instance)) == 26, "ScrollContainerData.found has unexpected offset % instead of 26", ((cast(*void)(*instance.found)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ScrollContainerData.found)) == 1, "ScrollContainerData.found has unexpected size % instead of 1", size_of(type_of(ScrollContainerData.found)));
|
||||
assert(size_of(ScrollContainerData) == 32, "ScrollContainerData has size % instead of 32", size_of(ScrollContainerData));
|
||||
}
|
||||
|
||||
{
|
||||
instance: RenderCommand;
|
||||
assert(((cast(*void)(*instance.boundingBox)) - cast(*void)(*instance)) == 0, "RenderCommand.boundingBox has unexpected offset % instead of 0", ((cast(*void)(*instance.boundingBox)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommand.boundingBox)) == 16, "RenderCommand.boundingBox has unexpected size % instead of 16", size_of(type_of(RenderCommand.boundingBox)));
|
||||
assert(((cast(*void)(*instance.config)) - cast(*void)(*instance)) == 16, "RenderCommand.config has unexpected offset % instead of 16", ((cast(*void)(*instance.config)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommand.config)) == 8, "RenderCommand.config has unexpected size % instead of 8", size_of(type_of(RenderCommand.config)));
|
||||
assert(((cast(*void)(*instance.text)) - cast(*void)(*instance)) == 24, "RenderCommand.text has unexpected offset % instead of 24", ((cast(*void)(*instance.text)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommand.text)) == 16, "RenderCommand.text has unexpected size % instead of 16", size_of(type_of(RenderCommand.text)));
|
||||
assert(((cast(*void)(*instance.id)) - cast(*void)(*instance)) == 40, "RenderCommand.id has unexpected offset % instead of 40", ((cast(*void)(*instance.id)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommand.id)) == 4, "RenderCommand.id has unexpected size % instead of 4", size_of(type_of(RenderCommand.id)));
|
||||
assert(((cast(*void)(*instance.commandType)) - cast(*void)(*instance)) == 44, "RenderCommand.commandType has unexpected offset % instead of 44", ((cast(*void)(*instance.commandType)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommand.commandType)) == 1, "RenderCommand.commandType has unexpected size % instead of 1", size_of(type_of(RenderCommand.commandType)));
|
||||
assert(size_of(RenderCommand) == 48, "RenderCommand has size % instead of 48", size_of(RenderCommand));
|
||||
}
|
||||
|
||||
{
|
||||
instance: RenderCommandArray;
|
||||
assert(((cast(*void)(*instance.capacity)) - cast(*void)(*instance)) == 0, "RenderCommandArray.capacity has unexpected offset % instead of 0", ((cast(*void)(*instance.capacity)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommandArray.capacity)) == 4, "RenderCommandArray.capacity has unexpected size % instead of 4", size_of(type_of(RenderCommandArray.capacity)));
|
||||
assert(((cast(*void)(*instance.length)) - cast(*void)(*instance)) == 4, "RenderCommandArray.length has unexpected offset % instead of 4", ((cast(*void)(*instance.length)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommandArray.length)) == 4, "RenderCommandArray.length has unexpected size % instead of 4", size_of(type_of(RenderCommandArray.length)));
|
||||
assert(((cast(*void)(*instance.internalArray)) - cast(*void)(*instance)) == 8, "RenderCommandArray.internalArray has unexpected offset % instead of 8", ((cast(*void)(*instance.internalArray)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(RenderCommandArray.internalArray)) == 8, "RenderCommandArray.internalArray has unexpected size % instead of 8", size_of(type_of(RenderCommandArray.internalArray)));
|
||||
assert(size_of(RenderCommandArray) == 16, "RenderCommandArray has size % instead of 16", size_of(RenderCommandArray));
|
||||
}
|
||||
|
||||
{
|
||||
instance: PointerData;
|
||||
assert(((cast(*void)(*instance.position)) - cast(*void)(*instance)) == 0, "PointerData.position has unexpected offset % instead of 0", ((cast(*void)(*instance.position)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(PointerData.position)) == 8, "PointerData.position has unexpected size % instead of 8", size_of(type_of(PointerData.position)));
|
||||
assert(((cast(*void)(*instance.state)) - cast(*void)(*instance)) == 8, "PointerData.state has unexpected offset % instead of 8", ((cast(*void)(*instance.state)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(PointerData.state)) == 4, "PointerData.state has unexpected size % instead of 4", size_of(type_of(PointerData.state)));
|
||||
assert(size_of(PointerData) == 12, "PointerData has size % instead of 12", size_of(PointerData));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ErrorData;
|
||||
assert(((cast(*void)(*instance.errorType)) - cast(*void)(*instance)) == 0, "ErrorData.errorType has unexpected offset % instead of 0", ((cast(*void)(*instance.errorType)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ErrorData.errorType)) == 4, "ErrorData.errorType has unexpected size % instead of 4", size_of(type_of(ErrorData.errorType)));
|
||||
assert(((cast(*void)(*instance.errorText)) - cast(*void)(*instance)) == 8, "ErrorData.errorText has unexpected offset % instead of 8", ((cast(*void)(*instance.errorText)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ErrorData.errorText)) == 16, "ErrorData.errorText has unexpected size % instead of 16", size_of(type_of(ErrorData.errorText)));
|
||||
assert(((cast(*void)(*instance.userData)) - cast(*void)(*instance)) == 24, "ErrorData.userData has unexpected offset % instead of 24", ((cast(*void)(*instance.userData)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ErrorData.userData)) == 8, "ErrorData.userData has unexpected size % instead of 8", size_of(type_of(ErrorData.userData)));
|
||||
assert(size_of(ErrorData) == 32, "ErrorData has size % instead of 32", size_of(ErrorData));
|
||||
}
|
||||
|
||||
{
|
||||
instance: ErrorHandler;
|
||||
assert(((cast(*void)(*instance.errorHandlerFunction)) - cast(*void)(*instance)) == 0, "ErrorHandler.errorHandlerFunction has unexpected offset % instead of 0", ((cast(*void)(*instance.errorHandlerFunction)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ErrorHandler.errorHandlerFunction)) == 8, "ErrorHandler.errorHandlerFunction has unexpected size % instead of 8", size_of(type_of(ErrorHandler.errorHandlerFunction)));
|
||||
assert(((cast(*void)(*instance.userData)) - cast(*void)(*instance)) == 8, "ErrorHandler.userData has unexpected offset % instead of 8", ((cast(*void)(*instance.userData)) - cast(*void)(*instance)));
|
||||
assert(size_of(type_of(ErrorHandler.userData)) == 8, "ErrorHandler.userData has unexpected size % instead of 8", size_of(type_of(ErrorHandler.userData)));
|
||||
assert(size_of(ErrorHandler) == 16, "ErrorHandler has size % instead of 16", size_of(ErrorHandler));
|
||||
}
|
||||
}
|
||||
|
||||
BIN
bindings/jai/clay-jai/linux/clay.a
Normal file
BIN
bindings/jai/clay-jai/linux/clay.a
Normal file
Binary file not shown.
296
bindings/jai/clay-jai/module.jai
Normal file
296
bindings/jai/clay-jai/module.jai
Normal file
|
|
@ -0,0 +1,296 @@
|
|||
/*
|
||||
These bindings adapt the CLAY macro using some for_expansion trickery, allowing a syntax similar to the one in the Odin bindings.
|
||||
I'll try to explain here why I did it that way.
|
||||
|
||||
In Odin, they can mark the procedure with deferred_none, allowing to call a proc after the current one, which works well with ifs.
|
||||
|
||||
@(require_results, deferred_none = _CloseElement)
|
||||
UI :: proc(configs: ..TypedConfig) -> bool {}
|
||||
|
||||
You can then use it like so :
|
||||
|
||||
if UI(Layout(), etc..) {Children ...}
|
||||
|
||||
So I tried to replicate this in Jai. The first thing I did was to try making a macro returning a bool with a backticked defer in it.
|
||||
|
||||
UI :: (configs: ..TypedConfig) -> bool #must #expand {
|
||||
`defer EndElement();
|
||||
return true;
|
||||
}
|
||||
|
||||
But this doesn't work if you have two elements side to side, as the end of the first element will be called after the start and the end of the second one.
|
||||
|
||||
Another option used in these bindings : https://github.com/nick-celestin-zizic/clay-jai is to have that defer like above and have the macro return nothing. You can then use it like that :
|
||||
|
||||
{ UI(Layout()); Children(); }
|
||||
|
||||
But I'm not a big fan of that since it's possible to forget the scope braces or to put the children before the element.
|
||||
|
||||
TODO This part is wrong... delete it and write the code that works
|
||||
|
||||
Another option to consider is to pass a code block to a macro that puts it between the start and the end.
|
||||
|
||||
UI :: (id: ElementId, layout: LayoutConfig, configs: ..ElementConfig, $code: Code) {
|
||||
OpenElement();
|
||||
...
|
||||
#insert code;
|
||||
CloseElement();
|
||||
}
|
||||
|
||||
UI(..., #code {
|
||||
Children();
|
||||
});
|
||||
|
||||
However this prevents to refer to variables from the previous scope, and it's also a bit akward to type.
|
||||
|
||||
The final solution I found, inspired by the fact that CLAY uses a for loop behind the scene, was to use Jai's for_expansions.
|
||||
Here is how it works :
|
||||
|
||||
InternalElementConfigArray :: struct {
|
||||
configs: [] TypedConfig;
|
||||
}
|
||||
|
||||
Element :: (configs: ..TypedConfig) -> InternalElementConfigArray #expand {
|
||||
return .{configs};
|
||||
}
|
||||
|
||||
for_expansion :: (configs_array: InternalElementConfigArray, body: Code, _: For_Flags) #expand {
|
||||
Jai forces the definition of these
|
||||
`it_index := 0;
|
||||
`it := 0;
|
||||
_OpenElement();
|
||||
...
|
||||
#insert body;
|
||||
_CloseElement();
|
||||
}
|
||||
|
||||
As you can see it's kinda similar to the previous one, but doesn't have the limitation on refering to variable from the calling scope.
|
||||
Element builds an InternalElementConfigArray that has an array to the TypedConfigs, which will be passed to the for_expansion when placed after a for (this is a Jai feature).
|
||||
This then allows to write something like :
|
||||
|
||||
for Element(Layout()) { Children(); }
|
||||
|
||||
With the downside that it's not obvious why the for is there before reading the documentation.
|
||||
*/
|
||||
|
||||
Vector2 :: Math.Vector2;
|
||||
|
||||
ElementConfigType :: enum u8 {
|
||||
NONE :: 0;
|
||||
RECTANGLE :: 1;
|
||||
BORDER_CONTAINER :: 2;
|
||||
FLOATING_CONTAINER :: 4;
|
||||
SCROLL_CONTAINER :: 8;
|
||||
IMAGE :: 16;
|
||||
TEXT :: 32;
|
||||
CUSTOM :: 64;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_NONE :: NONE;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_RECTANGLE :: RECTANGLE;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_BORDER_CONTAINER :: BORDER_CONTAINER;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_FLOATING_CONTAINER :: FLOATING_CONTAINER;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_SCROLL_CONTAINER :: SCROLL_CONTAINER;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_IMAGE :: IMAGE;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_TEXT :: TEXT;
|
||||
CLAY__ELEMENT_CONFIG_TYPE_CUSTOM :: CUSTOM;
|
||||
|
||||
// Jai bindings specific types, please don't assume any value in those
|
||||
// a it might change if the enums above overlap with it
|
||||
// TODO Check if these values need to be powers of two
|
||||
ID :: 250;
|
||||
LAYOUT :: 251;
|
||||
}
|
||||
|
||||
// This is passed to UI so that we can omit layout
|
||||
TypedConfig :: struct {
|
||||
type: ElementConfigType;
|
||||
config: *void;
|
||||
id: ElementId;
|
||||
}
|
||||
|
||||
BorderData :: struct {
|
||||
width: u32;
|
||||
color: Color;
|
||||
}
|
||||
|
||||
BorderElementConfig :: struct {
|
||||
left: BorderData;
|
||||
right: BorderData;
|
||||
top: BorderData;
|
||||
bottom: BorderData;
|
||||
betweenChildren: BorderData;
|
||||
cornerRadius: CornerRadius;
|
||||
}
|
||||
|
||||
make_string :: (str: string) -> String {
|
||||
clay_string := String.{cast(s32, str.count), str.data};
|
||||
return clay_string;
|
||||
}
|
||||
|
||||
global_counter := 0;
|
||||
|
||||
for_expansion :: (configs_array: InternalElementConfigArray, body: Code, _: For_Flags) #expand {
|
||||
// Jai forces the definition of these
|
||||
`it_index := 0;
|
||||
`it := 0;
|
||||
|
||||
_OpenElement();
|
||||
for config : configs_array.configs {
|
||||
if config.type == {
|
||||
case .ID;
|
||||
_AttachId(config.id);
|
||||
case .LAYOUT;
|
||||
_AttachLayoutConfig(cast(*LayoutConfig, config.config));
|
||||
case;
|
||||
// config.config is a *void, it stores the address of the pointer that is stored in the union
|
||||
// as ElementConfigUnion is a union of structs. We can't cast pointers directly to structs,
|
||||
// we first cast the address of the *void and then dereference it.
|
||||
// Maybe there's a cast modifier to avoid this, but I don't know it (no_check and trunc didn't work).
|
||||
_AttachElementConfig(cast(*ElementConfigUnion, *config.config).*, config.type);
|
||||
}
|
||||
}
|
||||
_ElementPostConfiguration();
|
||||
|
||||
#insert body;
|
||||
|
||||
_CloseElement();
|
||||
}
|
||||
|
||||
Element :: (configs: ..TypedConfig) -> InternalElementConfigArray #expand {
|
||||
return .{configs};
|
||||
}
|
||||
|
||||
ID :: (label: string, index: u32 = 0) -> TypedConfig {
|
||||
return .{type = .ID, id = _HashString(make_string(label), index, 0)};
|
||||
}
|
||||
|
||||
Layout :: (config: LayoutConfig) -> TypedConfig {
|
||||
return .{type = .LAYOUT, config = _StoreLayoutConfig(config)};
|
||||
}
|
||||
|
||||
Rectangle :: (config: RectangleElementConfig) -> TypedConfig {
|
||||
return .{
|
||||
type = .RECTANGLE,
|
||||
config = _StoreRectangleElementConfig(config)
|
||||
};
|
||||
}
|
||||
|
||||
Floating :: (config: FloatingElementConfig) -> TypedConfig {
|
||||
return .{type = .FLOATING_CONTAINER, config = _StoreFloatingElementConfig(config)};
|
||||
}
|
||||
|
||||
Scroll :: (config: ScrollElementConfig) -> TypedConfig {
|
||||
return .{type = .SCROLL_CONTAINER, config = _StoreScrollElementConfig(config)};
|
||||
}
|
||||
|
||||
Image :: (config: ImageElementConfig) -> TypedConfig {
|
||||
return .{type = .IMAGE, config = _StoreImageElementConfig(config)};
|
||||
}
|
||||
|
||||
Custom :: (config: CustomElementConfig) -> TypedConfig {
|
||||
return .{type = .CUSTOM, config = _StoreCustomElementConfig(config)};
|
||||
}
|
||||
|
||||
Border :: (config: BorderElementConfig) -> TypedConfig {
|
||||
return .{type = .BORDER, _StoreBorderElementConfig(config)};
|
||||
}
|
||||
|
||||
BorderOutside :: (outside_borders: BorderData) -> TypedConfig {
|
||||
return .{
|
||||
type = .BORDER,
|
||||
config = _StoreBorderElementConfig(BorderElementConfig.{
|
||||
left = outside_borders,
|
||||
right = outside_borders,
|
||||
top = outside_borders,
|
||||
bottom = outside_borders,
|
||||
}),
|
||||
};
|
||||
}
|
||||
|
||||
BorderOutsideRadius :: (outside_borders: BorderData, radius: float) -> TypedConfig {
|
||||
return .{
|
||||
type = .BORDER,
|
||||
config = _StoreBorderElementConfig(.{
|
||||
left = outside_borders,
|
||||
right = outside_borders,
|
||||
top = outside_borders,
|
||||
bottom = outside_borders,
|
||||
cornerRadius = .{radius, radius, radius, radius},
|
||||
})
|
||||
};
|
||||
}
|
||||
|
||||
BorderAll :: (all_borders: BorderData) -> TypedConfig {
|
||||
return .{
|
||||
type = .BORDER,
|
||||
config = _StoreBorderElementConfig(.{
|
||||
left = all_borders,
|
||||
right = all_borders,
|
||||
top = all_borders,
|
||||
bottom = all_borders,
|
||||
betweenChildren = all_borders,
|
||||
})
|
||||
};
|
||||
}
|
||||
|
||||
BorderAllRadius :: (all_borders: BorderData, radius: float) -> TypedConfig {
|
||||
return .{
|
||||
type = .BORDER,
|
||||
config = _StoreBorderElementConfig(.{
|
||||
left = all_borders,
|
||||
right = all_borders,
|
||||
top = all_borders,
|
||||
bottom = all_borders,
|
||||
cornerRadius = .{radius, radius, radius, radius},
|
||||
})
|
||||
};
|
||||
}
|
||||
|
||||
CornerRadiusAll :: (radius: float) -> CornerRadius {
|
||||
return .{radius, radius, radius, radius};
|
||||
}
|
||||
|
||||
Text :: (text: string, config: *TextElementConfig) {
|
||||
_OpenTextElement(make_string(text), config);
|
||||
}
|
||||
|
||||
TextConfig :: (config: TextElementConfig) -> *TextElementConfig {
|
||||
return _StoreTextElementConfig(config);
|
||||
}
|
||||
|
||||
SizingFit :: (size_min_max: SizingMinMax) -> SizingAxis {
|
||||
return .{type = .FIT, size = .{minMax = size_min_max}};
|
||||
}
|
||||
|
||||
SizingGrow :: (size_min_max: SizingMinMax = .{}) -> SizingAxis {
|
||||
return .{type = .GROW, size = .{minMax = size_min_max}};
|
||||
}
|
||||
|
||||
SizingFixed :: (size: float) -> SizingAxis {
|
||||
return .{type = .FIXED, size = .{minMax = .{size, size}}};
|
||||
}
|
||||
|
||||
SizingPercent :: (size_percent: float) -> SizingAxis {
|
||||
return .{type = .PERCENT, size = .{percent = size_percent}};
|
||||
}
|
||||
|
||||
GetElementId :: (str: string) -> ElementId {
|
||||
return GetElementId(make_string(str));
|
||||
}
|
||||
|
||||
#scope_module
|
||||
|
||||
Math :: #import "Math";
|
||||
Compiler :: #import "Compiler";
|
||||
ProgramPrint :: #import "Program_Print";
|
||||
|
||||
InternalElementConfigArray :: struct {
|
||||
configs: [] TypedConfig;
|
||||
}
|
||||
|
||||
#if OS == .WINDOWS {
|
||||
#load "windows.jai";
|
||||
} else #if OS == .LINUX {
|
||||
#load "linux.jai";
|
||||
} else {
|
||||
assert(false);
|
||||
}
|
||||
2
bindings/jai/clay-jai/source/clay.c
Normal file
2
bindings/jai/clay-jai/source/clay.c
Normal file
|
|
@ -0,0 +1,2 @@
|
|||
#define CLAY_IMPLEMENTATION
|
||||
#include "clay.h"
|
||||
1293
bindings/jai/clay-jai/windows.jai
Normal file
1293
bindings/jai/clay-jai/windows.jai
Normal file
File diff suppressed because it is too large
Load diff
BIN
bindings/jai/clay-jai/windows/clay.lib
Normal file
BIN
bindings/jai/clay-jai/windows/clay.lib
Normal file
Binary file not shown.
|
|
@ -0,0 +1,241 @@
|
|||
|
||||
RaylibFont :: struct {
|
||||
font_id: u16;
|
||||
font: Raylib.Font;
|
||||
}
|
||||
|
||||
g_raylib_fonts: [10]RaylibFont;
|
||||
|
||||
to_raylib_color :: (color: Clay.Color) -> Raylib.Color {
|
||||
return .{cast(u8) color.r, cast(u8) color.g, cast(u8) color.b, cast(u8) color.a};
|
||||
}
|
||||
|
||||
raylib_measure_text :: (text: *Clay.String, config: *Clay.TextElementConfig) -> Clay.Dimensions #c_call {
|
||||
text_size := Clay.Dimensions.{0, 0};
|
||||
|
||||
max_text_width: float = 0;
|
||||
line_text_width: float = 0;
|
||||
|
||||
text_height := cast(float)config.fontSize;
|
||||
font_to_use := g_raylib_fonts[config.fontId].font;
|
||||
|
||||
if text.length > 0 {
|
||||
for 0..(text.length - 1) {
|
||||
if text.chars[it] == #char "\n" {
|
||||
max_text_width = c_max(max_text_width, line_text_width);
|
||||
line_text_width = 0;
|
||||
continue;
|
||||
}
|
||||
|
||||
index := cast(s32, text.chars[it]) - 32;
|
||||
if font_to_use.glyphs[index].advanceX != 0 {
|
||||
line_text_width += cast(float) font_to_use.glyphs[index].advanceX;
|
||||
} else {
|
||||
line_text_width += (font_to_use.recs[index].width + cast(float) font_to_use.glyphs[index].offsetX);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
max_text_width = c_max(max_text_width, line_text_width);
|
||||
text_size.width = max_text_width / 2;
|
||||
text_size.height = text_height;
|
||||
|
||||
return text_size;
|
||||
}
|
||||
|
||||
raylib_initialize :: (width: s32, height: s32, $$title: string, flags: Raylib.ConfigFlags) {
|
||||
c_string_title: *u8;
|
||||
#if is_constant(title) {
|
||||
// Constant strings in Jai are null-terminated
|
||||
c_string_title = title.data;
|
||||
} else {
|
||||
c_string_title = to_c_string(title);
|
||||
}
|
||||
|
||||
Raylib.SetConfigFlags(flags);
|
||||
Raylib.InitWindow(width, height, c_string_title);
|
||||
}
|
||||
|
||||
clay_raylib_render :: (render_commands: Clay.RenderCommandArray) {
|
||||
for 0..render_commands.length - 1 {
|
||||
render_command := Clay.RenderCommandArray_Get(*render_commands, cast(s32) it);
|
||||
bounding_box := render_command.boundingBox;
|
||||
|
||||
if #complete render_command.commandType == {
|
||||
case .NONE;
|
||||
case .TEXT;
|
||||
text := string.{
|
||||
cast(s64) render_command.text.length,
|
||||
render_command.text.chars,
|
||||
};
|
||||
c_string_text := temp_c_string(text);
|
||||
|
||||
font_to_use: Raylib.Font = g_raylib_fonts[render_command.config.textElementConfig.fontId].font;
|
||||
Raylib.DrawTextEx(
|
||||
font_to_use,
|
||||
c_string_text,
|
||||
.{bounding_box.x, bounding_box.y},
|
||||
cast(float) render_command.config.textElementConfig.fontSize,
|
||||
cast(float) render_command.config.textElementConfig.letterSpacing,
|
||||
to_raylib_color(render_command.config.textElementConfig.textColor),
|
||||
);
|
||||
case .IMAGE;
|
||||
// TODO image handling
|
||||
image_texture := cast(*Raylib.Texture2D, render_command.config.imageElementConfig.imageData).*;
|
||||
Raylib.DrawTextureEx(
|
||||
image_texture,
|
||||
.{bounding_box.x, bounding_box.y},
|
||||
0,
|
||||
bounding_box.width / cast(float) image_texture.width,
|
||||
Raylib.WHITE
|
||||
);
|
||||
case .SCISSOR_START;
|
||||
Raylib.BeginScissorMode(
|
||||
cast(s32, round(bounding_box.x)),
|
||||
cast(s32, round(bounding_box.y)),
|
||||
cast(s32, round(bounding_box.width)),
|
||||
cast(s32, round(bounding_box.height)),
|
||||
);
|
||||
case .SCISSOR_END;
|
||||
Raylib.EndScissorMode();
|
||||
case .RECTANGLE;
|
||||
config := render_command.config.rectangleElementConfig;
|
||||
if config.cornerRadius.topLeft > 0 {
|
||||
radius := (config.cornerRadius.topLeft * 2.0) / min(bounding_box.width, bounding_box.height);
|
||||
Raylib.DrawRectangleRounded(
|
||||
.{bounding_box.x, bounding_box.y, bounding_box.width, bounding_box.height},
|
||||
radius,
|
||||
8,
|
||||
to_raylib_color(config.color),
|
||||
);
|
||||
} else {
|
||||
Raylib.DrawRectangle(
|
||||
cast(s32, bounding_box.x),
|
||||
cast(s32, bounding_box.y),
|
||||
cast(s32, bounding_box.width),
|
||||
cast(s32, bounding_box.height),
|
||||
to_raylib_color(config.color),
|
||||
);
|
||||
}
|
||||
case .BORDER;
|
||||
config := render_command.config.borderElementConfig;
|
||||
|
||||
// Left border
|
||||
if config.left.width > 0 {
|
||||
Raylib.DrawRectangle(
|
||||
cast(s32, round(bounding_box.x)),
|
||||
cast(s32, round(bounding_box.y + config.cornerRadius.topLeft)),
|
||||
cast(s32, config.left.width),
|
||||
cast(s32, round(bounding_box.height - config.cornerRadius.topLeft - config.cornerRadius.bottomLeft)),
|
||||
to_raylib_color(config.right.color),
|
||||
);
|
||||
}
|
||||
|
||||
// Right border
|
||||
if config.right.width > 0 {
|
||||
Raylib.DrawRectangle(
|
||||
cast(s32, round(bounding_box.x + bounding_box.width - cast(float, config.right.width))),
|
||||
cast(s32, round(bounding_box.y + config.cornerRadius.topRight)),
|
||||
cast(s32, config.right.width),
|
||||
cast(s32, round(bounding_box.height - config.cornerRadius.topRight - config.cornerRadius.bottomRight)),
|
||||
to_raylib_color(config.right.color),
|
||||
);
|
||||
}
|
||||
|
||||
// Top border
|
||||
if config.top.width > 0 {
|
||||
Raylib.DrawRectangle(
|
||||
cast(s32, round(bounding_box.x + config.cornerRadius.topLeft)),
|
||||
cast(s32, round(bounding_box.y)),
|
||||
cast(s32, round(bounding_box.width - config.cornerRadius.topLeft - config.cornerRadius.topRight)),
|
||||
cast(s32, config.top.width),
|
||||
to_raylib_color(config.right.color),
|
||||
);
|
||||
}
|
||||
|
||||
// Bottom border
|
||||
if config.bottom.width > 0 {
|
||||
Raylib.DrawRectangle(
|
||||
cast(s32, round(bounding_box.x + config.cornerRadius.bottomLeft)),
|
||||
cast(s32, round(bounding_box.y + bounding_box.height - cast(float, config.bottom.width))),
|
||||
cast(s32, round(bounding_box.width - config.cornerRadius.bottomLeft - config.cornerRadius.bottomRight)),
|
||||
cast(s32, config.top.width),
|
||||
to_raylib_color(config.right.color),
|
||||
);
|
||||
}
|
||||
|
||||
if config.cornerRadius.topLeft > 0 {
|
||||
Raylib.DrawRing(
|
||||
.{
|
||||
round(bounding_box.x + config.cornerRadius.topLeft),
|
||||
round(bounding_box.y + config.cornerRadius.topLeft),
|
||||
},
|
||||
round(config.cornerRadius.topLeft - cast(float, config.top.width)),
|
||||
config.cornerRadius.topLeft,
|
||||
180,
|
||||
270,
|
||||
10,
|
||||
to_raylib_color(config.top.color),
|
||||
);
|
||||
}
|
||||
|
||||
if config.cornerRadius.topRight > 0 {
|
||||
Raylib.DrawRing(
|
||||
.{
|
||||
round(bounding_box.x + bounding_box.width - config.cornerRadius.topRight),
|
||||
round(bounding_box.y + config.cornerRadius.topRight),
|
||||
},
|
||||
round(config.cornerRadius.topRight - cast(float, config.top.width)),
|
||||
config.cornerRadius.topRight,
|
||||
270,
|
||||
360,
|
||||
10,
|
||||
to_raylib_color(config.top.color),
|
||||
);
|
||||
}
|
||||
|
||||
if config.cornerRadius.bottomLeft > 0 {
|
||||
Raylib.DrawRing(
|
||||
.{
|
||||
round(bounding_box.x + config.cornerRadius.bottomLeft),
|
||||
round(bounding_box.y + bounding_box.height - config.cornerRadius.bottomLeft),
|
||||
},
|
||||
round(config.cornerRadius.bottomLeft - cast(float, config.bottom.width)),
|
||||
config.cornerRadius.bottomLeft,
|
||||
90,
|
||||
180,
|
||||
10,
|
||||
to_raylib_color(config.bottom.color),
|
||||
);
|
||||
}
|
||||
|
||||
if config.cornerRadius.bottomRight > 0 {
|
||||
Raylib.DrawRing(
|
||||
.{
|
||||
round(bounding_box.x + bounding_box.width - config.cornerRadius.bottomRight),
|
||||
round(bounding_box.y + bounding_box.height - config.cornerRadius.bottomRight),
|
||||
},
|
||||
round(config.cornerRadius.bottomRight - cast(float, config.bottom.width)),
|
||||
config.cornerRadius.bottomRight,
|
||||
0.1,
|
||||
90,
|
||||
10,
|
||||
to_raylib_color(config.bottom.color),
|
||||
);
|
||||
}
|
||||
case .CUSTOM;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#scope_file
|
||||
|
||||
round :: (x: float) -> float {
|
||||
rounded_int := cast(int, x + 0.5 * ifx x < 0 then -1 else 1);
|
||||
return cast(float, rounded_int);
|
||||
}
|
||||
|
||||
c_max :: (a: $T, b: T) -> T #c_call {
|
||||
if b < a return a;
|
||||
return b;
|
||||
}
|
||||
293
bindings/jai/examples/introducing_clay_video_demo/main.jai
Normal file
293
bindings/jai/examples/introducing_clay_video_demo/main.jai
Normal file
|
|
@ -0,0 +1,293 @@
|
|||
using Basic :: #import "Basic";
|
||||
|
||||
Clay :: #import,file "../../clay-jai/module.jai";
|
||||
Raylib :: #import "raylib-jai";
|
||||
|
||||
for_expansion :: Clay.for_expansion;;
|
||||
|
||||
#load "clay_renderer_raylib.jai";
|
||||
|
||||
FONT_ID_BODY_16 :: 0;
|
||||
COLOR_WHITE :: Clay.Color.{255, 255, 255, 255};
|
||||
|
||||
window_width: s32 = 1024;
|
||||
window_height: s32 = 768;
|
||||
|
||||
Document :: struct {
|
||||
title: string;
|
||||
contents: string;
|
||||
}
|
||||
|
||||
documents :: Document.[
|
||||
.{"Squirrels", "The Secret Life of Squirrels: Nature's Clever Acrobats\nSquirrels are often overlooked creatures, dismissed as mere park inhabitants or backyard nuisances. Yet, beneath their fluffy tails and twitching noses lies an intricate world of cunning, agility, and survival tactics that are nothing short of fascinating. As one of the most common mammals in North America, squirrels have adapted to a wide range of environments from bustling urban centers to tranquil forests and have developed a variety of unique behaviors that continue to intrigue scientists and nature enthusiasts alike.\n\nMaster Tree Climbers\nAt the heart of a squirrel's skill set is its impressive ability to navigate trees with ease. Whether they're darting from branch to branch or leaping across wide gaps, squirrels possess an innate talent for acrobatics. Their powerful hind legs, which are longer than their front legs, give them remarkable jumping power. With a tail that acts as a counterbalance, squirrels can leap distances of up to ten times the length of their body, making them some of the best aerial acrobats in the animal kingdom.\nBut it's not just their agility that makes them exceptional climbers. Squirrels' sharp, curved claws allow them to grip tree bark with precision, while the soft pads on their feet provide traction on slippery surfaces. Their ability to run at high speeds and scale vertical trunks with ease is a testament to the evolutionary adaptations that have made them so successful in their arboreal habitats.\n\nFood Hoarders Extraordinaire\nSquirrels are often seen frantically gathering nuts, seeds, and even fungi in preparation for winter. While this behavior may seem like instinctual hoarding, it is actually a survival strategy that has been honed over millions of years. Known as \"scatter hoarding,\" squirrels store their food in a variety of hidden locations, often burying it deep in the soil or stashing it in hollowed-out tree trunks.\nInterestingly, squirrels have an incredible memory for the locations of their caches. Research has shown that they can remember thousands of hiding spots, often returning to them months later when food is scarce. However, they don't always recover every stash some forgotten caches eventually sprout into new trees, contributing to forest regeneration. This unintentional role as forest gardeners highlights the ecological importance of squirrels in their ecosystems.\n\nThe Great Squirrel Debate: Urban vs. Wild\nWhile squirrels are most commonly associated with rural or wooded areas, their adaptability has allowed them to thrive in urban environments as well. In cities, squirrels have become adept at finding food sources in places like parks, streets, and even garbage cans. However, their urban counterparts face unique challenges, including traffic, predators, and the lack of natural shelters. Despite these obstacles, squirrels in urban areas are often observed using human infrastructure such as buildings, bridges, and power lines as highways for their acrobatic escapades.\nThere is, however, a growing concern regarding the impact of urban life on squirrel populations. Pollution, deforestation, and the loss of natural habitats are making it more difficult for squirrels to find adequate food and shelter. As a result, conservationists are focusing on creating squirrel-friendly spaces within cities, with the goal of ensuring these resourceful creatures continue to thrive in both rural and urban landscapes.\n\nA Symbol of Resilience\nIn many cultures, squirrels are symbols of resourcefulness, adaptability, and preparation. Their ability to thrive in a variety of environments while navigating challenges with agility and grace serves as a reminder of the resilience inherent in nature. Whether you encounter them in a quiet forest, a city park, or your own backyard, squirrels are creatures that never fail to amaze with their endless energy and ingenuity.\nIn the end, squirrels may be small, but they are mighty in their ability to survive and thrive in a world that is constantly changing. So next time you spot one hopping across a branch or darting across your lawn, take a moment to appreciate the remarkable acrobat at work a true marvel of the natural world."},
|
||||
.{"Lorem Ipsum", "Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum."},
|
||||
.{"Vacuum Instructions", "Chapter 3: Getting Started - Unpacking and Setup\n\nCongratulations on your new SuperClean Pro 5000 vacuum cleaner! In this section, we will guide you through the simple steps to get your vacuum up and running. Before you begin, please ensure that you have all the components listed in the \"Package Contents\" section on page 2.\n\n1. Unboxing Your Vacuum\nCarefully remove the vacuum cleaner from the box. Avoid using sharp objects that could damage the product. Once removed, place the unit on a flat, stable surface to proceed with the setup. Inside the box, you should find:\n\n The main vacuum unit\n A telescoping extension wand\n A set of specialized cleaning tools (crevice tool, upholstery brush, etc.)\n A reusable dust bag (if applicable)\n A power cord with a 3-prong plug\n A set of quick-start instructions\n\n2. Assembling Your Vacuum\nBegin by attaching the extension wand to the main body of the vacuum cleaner. Line up the connectors and twist the wand into place until you hear a click. Next, select the desired cleaning tool and firmly attach it to the wand's end, ensuring it is securely locked in.\n\nFor models that require a dust bag, slide the bag into the compartment at the back of the vacuum, making sure it is properly aligned with the internal mechanism. If your vacuum uses a bagless system, ensure the dust container is correctly seated and locked in place before use.\n\n3. Powering On\nTo start the vacuum, plug the power cord into a grounded electrical outlet. Once plugged in, locate the power switch, usually positioned on the side of the handle or body of the unit, depending on your model. Press the switch to the \"On\" position, and you should hear the motor begin to hum. If the vacuum does not power on, check that the power cord is securely plugged in, and ensure there are no blockages in the power switch.\n\nNote: Before first use, ensure that the vacuum filter (if your model has one) is properly installed. If unsure, refer to \"Section 5: Maintenance\" for filter installation instructions."},
|
||||
.{"Article 4", "Article 4"},
|
||||
.{"Article 5", "Article 5"},
|
||||
];
|
||||
|
||||
to_jai_string :: (str: Clay.String) -> string {
|
||||
return .{data = str.chars, count = cast(s64, str.length)};
|
||||
}
|
||||
|
||||
handle_clay_errors :: (error_data: Clay.ErrorData) #c_call {
|
||||
push_context {
|
||||
log_error(
|
||||
"Clay Error [%]: % | %",
|
||||
error_data.errorType,
|
||||
to_jai_string(error_data.errorText),
|
||||
error_data.userData
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
render_header_button :: (text: string) {
|
||||
for Clay.Element(
|
||||
Clay.Layout(.{padding = .{16, 8}}),
|
||||
Clay.Rectangle(.{
|
||||
color = .{140, 140, 140, 255},
|
||||
cornerRadius = .{5, 5, 5, 5},
|
||||
})
|
||||
) {
|
||||
Clay.Text(text, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 16,
|
||||
textColor = COLOR_WHITE,
|
||||
}));
|
||||
}
|
||||
}
|
||||
|
||||
render_dropdown_menu_item :: (text: string) {
|
||||
for Clay.Element(
|
||||
Clay.Layout(.{padding = .{16, 16}})
|
||||
) {
|
||||
Clay.Text(text, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 16,
|
||||
textColor = COLOR_WHITE,
|
||||
}));
|
||||
}
|
||||
}
|
||||
|
||||
selected_document_index : int = 0;
|
||||
|
||||
main :: () {
|
||||
flags := Raylib.ConfigFlags.WINDOW_RESIZABLE | .MSAA_4X_HINT | .VSYNC_HINT;
|
||||
raylib_initialize(1024, 768, "Introducing Clay Demo", flags);
|
||||
|
||||
// For some reason, on linux, this is 8 bytes off ???
|
||||
clay_required_memory := Clay.MinMemorySize() + 8;
|
||||
memory := alloc(clay_required_memory);
|
||||
clay_memory := Clay.CreateArenaWithCapacityAndMemory(clay_required_memory, memory);
|
||||
Clay.Initialize(
|
||||
clay_memory,
|
||||
Clay.Dimensions.{cast(float, Raylib.GetScreenWidth()), cast(float, Raylib.GetScreenHeight())},
|
||||
.{handle_clay_errors, 0}
|
||||
);
|
||||
|
||||
Clay.SetMeasureTextFunction(raylib_measure_text);
|
||||
g_raylib_fonts[FONT_ID_BODY_16] = .{
|
||||
FONT_ID_BODY_16,
|
||||
Raylib.LoadFontEx("resources/Roboto-Regular.ttf", 48, null, 400),
|
||||
};
|
||||
Raylib.SetTextureFilter(g_raylib_fonts[FONT_ID_BODY_16].font.texture, .BILINEAR);
|
||||
|
||||
while !Raylib.WindowShouldClose() {
|
||||
Clay.SetLayoutDimensions(.{
|
||||
cast(float, Raylib.GetScreenWidth()),
|
||||
cast(float, Raylib.GetScreenHeight()),
|
||||
});
|
||||
|
||||
mouse_position := Raylib.GetMousePosition();
|
||||
scroll_delta := Raylib.GetMouseWheelMoveV();
|
||||
Clay.SetPointerState(mouse_position, Raylib.IsMouseButtonDown(0));
|
||||
Clay.UpdateScrollContainers(true, scroll_delta, Raylib.GetFrameTime());
|
||||
|
||||
layout_expand := Clay.Sizing.{
|
||||
Clay.SizingGrow(),
|
||||
Clay.SizingGrow(),
|
||||
};
|
||||
|
||||
content_background_config := Clay.RectangleElementConfig.{
|
||||
color = .{90, 90, 90, 255},
|
||||
cornerRadius = .{8, 8, 8, 8},
|
||||
};
|
||||
|
||||
Clay.BeginLayout();
|
||||
for Clay.Element(
|
||||
Clay.ID("OuterContainer"),
|
||||
Clay.Rectangle(.{color = .{43, 41, 51, 255}}),
|
||||
Clay.Layout(.{
|
||||
layoutDirection = .TOP_TO_BOTTOM,
|
||||
sizing = layout_expand,
|
||||
padding = .{16, 16},
|
||||
childGap = 16,
|
||||
}),
|
||||
) {
|
||||
for Clay.Element(
|
||||
Clay.ID("HeaderBar"),
|
||||
Clay.Rectangle(content_background_config),
|
||||
Clay.Layout(.{
|
||||
sizing = .{
|
||||
height = Clay.SizingFixed(60),
|
||||
width = Clay.SizingGrow(),
|
||||
},
|
||||
padding = .{16, 16},
|
||||
childGap = 16,
|
||||
childAlignment = .{
|
||||
y = .CENTER,
|
||||
}
|
||||
}),
|
||||
) {
|
||||
for Clay.Element(
|
||||
Clay.ID("FileButton"),
|
||||
Clay.Layout(.{padding = .{16, 8}}),
|
||||
Clay.Rectangle(.{
|
||||
color = .{140, 140, 140, 255},
|
||||
cornerRadius = .{5, 5, 5, 5},
|
||||
}),
|
||||
) {
|
||||
Clay.Text("File", Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 16,
|
||||
textColor = COLOR_WHITE,
|
||||
}));
|
||||
|
||||
file_menu_visible := Clay.PointerOver(Clay.GetElementId("FileButton")) ||
|
||||
Clay.PointerOver(Clay.GetElementId("FileMenu"));
|
||||
|
||||
if file_menu_visible {
|
||||
for Clay.Element(
|
||||
Clay.ID("FileMenu"),
|
||||
Clay.Floating(.{attachment = .{parent = .LEFT_BOTTOM}}),
|
||||
Clay.Layout(.{padding = .{0, 8}})
|
||||
) {
|
||||
for Clay.Element(
|
||||
Clay.Layout(.{
|
||||
layoutDirection=.TOP_TO_BOTTOM,
|
||||
sizing = .{width = Clay.SizingFixed(200)}
|
||||
}),
|
||||
Clay.Rectangle(.{
|
||||
color = .{40, 40, 40, 255},
|
||||
cornerRadius = .{8, 8, 8, 8}
|
||||
})
|
||||
) {
|
||||
// Render dropdown items here
|
||||
render_dropdown_menu_item("New");
|
||||
render_dropdown_menu_item("Open");
|
||||
render_dropdown_menu_item("Close");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Render header buttons
|
||||
render_header_button("Edit");
|
||||
for Clay.Element(Clay.Layout(.{
|
||||
sizing = .{Clay.SizingGrow(), Clay.SizingGrow()}})) {}
|
||||
render_header_button("Upload");
|
||||
render_header_button("Media");
|
||||
render_header_button("Support");
|
||||
}
|
||||
|
||||
for Clay.Element(
|
||||
Clay.ID("LowerContent"),
|
||||
Clay.Layout(.{sizing = layout_expand, childGap = 16}),
|
||||
) {
|
||||
for Clay.Element(
|
||||
Clay.ID("Sidebar"),
|
||||
Clay.Rectangle(content_background_config),
|
||||
Clay.Layout(.{
|
||||
layoutDirection = .TOP_TO_BOTTOM,
|
||||
padding = .{16, 16},
|
||||
childGap = 8,
|
||||
sizing = .{
|
||||
width = Clay.SizingFixed(250),
|
||||
height = Clay.SizingGrow(),
|
||||
}
|
||||
})
|
||||
) {
|
||||
for document : documents {
|
||||
sidebar_button_layout := Clay.LayoutConfig.{
|
||||
sizing = .{width = Clay.SizingGrow()},
|
||||
padding = .{16, 16},
|
||||
};
|
||||
|
||||
if it_index == selected_document_index {
|
||||
for Clay.Element(
|
||||
Clay.Layout(sidebar_button_layout),
|
||||
Clay.Rectangle(.{
|
||||
color = .{120, 120, 120, 255},
|
||||
cornerRadius = .{8, 8, 8, 8},
|
||||
})
|
||||
) {
|
||||
Clay.Text(document.title, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 20,
|
||||
textColor = COLOR_WHITE,
|
||||
}));
|
||||
}
|
||||
} else {
|
||||
id := tprint("Parnets %", it_index);
|
||||
is_hovered := Clay.PointerOver(Clay.GetElementId(id));
|
||||
if is_hovered && Raylib.IsMouseButtonPressed(0) {
|
||||
selected_document_index = it_index;
|
||||
}
|
||||
|
||||
for Clay.Element(
|
||||
Clay.ID(id)
|
||||
) {
|
||||
for Clay.Element(
|
||||
Clay.Layout(sidebar_button_layout),
|
||||
ifx is_hovered then Clay.Rectangle(.{
|
||||
color = .{120, 120, 120, 120},
|
||||
cornerRadius = .{8, 8, 8, 8},
|
||||
}) else .{}
|
||||
) {
|
||||
Clay.Text(document.title, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 20,
|
||||
textColor = COLOR_WHITE
|
||||
}));
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for Clay.Element(
|
||||
Clay.ID("MainContent"),
|
||||
Clay.Rectangle(content_background_config),
|
||||
Clay.Scroll(.{vertical = true}),
|
||||
Clay.Layout(.{
|
||||
layoutDirection = .TOP_TO_BOTTOM,
|
||||
childGap = 16,
|
||||
padding = .{16, 16},
|
||||
sizing = layout_expand,
|
||||
}),
|
||||
) {
|
||||
selected_document := documents[selected_document_index];
|
||||
Clay.Text(selected_document.title, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 24,
|
||||
textColor = COLOR_WHITE,
|
||||
}));
|
||||
Clay.Text(selected_document.contents, Clay.TextConfig(.{
|
||||
fontId = FONT_ID_BODY_16,
|
||||
fontSize = 24,
|
||||
textColor = COLOR_WHITE
|
||||
}));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
render_commands := Clay.EndLayout();
|
||||
|
||||
Raylib.BeginDrawing();
|
||||
Raylib.ClearBackground(Raylib.BLACK);
|
||||
clay_raylib_render(render_commands);
|
||||
Raylib.EndDrawing();
|
||||
|
||||
reset_temporary_storage();
|
||||
}
|
||||
}
|
||||
4
bindings/jai/examples/introducing_clay_video_demo/modules/raylib-jai/.gitignore
vendored
Normal file
4
bindings/jai/examples/introducing_clay_video_demo/modules/raylib-jai/.gitignore
vendored
Normal file
|
|
@ -0,0 +1,4 @@
|
|||
.build
|
||||
.vscode
|
||||
raylib/
|
||||
.DS_Store
|
||||
File diff suppressed because it is too large
Load diff
Binary file not shown.
File diff suppressed because it is too large
Load diff
Binary file not shown.
|
|
@ -0,0 +1,148 @@
|
|||
|
||||
Vector2 :: Math.Vector2;
|
||||
Vector3 :: Math.Vector3;
|
||||
Vector4 :: Math.Vector4;
|
||||
Quaternion :: Math.Quaternion;
|
||||
Matrix :: Math.Matrix4;
|
||||
PI :: Math.PI;
|
||||
|
||||
LIGHTGRAY :: Color.{ 200, 200, 200, 255 };
|
||||
GRAY :: Color.{ 130, 130, 130, 255 };
|
||||
DARKGRAY :: Color.{ 80, 80, 80, 255 };
|
||||
YELLOW :: Color.{ 253, 249, 0, 255 };
|
||||
GOLD :: Color.{ 255, 203, 0, 255 };
|
||||
ORANGE :: Color.{ 255, 161, 0, 255 };
|
||||
PINK :: Color.{ 255, 109, 194, 255 };
|
||||
RED :: Color.{ 230, 41, 55, 255 };
|
||||
MAROON :: Color.{ 190, 33, 55, 255 };
|
||||
GREEN :: Color.{ 0, 228, 48, 255 };
|
||||
LIME :: Color.{ 0, 158, 47, 255 };
|
||||
DARKGREEN :: Color.{ 0, 117, 44, 255 };
|
||||
SKYBLUE :: Color.{ 102, 191, 255, 255 };
|
||||
BLUE :: Color.{ 0, 121, 241, 255 };
|
||||
DARKBLUE :: Color.{ 0, 82, 172, 255 };
|
||||
PURPLE :: Color.{ 200, 122, 255, 255 };
|
||||
VIOLET :: Color.{ 135, 60, 190, 255 };
|
||||
DARKPURPLE :: Color.{ 112, 31, 126, 255 };
|
||||
BEIGE :: Color.{ 211, 176, 131, 255 };
|
||||
BROWN :: Color.{ 127, 106, 79, 255 };
|
||||
DARKBROWN :: Color.{ 76, 63, 47, 255 };
|
||||
WHITE :: Color.{ 255, 255, 255, 255 };
|
||||
BLACK :: Color.{ 0, 0, 0, 255 };
|
||||
BLANK :: Color.{ 0, 0, 0, 0 };
|
||||
MAGENTA :: Color.{ 255, 0, 255, 255 };
|
||||
RAYWHITE :: Color.{ 245, 245, 245, 255 };
|
||||
|
||||
GetGamepadButtonPressed :: () -> GamepadButton #foreign raylib;
|
||||
|
||||
IsMouseButtonPressed :: (button: MouseButton) -> bool { return IsMouseButtonPressed(cast(s32) button); }
|
||||
IsMouseButtonDown :: (button: MouseButton) -> bool { return IsMouseButtonDown(cast(s32) button); }
|
||||
IsMouseButtonReleased :: (button: MouseButton) -> bool { return IsMouseButtonReleased(cast(s32) button); }
|
||||
IsMouseButtonUp :: (button: MouseButton) -> bool { return IsMouseButtonUp(cast(s32) button); }
|
||||
|
||||
IsKeyPressed :: (key: KeyboardKey) -> bool { return IsKeyPressed(cast(s32) key); }
|
||||
IsKeyPressedRepeat :: (key: KeyboardKey) -> bool { return IsKeyPressedRepeat(cast(s32) key); }
|
||||
IsKeyDown :: (key: KeyboardKey) -> bool { return IsKeyDown(cast(s32) key); }
|
||||
IsKeyReleased :: (key: KeyboardKey) -> bool { return IsKeyReleased(cast(s32) key); }
|
||||
IsKeyUp :: (key: KeyboardKey) -> bool { return IsKeyUp(cast(s32) key); }
|
||||
SetExitKey :: (key: KeyboardKey) -> void { return SetExitKey(cast(s32) key); }
|
||||
|
||||
SetConfigFlags :: (flags: ConfigFlags) -> void { return SetConfigFlags(cast(u32) flags); }
|
||||
|
||||
SetGesturesEnabled :: (flags: Gesture) -> void { return SetGesturesEnabled(cast(u32) flags); }
|
||||
IsGestureDetected :: (gesture: Gesture) -> bool { return IsGestureDetected(cast(u32) gesture); }
|
||||
|
||||
IsWindowState :: (flag: ConfigFlags) -> bool { return IsWindowState(cast(u32) flag); }
|
||||
SetWindowState :: (flags: ConfigFlags) -> void { return SetWindowState(cast(u32) flags); }
|
||||
ClearWindowState :: (flags: ConfigFlags) -> void { return ClearWindowState(cast(u32) flags); }
|
||||
|
||||
UpdateCamera :: (camera: *Camera, mode: CameraMode) -> void { return UpdateCamera(camera, cast(s32) mode); }
|
||||
|
||||
SetTraceLogLevel :: (logLevel: TraceLogLevel) -> void { return SetTraceLogLevel(cast(s32) logLevel); }
|
||||
TraceLog :: (logLevel: TraceLogLevel, text: string, __args: ..Any) { TraceLog(cast(s32) logLevel, text, __args); }
|
||||
|
||||
SetShaderValue :: (shader: Shader, locIndex: s32, value: *void, uniformType: ShaderUniformDataType) -> void {
|
||||
return SetShaderValue(shader, locIndex, value, cast(s32) uniformType);
|
||||
}
|
||||
SetShaderValueV :: (shader: Shader, locIndex: s32, value: *void, uniformType: ShaderUniformDataType, count: s32) -> void {
|
||||
return SetShaderValue(shader, locIndex, value, cast(s32) uniformType, count);
|
||||
}
|
||||
|
||||
IsGamepadButtonPressed :: (gamepad: s32, button: GamepadButton) -> bool { return IsGamepadButtonPressed(gamepad, cast(s32) button); }
|
||||
IsGamepadButtonDown :: (gamepad: s32, button: GamepadButton) -> bool { return IsGamepadButtonDown(gamepad, cast(s32) button); }
|
||||
IsGamepadButtonReleased :: (gamepad: s32, button: GamepadButton) -> bool { return IsGamepadButtonReleased(gamepad, cast(s32) button); }
|
||||
IsGamepadButtonUp :: (gamepad: s32, button: GamepadButton) -> bool { return IsGamepadButtonUp(gamepad, cast(s32) button); }
|
||||
|
||||
GetGamepadAxisMovement :: (gamepad: s32, axis: GamepadAxis) -> float { return GetGamepadAxisMovement(gamepad, cast(s32) axis); }
|
||||
|
||||
SetTextureFilter :: (texture: Texture2D, filter: TextureFilter) -> void { return SetTextureFilter(texture, cast(s32) filter); }
|
||||
SetTextureWrap :: (texture: Texture2D, wrap: TextureWrap) -> void { return SetTextureWrap(textuer, cast(s32) wrap); }
|
||||
|
||||
BeginBlendMode :: (mode: BlendMode) -> void { return BeginBlendMode(cast(s32) mode); }
|
||||
|
||||
ImageFormat :: (image: *Image, newFormat: PixelFormat) -> void { return ImageFormat(image, cast(s32) newFormat); }
|
||||
|
||||
LoadImageRaw :: (fileName: *u8, width: s32, height: s32, format: PixelFormat, headerSize: s32) -> Image {
|
||||
return LoadImageRaw(fileName, width, height, cast(s32) format, headerSize);
|
||||
}
|
||||
|
||||
LoadFontData :: (fileData: *u8, dataSize: s32, fontSize: s32, codepoints: *s32, codepointCount: s32, type: FontType) -> *GlyphInfo {
|
||||
return LoadFontData(fileData, dataSize, fontSize, codepoints, codepointCount, cast(s32) type);
|
||||
}
|
||||
|
||||
SetMouseCursor :: (cursor: MouseCursor) -> void { return SetMouseCursor(cast(s32) cursor); }
|
||||
|
||||
LoadTexture :: (data: *void, width: s32, height: s32, format: PixelFormat, mipmapCount: s32) -> u32 {
|
||||
return LoadTexture(data, width, height, cast(s32) format, mipmapCount);
|
||||
}
|
||||
|
||||
FramebufferAttach :: (fboId: u32, texId: u32, attachType: FramebufferAttachType, texType: FramebufferAttachTextureType, mipLevel: s32) -> void {
|
||||
return FramebufferAttach(fbiId, texId, cast(s32) attachType, cast(s32) texType, mipLevel);
|
||||
}
|
||||
|
||||
SetUniform :: (locIndex: s32, value: *void, uniformType: ShaderUniformDataType, count: s32) -> void { return SetUniform(locIndex, value, cast(s32) uniformType, count); }
|
||||
|
||||
SetMaterialTexture :: (material: *Material, mapType: MaterialMapIndex, texture: Texture2D) -> void { return SetMaterialTexture(material, mapType, texture); }
|
||||
|
||||
Camera3D :: struct {
|
||||
position: Vector3; // Camera position
|
||||
target: Vector3; // Camera target it looks-at
|
||||
up: Vector3; // Camera up vector (rotation over its axis)
|
||||
fovy: float; // Camera field-of-view aperture in Y (degrees) in perspective, used as near plane width in orthographic
|
||||
projection: CameraProjection; // Camera projection: CAMERA_PERSPECTIVE or CAMERA_ORTHOGRAPHIC
|
||||
}
|
||||
|
||||
TraceLogCallback :: #type (logLevel: TraceLogLevel, text: *u8, args: .. Any) #c_call;
|
||||
|
||||
#scope_module
|
||||
|
||||
#if OS == .WINDOWS {
|
||||
user32 :: #system_library,link_always "user32";
|
||||
gdi32 :: #system_library,link_always "gdi32";
|
||||
shell32 :: #system_library,link_always "shell32";
|
||||
winmm :: #system_library,link_always "winmm";
|
||||
|
||||
raylib :: #library,no_dll "windows/raylib";
|
||||
|
||||
#load "windows.jai";
|
||||
} else #if OS == .LINUX {
|
||||
math :: #system_library,link_always "m";
|
||||
raylib :: #library,no_dll "linux/raylib";
|
||||
|
||||
#load "linux.jai";
|
||||
} else #if OS == .MACOS {
|
||||
#system_library,link_always "Cocoa";
|
||||
#system_library,link_always "OpenGL";
|
||||
#system_library,link_always "CoreGraphics";
|
||||
#system_library,link_always "AppKit";
|
||||
#system_library,link_always "IOKit";
|
||||
|
||||
raylib :: #library,no_dll "macos/raylib";
|
||||
|
||||
#load "macos.jai";
|
||||
} else {
|
||||
assert(false);
|
||||
}
|
||||
|
||||
#import "Basic";
|
||||
Math :: #import "Math";
|
||||
File diff suppressed because it is too large
Load diff
Binary file not shown.
Binary file not shown.
|
|
@ -1,13 +1,13 @@
|
|||
cp ../../clay.h clay.c;
|
||||
# Intel Mac
|
||||
clang -c -DCLAY_IMPLEMENTATION -o clay.o -ffreestanding -static -target x86_64-apple-darwin clay.c -fPIC -O3 && ar r clay-odin/macos/clay.a clay.o;
|
||||
rm -f clay-odin/macos/clay.a && clang -c -DCLAY_IMPLEMENTATION -o clay.o -ffreestanding -static -target x86_64-apple-darwin clay.c -fPIC -O3 && ar r clay-odin/macos/clay.a clay.o;
|
||||
# ARM Mac
|
||||
clang -c -DCLAY_IMPLEMENTATION -g -o clay.o -static clay.c -fPIC -O3 && ar r clay-odin/macos-arm64/clay.a clay.o;
|
||||
rm -f clay-odin/macos-arm64/clay.a && clang -c -DCLAY_IMPLEMENTATION -g -o clay.o -static clay.c -fPIC -O3 && ar r clay-odin/macos-arm64/clay.a clay.o;
|
||||
# x64 Windows
|
||||
clang -c -DCLAY_IMPLEMENTATION -o clay-odin/windows/clay.lib -ffreestanding -target x86_64-pc-windows-msvc -fuse-ld=llvm-lib -static -O3 clay.c;
|
||||
rm -f clay-odin/windows/clay.lib && clang -c -DCLAY_IMPLEMENTATION -o clay-odin/windows/clay.lib -ffreestanding -target x86_64-pc-windows-msvc -fuse-ld=llvm-lib -static -O3 clay.c;
|
||||
# Linux
|
||||
clang -c -DCLAY_IMPLEMENTATION -o clay.o -ffreestanding -static -target x86_64-unknown-linux-gnu clay.c -fPIC -O3 && ar r clay-odin/linux/clay.a clay.o;
|
||||
rm -f clay-odin/linux/clay.a && clang -c -DCLAY_IMPLEMENTATION -o clay.o -ffreestanding -static -target x86_64-unknown-linux-gnu clay.c -fPIC -O3 && ar r clay-odin/linux/clay.a clay.o;
|
||||
# WASM
|
||||
clang -c -DCLAY_IMPLEMENTATION -o clay-odin/wasm/clay.o -target wasm32 -nostdlib -static -O3 clay.c;
|
||||
rm -f clay-odin/wasm/clay.o && clang -c -DCLAY_IMPLEMENTATION -o clay-odin/wasm/clay.o -target wasm32 -nostdlib -static -O3 clay.c;
|
||||
rm clay.o;
|
||||
rm clay.c;
|
||||
|
|
|
|||
|
|
@ -338,7 +338,6 @@ ClayArray :: struct($type: typeid) {
|
|||
}
|
||||
|
||||
ElementDeclaration :: struct {
|
||||
id: ElementId,
|
||||
layout: LayoutConfig,
|
||||
backgroundColor: Color,
|
||||
cornerRadius: CornerRadius,
|
||||
|
|
@ -378,6 +377,7 @@ Context :: struct {} // opaque structure, only use as a pointer
|
|||
@(link_prefix = "Clay_", default_calling_convention = "c")
|
||||
foreign Clay {
|
||||
_OpenElement :: proc() ---
|
||||
_OpenElementWithId :: proc(id: ElementId) ---
|
||||
_CloseElement :: proc() ---
|
||||
MinMemorySize :: proc() -> u32 ---
|
||||
CreateArenaWithCapacityAndMemory :: proc(capacity: c.size_t, offset: [^]u8) -> Arena ---
|
||||
|
|
@ -426,11 +426,19 @@ ConfigureOpenElement :: proc(config: ElementDeclaration) -> bool {
|
|||
}
|
||||
|
||||
@(deferred_none = _CloseElement)
|
||||
UI :: proc() -> proc (config: ElementDeclaration) -> bool {
|
||||
UI_WithId :: proc(id: ElementId) -> proc (config: ElementDeclaration) -> bool {
|
||||
_OpenElementWithId(id)
|
||||
return ConfigureOpenElement
|
||||
}
|
||||
|
||||
@(deferred_none = _CloseElement)
|
||||
UI_AutoId :: proc() -> proc (config: ElementDeclaration) -> bool {
|
||||
_OpenElement()
|
||||
return ConfigureOpenElement
|
||||
}
|
||||
|
||||
UI :: proc{UI_WithId, UI_AutoId};
|
||||
|
||||
Text :: proc($text: string, config: ^TextElementConfig) {
|
||||
wrapped := MakeString(text)
|
||||
wrapped.isStaticallyAllocated = true
|
||||
|
|
|
|||
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
|
|
@ -63,14 +63,12 @@ border2pxRed := clay.BorderElementConfig {
|
|||
}
|
||||
|
||||
LandingPageBlob :: proc(index: u32, fontSize: u16, fontId: u16, color: clay.Color, $text: string, image: ^raylib.Texture2D) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("HeroBlob", index),
|
||||
if clay.UI(clay.ID("HeroBlob", index))({
|
||||
layout = { sizing = { width = clay.SizingGrow({ max = 480 }) }, padding = clay.PaddingAll(16), childGap = 16, childAlignment = clay.ChildAlignment{ y = .Center } },
|
||||
border = border2pxRed,
|
||||
cornerRadius = clay.CornerRadiusAll(10)
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("CheckImage", index),
|
||||
if clay.UI(clay.ID("CheckImage", index))({
|
||||
layout = { sizing = { width = clay.SizingFixed(32) } },
|
||||
aspectRatio = { 1.0 },
|
||||
image = { imageData = image },
|
||||
|
|
@ -80,16 +78,14 @@ LandingPageBlob :: proc(index: u32, fontSize: u16, fontId: u16, color: clay.Colo
|
|||
}
|
||||
|
||||
LandingPageDesktop :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("LandingPage1Desktop"),
|
||||
if clay.UI(clay.ID("LandingPage1Desktop"))({
|
||||
layout = { sizing = { width = clay.SizingGrow(), height = clay.SizingFit({ min = cast(f32)windowHeight - 70 }) }, childAlignment = { y = .Center }, padding = { left = 50, right = 50 } },
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("LandingPage1"),
|
||||
if clay.UI(clay.ID("LandingPage1"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingGrow() }, childAlignment = { y = .Center }, padding = clay.PaddingAll(32), childGap = 32 },
|
||||
border = { COLOR_RED, { left = 2, right = 2 } },
|
||||
}) {
|
||||
if clay.UI()({ id = clay.ID("LeftText"), layout = { sizing = { width = clay.SizingPercent(0.55) }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
if clay.UI(clay.ID("LeftText"))({ layout = { sizing = { width = clay.SizingPercent(0.55) }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
clay.Text(
|
||||
"Clay is a flex-box style UI auto layout library in C, with declarative syntax and microsecond performance.",
|
||||
clay.TextConfig({fontSize = 56, fontId = FONT_ID_TITLE_56, textColor = COLOR_RED}),
|
||||
|
|
@ -100,8 +96,7 @@ LandingPageDesktop :: proc() {
|
|||
clay.TextConfig({fontSize = 36, fontId = FONT_ID_TITLE_36, textColor = COLOR_ORANGE}),
|
||||
)
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("HeroImageOuter"),
|
||||
if clay.UI(clay.ID("HeroImageOuter"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { width = clay.SizingPercent(0.45) }, childAlignment = { x = .Center }, childGap = 16 },
|
||||
}) {
|
||||
LandingPageBlob(1, 30, FONT_ID_BODY_30, COLOR_BLOB_BORDER_5, "High performance", &checkImage5)
|
||||
|
|
@ -115,8 +110,7 @@ LandingPageDesktop :: proc() {
|
|||
}
|
||||
|
||||
LandingPageMobile :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("LandingPage1Mobile"),
|
||||
if clay.UI(clay.ID("LandingPage1Mobile"))({
|
||||
layout = {
|
||||
layoutDirection = .TopToBottom,
|
||||
sizing = { width = clay.SizingGrow(), height = clay.SizingFit({ min = cast(f32)windowHeight - 70 }) },
|
||||
|
|
@ -125,7 +119,7 @@ LandingPageMobile :: proc() {
|
|||
childGap = 32,
|
||||
},
|
||||
}) {
|
||||
if clay.UI()({ id = clay.ID("LeftText"), layout = { sizing = { width = clay.SizingGrow() }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
if clay.UI(clay.ID("LeftText"))({ layout = { sizing = { width = clay.SizingGrow() }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
clay.Text(
|
||||
"Clay is a flex-box style UI auto layout library in C, with declarative syntax and microsecond performance.",
|
||||
clay.TextConfig({fontSize = 48, fontId = FONT_ID_TITLE_48, textColor = COLOR_RED}),
|
||||
|
|
@ -136,8 +130,7 @@ LandingPageMobile :: proc() {
|
|||
clay.TextConfig({fontSize = 32, fontId = FONT_ID_TITLE_32, textColor = COLOR_ORANGE}),
|
||||
)
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("HeroImageOuter"),
|
||||
if clay.UI(clay.ID("HeroImageOuter"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { width = clay.SizingGrow() }, childAlignment = { x = .Center }, childGap = 16 },
|
||||
}) {
|
||||
LandingPageBlob(1, 24, FONT_ID_BODY_24, COLOR_BLOB_BORDER_5, "High performance", &checkImage5)
|
||||
|
|
@ -151,18 +144,16 @@ LandingPageMobile :: proc() {
|
|||
|
||||
FeatureBlocks :: proc(widthSizing: clay.SizingAxis, outerPadding: u16) {
|
||||
textConfig := clay.TextConfig({fontSize = 24, fontId = FONT_ID_BODY_24, textColor = COLOR_RED})
|
||||
if clay.UI()({
|
||||
id = clay.ID("HFileBoxOuter"),
|
||||
if clay.UI(clay.ID("HFileBoxOuter"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { width = widthSizing }, childAlignment = { y = .Center }, padding = { outerPadding, outerPadding, 32, 32 }, childGap = 8 },
|
||||
}) {
|
||||
if clay.UI()({ id = clay.ID("HFileIncludeOuter"), layout = { padding = { 8, 8, 4, 4 } }, backgroundColor = COLOR_RED, cornerRadius = clay.CornerRadiusAll(8) }) {
|
||||
if clay.UI(clay.ID("HFileIncludeOuter"))({ layout = { padding = { 8, 8, 4, 4 } }, backgroundColor = COLOR_RED, cornerRadius = clay.CornerRadiusAll(8) }) {
|
||||
clay.Text("#include clay.h", clay.TextConfig({fontSize = 24, fontId = FONT_ID_BODY_24, textColor = COLOR_LIGHT}))
|
||||
}
|
||||
clay.Text("~2000 lines of C99.", textConfig)
|
||||
clay.Text("Zero dependencies, including no C standard library.", textConfig)
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("BringYourOwnRendererOuter"),
|
||||
if clay.UI(clay.ID("BringYourOwnRendererOuter"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { width = widthSizing }, childAlignment = { y = .Center }, padding = { outerPadding, outerPadding, 32, 32 }, childGap = 8 },
|
||||
}) {
|
||||
clay.Text("Renderer agnostic.", clay.TextConfig({fontId = FONT_ID_BODY_24, fontSize = 24, textColor = COLOR_ORANGE}))
|
||||
|
|
@ -172,9 +163,8 @@ FeatureBlocks :: proc(widthSizing: clay.SizingAxis, outerPadding: u16) {
|
|||
}
|
||||
|
||||
FeatureBlocksDesktop :: proc() {
|
||||
if clay.UI()({ id = clay.ID("FeatureBlocksOuter"), layout = { sizing = { width = clay.SizingGrow({}) } } }) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("FeatureBlocksInner"),
|
||||
if clay.UI(clay.ID("FeatureBlocksOuter"))({ layout = { sizing = { width = clay.SizingGrow({}) } } }) {
|
||||
if clay.UI(clay.ID("FeatureBlocksInner"))({
|
||||
layout = { sizing = { width = clay.SizingGrow() }, childAlignment = { y = .Center } },
|
||||
border = { width = { betweenChildren = 2}, color = COLOR_RED },
|
||||
}) {
|
||||
|
|
@ -184,8 +174,7 @@ FeatureBlocksDesktop :: proc() {
|
|||
}
|
||||
|
||||
FeatureBlocksMobile :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("FeatureBlocksInner"),
|
||||
if clay.UI(clay.ID("FeatureBlocksInner"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { width = clay.SizingGrow() } },
|
||||
border = { width = { betweenChildren = 2}, color = COLOR_RED },
|
||||
}) {
|
||||
|
|
@ -194,9 +183,9 @@ FeatureBlocksMobile :: proc() {
|
|||
}
|
||||
|
||||
DeclarativeSyntaxPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizing: clay.SizingAxis) {
|
||||
if clay.UI()({ id = clay.ID("SyntaxPageLeftText"), layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
if clay.UI(clay.ID("SyntaxPageLeftText"))({ layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
clay.Text("Declarative Syntax", clay.TextConfig(titleTextConfig))
|
||||
if clay.UI()({ id = clay.ID("SyntaxSpacer"), layout = { sizing = { width = clay.SizingGrow({ max = 16 }) } } }) {}
|
||||
if clay.UI(clay.ID("SyntaxSpacer"))({ layout = { sizing = { width = clay.SizingGrow({ max = 16 }) } } }) {}
|
||||
clay.Text(
|
||||
"Flexible and readable declarative syntax with nested UI element hierarchies.",
|
||||
clay.TextConfig({fontSize = 28, fontId = FONT_ID_BODY_28, textColor = COLOR_RED}),
|
||||
|
|
@ -210,9 +199,8 @@ DeclarativeSyntaxPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizi
|
|||
clay.TextConfig({fontSize = 28, fontId = FONT_ID_BODY_28, textColor = COLOR_RED}),
|
||||
)
|
||||
}
|
||||
if clay.UI()({ id = clay.ID("SyntaxPageRightImage"), layout = { sizing = { width = widthSizing }, childAlignment = { x = .Center } } }) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("SyntaxPageRightImageInner"),
|
||||
if clay.UI(clay.ID("SyntaxPageRightImage"))({ layout = { sizing = { width = widthSizing }, childAlignment = { x = .Center } } }) {
|
||||
if clay.UI(clay.ID("SyntaxPageRightImageInner"))({
|
||||
layout = { sizing = { width = clay.SizingGrow({ max = 568 }) } },
|
||||
aspectRatio = { 1136.0 / 1194.0 },
|
||||
image = { imageData = &syntaxImage },
|
||||
|
|
@ -221,12 +209,10 @@ DeclarativeSyntaxPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizi
|
|||
}
|
||||
|
||||
DeclarativeSyntaxPageDesktop :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("SyntaxPageDesktop"),
|
||||
if clay.UI(clay.ID("SyntaxPageDesktop"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) }, childAlignment = { y = .Center }, padding = { left = 50, right = 50 } },
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("SyntaxPage"),
|
||||
if clay.UI(clay.ID("SyntaxPage"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingGrow() }, childAlignment = { y = .Center }, padding = clay.PaddingAll(32), childGap = 32 },
|
||||
border = border2pxRed,
|
||||
}) {
|
||||
|
|
@ -236,8 +222,7 @@ DeclarativeSyntaxPageDesktop :: proc() {
|
|||
}
|
||||
|
||||
DeclarativeSyntaxPageMobile :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("SyntaxPageMobile"),
|
||||
if clay.UI(clay.ID("SyntaxPageMobile"))({
|
||||
layout = {
|
||||
layoutDirection = .TopToBottom,
|
||||
sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) },
|
||||
|
|
@ -257,7 +242,7 @@ ColorLerp :: proc(a: clay.Color, b: clay.Color, amount: f32) -> clay.Color {
|
|||
LOREM_IPSUM_TEXT :: "Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua."
|
||||
|
||||
HighPerformancePage :: proc(lerpValue: f32, titleTextConfig: clay.TextElementConfig, widthSizing: clay.SizingAxis) {
|
||||
if clay.UI()({ id = clay.ID("PerformanceLeftText"), layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
if clay.UI(clay.ID("PerformanceLeftText"))({ layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
clay.Text("High Performance", clay.TextConfig(titleTextConfig))
|
||||
if clay.UI()({ layout = { sizing = { width = clay.SizingGrow({ max = 16 }) } }}) {}
|
||||
clay.Text(
|
||||
|
|
@ -273,21 +258,18 @@ HighPerformancePage :: proc(lerpValue: f32, titleTextConfig: clay.TextElementCon
|
|||
clay.TextConfig({fontSize = 28, fontId = FONT_ID_BODY_36, textColor = COLOR_LIGHT}),
|
||||
)
|
||||
}
|
||||
if clay.UI()({ id = clay.ID("PerformanceRightImageOuter"), layout = { sizing = { width = widthSizing }, childAlignment = { x = .Center } } }) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("PerformanceRightBorder"),
|
||||
if clay.UI(clay.ID("PerformanceRightImageOuter"))({ layout = { sizing = { width = widthSizing }, childAlignment = { x = .Center } } }) {
|
||||
if clay.UI(clay.ID("PerformanceRightBorder"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(400) } },
|
||||
border = { COLOR_LIGHT, {2, 2, 2, 2, 2} },
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("AnimationDemoContainerLeft"),
|
||||
if clay.UI(clay.ID("AnimationDemoContainerLeft"))({
|
||||
layout = { sizing = { clay.SizingPercent(0.35 + 0.3 * lerpValue), clay.SizingGrow() }, childAlignment = { y = .Center }, padding = clay.PaddingAll(16) },
|
||||
backgroundColor = ColorLerp(COLOR_RED, COLOR_ORANGE, lerpValue),
|
||||
}) {
|
||||
clay.Text(LOREM_IPSUM_TEXT, clay.TextConfig({fontSize = 16, fontId = FONT_ID_BODY_16, textColor = COLOR_LIGHT}))
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("AnimationDemoContainerRight"),
|
||||
if clay.UI(clay.ID("AnimationDemoContainerRight"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingGrow() }, childAlignment = { y = .Center }, padding = clay.PaddingAll(16) },
|
||||
backgroundColor = ColorLerp(COLOR_ORANGE, COLOR_RED, lerpValue),
|
||||
}) {
|
||||
|
|
@ -298,8 +280,7 @@ HighPerformancePage :: proc(lerpValue: f32, titleTextConfig: clay.TextElementCon
|
|||
}
|
||||
|
||||
HighPerformancePageDesktop :: proc(lerpValue: f32) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("PerformanceDesktop"),
|
||||
if clay.UI(clay.ID("PerformanceDesktop"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) }, childAlignment = { y = .Center }, padding = { 82, 82, 32, 32 }, childGap = 64 },
|
||||
backgroundColor = COLOR_RED,
|
||||
}) {
|
||||
|
|
@ -308,8 +289,7 @@ HighPerformancePageDesktop :: proc(lerpValue: f32) {
|
|||
}
|
||||
|
||||
HighPerformancePageMobile :: proc(lerpValue: f32) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("PerformanceMobile"),
|
||||
if clay.UI(clay.ID("PerformanceMobile"))({
|
||||
layout = {
|
||||
layoutDirection = .TopToBottom,
|
||||
sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) },
|
||||
|
|
@ -335,8 +315,7 @@ RendererButtonActive :: proc(index: i32, $text: string) {
|
|||
|
||||
RendererButtonInactive :: proc(index: u32, $text: string) {
|
||||
if clay.UI()({ border = border2pxRed }) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("RendererButtonInactiveInner", index),
|
||||
if clay.UI(clay.ID("RendererButtonInactiveInner", index))({
|
||||
layout = { sizing = { width = clay.SizingFixed(300) }, padding = clay.PaddingAll(16) },
|
||||
backgroundColor = COLOR_LIGHT,
|
||||
cornerRadius = clay.CornerRadiusAll(10)
|
||||
|
|
@ -347,7 +326,7 @@ RendererButtonInactive :: proc(index: u32, $text: string) {
|
|||
}
|
||||
|
||||
RendererPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizing: clay.SizingAxis) {
|
||||
if clay.UI()({ id = clay.ID("RendererLeftText"), layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
if clay.UI(clay.ID("RendererLeftText"))({ layout = { sizing = { width = widthSizing }, layoutDirection = .TopToBottom, childGap = 8 } }) {
|
||||
clay.Text("Renderer & Platform Agnostic", clay.TextConfig(titleTextConfig))
|
||||
if clay.UI()({ layout = { sizing = { width = clay.SizingGrow({ max = 16 }) } } }) {}
|
||||
clay.Text(
|
||||
|
|
@ -363,8 +342,7 @@ RendererPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizing: clay.
|
|||
clay.TextConfig({fontSize = 28, fontId = FONT_ID_BODY_36, textColor = COLOR_RED}),
|
||||
)
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("RendererRightText"),
|
||||
if clay.UI(clay.ID("RendererRightText"))({
|
||||
layout = { sizing = { width = widthSizing }, childAlignment = { x = .Center }, layoutDirection = .TopToBottom, childGap = 16 },
|
||||
}) {
|
||||
clay.Text("Try changing renderer!", clay.TextConfig({fontSize = 36, fontId = FONT_ID_BODY_36, textColor = COLOR_ORANGE}))
|
||||
|
|
@ -374,12 +352,10 @@ RendererPage :: proc(titleTextConfig: clay.TextElementConfig, widthSizing: clay.
|
|||
}
|
||||
|
||||
RendererPageDesktop :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("RendererPageDesktop"),
|
||||
if clay.UI(clay.ID("RendererPageDesktop"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) }, childAlignment = { y = .Center }, padding = { left = 50, right = 50 } },
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("RendererPage"),
|
||||
if clay.UI(clay.ID("RendererPage"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingGrow() }, childAlignment = { y = .Center }, padding = clay.PaddingAll(32), childGap = 32 },
|
||||
border = { COLOR_RED, { left = 2, right = 2 } },
|
||||
}) {
|
||||
|
|
@ -389,8 +365,7 @@ RendererPageDesktop :: proc() {
|
|||
}
|
||||
|
||||
RendererPageMobile :: proc() {
|
||||
if clay.UI()({
|
||||
id = clay.ID("RendererMobile"),
|
||||
if clay.UI(clay.ID("RendererMobile"))({
|
||||
layout = {
|
||||
layoutDirection = .TopToBottom,
|
||||
sizing = { clay.SizingGrow(), clay.SizingFit({ min = cast(f32)windowHeight - 50 }) },
|
||||
|
|
@ -416,28 +391,25 @@ animationLerpValue: f32 = -1.0
|
|||
createLayout :: proc(lerpValue: f32) -> clay.ClayArray(clay.RenderCommand) {
|
||||
mobileScreen := windowWidth < 750
|
||||
clay.BeginLayout()
|
||||
if clay.UI()({
|
||||
id = clay.ID("OuterContainer"),
|
||||
if clay.UI(clay.ID("OuterContainer"))({
|
||||
layout = { layoutDirection = .TopToBottom, sizing = { clay.SizingGrow(), clay.SizingGrow() } },
|
||||
backgroundColor = COLOR_LIGHT,
|
||||
}) {
|
||||
if clay.UI()({
|
||||
id = clay.ID("Header"),
|
||||
if clay.UI(clay.ID("Header"))({
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(50) }, childAlignment = { y = .Center }, childGap = 24, padding = { left = 32, right = 32 } },
|
||||
}) {
|
||||
clay.Text("Clay", &headerTextConfig)
|
||||
if clay.UI()({ layout = { sizing = { width = clay.SizingGrow() } } }) {}
|
||||
|
||||
if (!mobileScreen) {
|
||||
if clay.UI()({ id = clay.ID("LinkExamplesOuter"), backgroundColor = {0, 0, 0, 0} }) {
|
||||
if clay.UI(clay.ID("LinkExamplesOuter"))({ backgroundColor = {0, 0, 0, 0} }) {
|
||||
clay.Text("Examples", clay.TextConfig({fontId = FONT_ID_BODY_24, fontSize = 24, textColor = {61, 26, 5, 255}}))
|
||||
}
|
||||
if clay.UI()({ id = clay.ID("LinkDocsOuter"), backgroundColor = {0, 0, 0, 0} }) {
|
||||
if clay.UI(clay.ID("LinkDocsOuter"))({ backgroundColor = {0, 0, 0, 0} }) {
|
||||
clay.Text("Docs", clay.TextConfig({fontId = FONT_ID_BODY_24, fontSize = 24, textColor = {61, 26, 5, 255}}))
|
||||
}
|
||||
}
|
||||
if clay.UI()({
|
||||
id = clay.ID("LinkGithubOuter"),
|
||||
if clay.UI(clay.ID("LinkGithubOuter"))({
|
||||
layout = { padding = { 16, 16, 6, 6 } },
|
||||
border = border2pxRed,
|
||||
backgroundColor = clay.Hovered() ? COLOR_LIGHT_HOVER : COLOR_LIGHT,
|
||||
|
|
@ -446,13 +418,12 @@ createLayout :: proc(lerpValue: f32) -> clay.ClayArray(clay.RenderCommand) {
|
|||
clay.Text("Github", clay.TextConfig({fontId = FONT_ID_BODY_24, fontSize = 24, textColor = {61, 26, 5, 255}}))
|
||||
}
|
||||
}
|
||||
if clay.UI()({ id = clay.ID("TopBorder1"), layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_5 } ) {}
|
||||
if clay.UI()({ id = clay.ID("TopBorder2"), layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_4 } ) {}
|
||||
if clay.UI()({ id = clay.ID("TopBorder3"), layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_3 } ) {}
|
||||
if clay.UI()({ id = clay.ID("TopBorder4"), layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_2 } ) {}
|
||||
if clay.UI()({ id = clay.ID("TopBorder5"), layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_1 } ) {}
|
||||
if clay.UI()({
|
||||
id = clay.ID("ScrollContainerBackgroundRectangle"),
|
||||
if clay.UI(clay.ID("TopBorder1"))({ layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_5 } ) {}
|
||||
if clay.UI(clay.ID("TopBorder2"))({ layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_4 } ) {}
|
||||
if clay.UI(clay.ID("TopBorder3"))({ layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_3 } ) {}
|
||||
if clay.UI(clay.ID("TopBorder4"))({ layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_2 } ) {}
|
||||
if clay.UI(clay.ID("TopBorder5"))({ layout = { sizing = { clay.SizingGrow(), clay.SizingFixed(4) } }, backgroundColor = COLOR_TOP_BORDER_1 } ) {}
|
||||
if clay.UI(clay.ID("ScrollContainerBackgroundRectangle"))({
|
||||
clip = { vertical = true, childOffset = clay.GetScrollOffset() },
|
||||
layout = { sizing = { clay.SizingGrow(), clay.SizingGrow() }, layoutDirection = clay.LayoutDirection.TopToBottom },
|
||||
backgroundColor = COLOR_LIGHT,
|
||||
|
|
|
|||
226
clay.h
226
clay.h
|
|
@ -121,25 +121,32 @@ static inline void Clay__SuppressUnusedLatchDefinitionVariableWarning(void) { (v
|
|||
|
||||
Into calls like this:
|
||||
|
||||
Clay_OpenElement();
|
||||
Clay_ConfigureOpenElement((Clay_ElementDeclaration) {
|
||||
Clay__OpenElement();
|
||||
Clay__ConfigureOpenElement((Clay_ElementDeclaration) {
|
||||
.id = CLAY_ID("Container"),
|
||||
.backgroundColor = { 255, 200, 200, 255 }
|
||||
});
|
||||
...children declared here
|
||||
Clay_CloseElement();
|
||||
Clay__CloseElement();
|
||||
|
||||
The for loop will only ever run a single iteration, putting Clay__CloseElement() in the increment of the loop
|
||||
means that it will run after the body - where the children are declared. It just exists to make sure you don't forget
|
||||
to call Clay_CloseElement().
|
||||
*/
|
||||
#define CLAY(...) \
|
||||
#define CLAY_AUTO_ID(...) \
|
||||
for ( \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH = (Clay__OpenElement(), Clay__ConfigureOpenElement(CLAY__CONFIG_WRAPPER(Clay_ElementDeclaration, __VA_ARGS__)), 0); \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH < 1; \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH=1, Clay__CloseElement() \
|
||||
)
|
||||
|
||||
#define CLAY(id, ...) \
|
||||
for ( \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH = (Clay__OpenElementWithId(id), Clay__ConfigureOpenElement(CLAY__CONFIG_WRAPPER(Clay_ElementDeclaration, __VA_ARGS__)), 0); \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH < 1; \
|
||||
CLAY__ELEMENT_DEFINITION_LATCH=1, Clay__CloseElement() \
|
||||
)
|
||||
|
||||
// These macros exist to allow the CLAY() macro to be called both with an inline struct definition, such as
|
||||
// CLAY({ .id = something... });
|
||||
// As well as by passing a predefined declaration struct
|
||||
|
|
@ -740,9 +747,6 @@ typedef struct Clay_PointerData {
|
|||
} Clay_PointerData;
|
||||
|
||||
typedef struct Clay_ElementDeclaration {
|
||||
// Primarily created via the CLAY_ID(), CLAY_IDI(), CLAY_ID_LOCAL() and CLAY_IDI_LOCAL() macros.
|
||||
// Represents a hashed string ID used for identifying and finding specific clay UI elements, required by functions such as Clay_PointerOver() and Clay_GetElementData().
|
||||
Clay_ElementId id;
|
||||
// Controls various settings that affect the size and position of an element, as well as the sizes and positions of any child elements.
|
||||
Clay_LayoutConfig layout;
|
||||
// Controls the background color of the resulting element.
|
||||
|
|
@ -789,6 +793,8 @@ typedef CLAY_PACKED_ENUM {
|
|||
CLAY_ERROR_TYPE_PERCENTAGE_OVER_1,
|
||||
// Clay encountered an internal error. It would be wonderful if you could report this so we can fix it!
|
||||
CLAY_ERROR_TYPE_INTERNAL_ERROR,
|
||||
// Clay__OpenElement was called more times than Clay__CloseElement, so there were still remaining open elements when the layout ended.
|
||||
CLAY_ERROR_TYPE_UNBALANCED_OPEN_CLOSE,
|
||||
} Clay_ErrorType;
|
||||
|
||||
// Data to identify the error that clay has encountered.
|
||||
|
|
@ -916,6 +922,7 @@ CLAY_DLL_EXPORT void Clay_ResetMeasureTextCache(void);
|
|||
// Internal API functions required by macros ----------------------
|
||||
|
||||
CLAY_DLL_EXPORT void Clay__OpenElement(void);
|
||||
CLAY_DLL_EXPORT void Clay__OpenElementWithId(Clay_ElementId elementId);
|
||||
CLAY_DLL_EXPORT void Clay__ConfigureOpenElement(const Clay_ElementDeclaration config);
|
||||
CLAY_DLL_EXPORT void Clay__ConfigureOpenElementPtr(const Clay_ElementDeclaration *config);
|
||||
CLAY_DLL_EXPORT void Clay__CloseElement(void);
|
||||
|
|
@ -1175,7 +1182,6 @@ typedef struct { // todo get this struct into a single cache line
|
|||
intptr_t hoverFunctionUserData;
|
||||
int32_t nextIndex;
|
||||
uint32_t generation;
|
||||
uint32_t idAlias;
|
||||
Clay__DebugElementData *debugData;
|
||||
} Clay_LayoutElementHashMapItem;
|
||||
|
||||
|
|
@ -1709,12 +1715,12 @@ bool Clay__PointIsInsideRect(Clay_Vector2 point, Clay_BoundingBox rect) {
|
|||
return point.x >= rect.x && point.x <= rect.x + rect.width && point.y >= rect.y && point.y <= rect.y + rect.height;
|
||||
}
|
||||
|
||||
Clay_LayoutElementHashMapItem* Clay__AddHashMapItem(Clay_ElementId elementId, Clay_LayoutElement* layoutElement, uint32_t idAlias) {
|
||||
Clay_LayoutElementHashMapItem* Clay__AddHashMapItem(Clay_ElementId elementId, Clay_LayoutElement* layoutElement) {
|
||||
Clay_Context* context = Clay_GetCurrentContext();
|
||||
if (context->layoutElementsHashMapInternal.length == context->layoutElementsHashMapInternal.capacity - 1) {
|
||||
return NULL;
|
||||
}
|
||||
Clay_LayoutElementHashMapItem item = { .elementId = elementId, .layoutElement = layoutElement, .nextIndex = -1, .generation = context->generation + 1, .idAlias = idAlias };
|
||||
Clay_LayoutElementHashMapItem item = { .elementId = elementId, .layoutElement = layoutElement, .nextIndex = -1, .generation = context->generation + 1 };
|
||||
uint32_t hashBucket = elementId.id % context->layoutElementsHashMap.capacity;
|
||||
int32_t hashItemPrevious = -1;
|
||||
int32_t hashItemIndex = context->layoutElementsHashMap.internalArray[hashBucket];
|
||||
|
|
@ -1724,7 +1730,6 @@ Clay_LayoutElementHashMapItem* Clay__AddHashMapItem(Clay_ElementId elementId, Cl
|
|||
item.nextIndex = hashItem->nextIndex;
|
||||
if (hashItem->generation <= context->generation) { // First collision - assume this is the "same" element
|
||||
hashItem->elementId = elementId; // Make sure to copy this across. If the stringId reference has changed, we should update the hash item to use the new one.
|
||||
hashItem->idAlias = idAlias;
|
||||
hashItem->generation = context->generation + 1;
|
||||
hashItem->layoutElement = layoutElement;
|
||||
hashItem->debugData->collision = false;
|
||||
|
|
@ -1773,7 +1778,7 @@ Clay_ElementId Clay__GenerateIdForAnonymousElement(Clay_LayoutElement *openLayou
|
|||
Clay_LayoutElement *parentElement = Clay_LayoutElementArray_Get(&context->layoutElements, Clay__int32_tArray_GetValue(&context->openLayoutElementStack, context->openLayoutElementStack.length - 2));
|
||||
Clay_ElementId elementId = Clay__HashNumber(parentElement->childrenOrTextContent.children.length, parentElement->id);
|
||||
openLayoutElement->id = elementId.id;
|
||||
Clay__AddHashMapItem(elementId, openLayoutElement, 0);
|
||||
Clay__AddHashMapItem(elementId, openLayoutElement);
|
||||
Clay__StringArray_Add(&context->layoutElementIdStrings, elementId.stringId);
|
||||
return elementId;
|
||||
}
|
||||
|
|
@ -1812,6 +1817,10 @@ void Clay__CloseElement(void) {
|
|||
}
|
||||
Clay_LayoutElement *openLayoutElement = Clay__GetOpenLayoutElement();
|
||||
Clay_LayoutConfig *layoutConfig = openLayoutElement->layoutConfig;
|
||||
if (!layoutConfig) {
|
||||
openLayoutElement->layoutConfig = &Clay_LayoutConfig_DEFAULT;
|
||||
layoutConfig = &Clay_LayoutConfig_DEFAULT;
|
||||
}
|
||||
bool elementHasClipHorizontal = false;
|
||||
bool elementHasClipVertical = false;
|
||||
for (int32_t i = 0; i < openLayoutElement->elementConfigs.length; i++) {
|
||||
|
|
@ -1988,8 +1997,28 @@ void Clay__OpenElement(void) {
|
|||
return;
|
||||
}
|
||||
Clay_LayoutElement layoutElement = CLAY__DEFAULT_STRUCT;
|
||||
Clay_LayoutElementArray_Add(&context->layoutElements, layoutElement);
|
||||
Clay_LayoutElement* openLayoutElement = Clay_LayoutElementArray_Add(&context->layoutElements, layoutElement);
|
||||
Clay__int32_tArray_Add(&context->openLayoutElementStack, context->layoutElements.length - 1);
|
||||
Clay__GenerateIdForAnonymousElement(openLayoutElement);
|
||||
if (context->openClipElementStack.length > 0) {
|
||||
Clay__int32_tArray_Set(&context->layoutElementClipElementIds, context->layoutElements.length - 1, Clay__int32_tArray_GetValue(&context->openClipElementStack, (int)context->openClipElementStack.length - 1));
|
||||
} else {
|
||||
Clay__int32_tArray_Set(&context->layoutElementClipElementIds, context->layoutElements.length - 1, 0);
|
||||
}
|
||||
}
|
||||
|
||||
void Clay__OpenElementWithId(Clay_ElementId elementId) {
|
||||
Clay_Context* context = Clay_GetCurrentContext();
|
||||
if (context->layoutElements.length == context->layoutElements.capacity - 1 || context->booleanWarnings.maxElementsExceeded) {
|
||||
context->booleanWarnings.maxElementsExceeded = true;
|
||||
return;
|
||||
}
|
||||
Clay_LayoutElement layoutElement = CLAY__DEFAULT_STRUCT;
|
||||
layoutElement.id = elementId.id;
|
||||
Clay_LayoutElement * openLayoutElement = Clay_LayoutElementArray_Add(&context->layoutElements, layoutElement);
|
||||
Clay__int32_tArray_Add(&context->openLayoutElementStack, context->layoutElements.length - 1);
|
||||
Clay__AddHashMapItem(elementId, openLayoutElement);
|
||||
Clay__StringArray_Add(&context->layoutElementIdStrings, elementId.stringId);
|
||||
if (context->openClipElementStack.length > 0) {
|
||||
Clay__int32_tArray_Set(&context->layoutElementClipElementIds, context->layoutElements.length - 1, Clay__int32_tArray_GetValue(&context->openClipElementStack, (int)context->openClipElementStack.length - 1));
|
||||
} else {
|
||||
|
|
@ -2017,7 +2046,7 @@ void Clay__OpenTextElement(Clay_String text, Clay_TextElementConfig *textConfig)
|
|||
Clay__MeasureTextCacheItem *textMeasured = Clay__MeasureTextCached(&text, textConfig);
|
||||
Clay_ElementId elementId = Clay__HashNumber(parentElement->childrenOrTextContent.children.length, parentElement->id);
|
||||
textElement->id = elementId.id;
|
||||
Clay__AddHashMapItem(elementId, textElement, 0);
|
||||
Clay__AddHashMapItem(elementId, textElement);
|
||||
Clay__StringArray_Add(&context->layoutElementIdStrings, elementId.stringId);
|
||||
Clay_Dimensions textDimensions = { .width = textMeasured->unwrappedDimensions.width, .height = textConfig->lineHeight > 0 ? (float)textConfig->lineHeight : textMeasured->unwrappedDimensions.height };
|
||||
textElement->dimensions = textDimensions;
|
||||
|
|
@ -2031,19 +2060,6 @@ void Clay__OpenTextElement(Clay_String text, Clay_TextElementConfig *textConfig)
|
|||
parentElement->childrenOrTextContent.children.length++;
|
||||
}
|
||||
|
||||
Clay_ElementId Clay__AttachId(Clay_ElementId elementId) {
|
||||
Clay_Context* context = Clay_GetCurrentContext();
|
||||
if (context->booleanWarnings.maxElementsExceeded) {
|
||||
return Clay_ElementId_DEFAULT;
|
||||
}
|
||||
Clay_LayoutElement *openLayoutElement = Clay__GetOpenLayoutElement();
|
||||
uint32_t idAlias = openLayoutElement->id;
|
||||
openLayoutElement->id = elementId.id;
|
||||
Clay__AddHashMapItem(elementId, openLayoutElement, idAlias);
|
||||
Clay__StringArray_Set(&context->layoutElementIdStrings, context->layoutElements.length - 1, elementId.stringId);
|
||||
return elementId;
|
||||
}
|
||||
|
||||
void Clay__ConfigureOpenElementPtr(const Clay_ElementDeclaration *declaration) {
|
||||
Clay_Context* context = Clay_GetCurrentContext();
|
||||
Clay_LayoutElement *openLayoutElement = Clay__GetOpenLayoutElement();
|
||||
|
|
@ -2055,8 +2071,6 @@ void Clay__ConfigureOpenElementPtr(const Clay_ElementDeclaration *declaration) {
|
|||
.userData = context->errorHandler.userData });
|
||||
}
|
||||
|
||||
Clay_ElementId openLayoutElementId = declaration->id;
|
||||
|
||||
openLayoutElement->elementConfigs.internalArray = &context->elementConfigs.internalArray[context->elementConfigs.length];
|
||||
Clay_SharedElementConfig *sharedConfig = NULL;
|
||||
if (declaration->backgroundColor.a > 0) {
|
||||
|
|
@ -2111,9 +2125,6 @@ void Clay__ConfigureOpenElementPtr(const Clay_ElementDeclaration *declaration) {
|
|||
} else if (declaration->floating.attachTo == CLAY_ATTACH_TO_ROOT) {
|
||||
floatingConfig.parentId = Clay__HashString(CLAY_STRING("Clay__RootContainer"), 0).id;
|
||||
}
|
||||
if (!openLayoutElementId.id) {
|
||||
openLayoutElementId = Clay__HashStringWithOffset(CLAY_STRING("Clay__FloatingContainer"), context->layoutElementTreeRoots.length, 0);
|
||||
}
|
||||
if (declaration->floating.clipTo == CLAY_CLIP_TO_NONE) {
|
||||
clipElementId = 0;
|
||||
}
|
||||
|
|
@ -2133,12 +2144,6 @@ void Clay__ConfigureOpenElementPtr(const Clay_ElementDeclaration *declaration) {
|
|||
Clay__AttachElementConfig(CLAY__INIT(Clay_ElementConfigUnion) { .customElementConfig = Clay__StoreCustomElementConfig(declaration->custom) }, CLAY__ELEMENT_CONFIG_TYPE_CUSTOM);
|
||||
}
|
||||
|
||||
if (openLayoutElementId.id != 0) {
|
||||
Clay__AttachId(openLayoutElementId);
|
||||
} else if (openLayoutElement->id == 0) {
|
||||
openLayoutElementId = Clay__GenerateIdForAnonymousElement(openLayoutElement);
|
||||
}
|
||||
|
||||
if (declaration->clip.horizontal | declaration->clip.vertical) {
|
||||
Clay__AttachElementConfig(CLAY__INIT(Clay_ElementConfigUnion) { .clipElementConfig = Clay__StoreClipElementConfig(declaration->clip) }, CLAY__ELEMENT_CONFIG_TYPE_CLIP);
|
||||
Clay__int32_tArray_Add(&context->openClipElementStack, (int)openLayoutElement->id);
|
||||
|
|
@ -2787,12 +2792,6 @@ void Clay__CalculateFinalLayout(void) {
|
|||
Clay_LayoutElementHashMapItem *hashMapItem = Clay__GetHashMapItem(currentElement->id);
|
||||
if (hashMapItem) {
|
||||
hashMapItem->boundingBox = currentElementBoundingBox;
|
||||
if (hashMapItem->idAlias) {
|
||||
Clay_LayoutElementHashMapItem *hashMapItemAlias = Clay__GetHashMapItem(hashMapItem->idAlias);
|
||||
if (hashMapItemAlias) {
|
||||
hashMapItemAlias->boundingBox = currentElementBoundingBox;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
int32_t sortedConfigIndexes[20];
|
||||
|
|
@ -3190,8 +3189,8 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
Clay__int32_tArray_Add(&dfsBuffer, (int32_t)root->layoutElementIndex);
|
||||
context->treeNodeVisited.internalArray[0] = false;
|
||||
if (rootIndex > 0) {
|
||||
CLAY({ .id = CLAY_IDI("Clay__DebugView_EmptyRowOuter", rootIndex), .layout = { .sizing = {.width = CLAY_SIZING_GROW(0)}, .padding = {CLAY__DEBUGVIEW_INDENT_WIDTH / 2, 0, 0, 0} } }) {
|
||||
CLAY({ .id = CLAY_IDI("Clay__DebugView_EmptyRow", rootIndex), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED((float)CLAY__DEBUGVIEW_ROW_HEIGHT) }}, .border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { .top = 1 } } }) {}
|
||||
CLAY(CLAY_IDI("Clay__DebugView_EmptyRowOuter", rootIndex), { .layout = { .sizing = {.width = CLAY_SIZING_GROW(0)}, .padding = {CLAY__DEBUGVIEW_INDENT_WIDTH / 2, 0, 0, 0} } }) {
|
||||
CLAY(CLAY_IDI("Clay__DebugView_EmptyRow", rootIndex), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED((float)CLAY__DEBUGVIEW_ROW_HEIGHT) }}, .border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { .top = 1 } } }) {}
|
||||
}
|
||||
layoutData.rowCount++;
|
||||
}
|
||||
|
|
@ -3221,11 +3220,10 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
if (context->debugSelectedElementId == currentElement->id) {
|
||||
layoutData.selectedElementRowIndex = layoutData.rowCount;
|
||||
}
|
||||
CLAY({ .id = CLAY_IDI("Clay__DebugView_ElementOuter", currentElement->id), .layout = Clay__DebugView_ScrollViewItemLayoutConfig }) {
|
||||
CLAY(CLAY_IDI("Clay__DebugView_ElementOuter", currentElement->id), { .layout = Clay__DebugView_ScrollViewItemLayoutConfig }) {
|
||||
// Collapse icon / button
|
||||
if (!(Clay__ElementHasConfig(currentElement, CLAY__ELEMENT_CONFIG_TYPE_TEXT) || currentElement->childrenOrTextContent.children.length == 0)) {
|
||||
CLAY({
|
||||
.id = CLAY_IDI("Clay__DebugView_CollapseElement", currentElement->id),
|
||||
CLAY(CLAY_IDI("Clay__DebugView_CollapseElement", currentElement->id), {
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED(16), CLAY_SIZING_FIXED(16)}, .childAlignment = { CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER} },
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4),
|
||||
.border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = {1, 1, 1, 1, 0} },
|
||||
|
|
@ -3233,19 +3231,19 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
CLAY_TEXT((currentElementData && currentElementData->debugData->collapsed) ? CLAY_STRING("+") : CLAY_STRING("-"), CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
} else { // Square dot for empty containers
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_FIXED(16), CLAY_SIZING_FIXED(16)}, .childAlignment = { CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_FIXED(8), CLAY_SIZING_FIXED(8)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3, .cornerRadius = CLAY_CORNER_RADIUS(2) }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_FIXED(16), CLAY_SIZING_FIXED(16)}, .childAlignment = { CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_FIXED(8), CLAY_SIZING_FIXED(8)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3, .cornerRadius = CLAY_CORNER_RADIUS(2) }) {}
|
||||
}
|
||||
}
|
||||
// Collisions and offscreen info
|
||||
if (currentElementData) {
|
||||
if (currentElementData->debugData->collision) {
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 }}, .border = { .color = {177, 147, 8, 255}, .width = {1, 1, 1, 1, 0} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 }}, .border = { .color = {177, 147, 8, 255}, .width = {1, 1, 1, 1, 0} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Duplicate ID"), CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_3, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
if (offscreen) {
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 } }, .border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { 1, 1, 1, 1, 0} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 } }, .border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { 1, 1, 1, 1, 0} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Offscreen"), CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_3, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
|
|
@ -3262,12 +3260,12 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
Clay_Color backgroundColor = elementConfig->config.sharedElementConfig->backgroundColor;
|
||||
Clay_CornerRadius radius = elementConfig->config.sharedElementConfig->cornerRadius;
|
||||
if (backgroundColor.a > 0) {
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = labelColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = labelColor, .width = { 1, 1, 1, 1, 0} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = labelColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = labelColor, .width = { 1, 1, 1, 1, 0} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Color"), CLAY_TEXT_CONFIG({ .textColor = offscreen ? CLAY__DEBUGVIEW_COLOR_3 : CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
if (radius.bottomLeft > 0) {
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = labelColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = labelColor, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = labelColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = labelColor, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Radius"), CLAY_TEXT_CONFIG({ .textColor = offscreen ? CLAY__DEBUGVIEW_COLOR_3 : CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
|
|
@ -3276,7 +3274,7 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
Clay__DebugElementConfigTypeLabelConfig config = Clay__DebugGetElementConfigTypeLabel(elementConfig->type);
|
||||
Clay_Color backgroundColor = config.color;
|
||||
backgroundColor.a = 90;
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = backgroundColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = config.color, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = backgroundColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = config.color, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_TEXT(config.label, CLAY_TEXT_CONFIG({ .textColor = offscreen ? CLAY__DEBUGVIEW_COLOR_3 : CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
|
|
@ -3287,8 +3285,8 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
layoutData.rowCount++;
|
||||
Clay__TextElementData *textElementData = currentElement->childrenOrTextContent.textElementData;
|
||||
Clay_TextElementConfig *rawTextConfig = offscreen ? CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_3, .fontSize = 16 }) : &Clay__DebugView_TextNameConfig;
|
||||
CLAY({ .layout = { .sizing = { .height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY({ .layout = { .sizing = {.width = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_INDENT_WIDTH + 16) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {.width = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_INDENT_WIDTH + 16) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("\""), rawTextConfig);
|
||||
CLAY_TEXT(textElementData->text.length > 40 ? (CLAY__INIT(Clay_String) { .length = 40, .chars = textElementData->text.chars }) : textElementData->text, rawTextConfig);
|
||||
if (textElementData->text.length > 40) {
|
||||
|
|
@ -3328,8 +3326,8 @@ Clay__RenderDebugLayoutData Clay__RenderDebugLayoutElementsList(int32_t initialR
|
|||
}
|
||||
|
||||
if (highlightedElementId) {
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugView_ElementHighlight"), .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .floating = { .parentId = highlightedElementId, .zIndex = 32767, .pointerCaptureMode = CLAY_POINTER_CAPTURE_MODE_PASSTHROUGH, .attachTo = CLAY_ATTACH_TO_ELEMENT_WITH_ID } }) {
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugView_ElementHighlightRectangle"), .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .backgroundColor = Clay__debugViewHighlightColor }) {}
|
||||
CLAY(CLAY_ID("Clay__DebugView_ElementHighlight"), { .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .floating = { .parentId = highlightedElementId, .zIndex = 32767, .pointerCaptureMode = CLAY_POINTER_CAPTURE_MODE_PASSTHROUGH, .attachTo = CLAY_ATTACH_TO_ELEMENT_WITH_ID } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugView_ElementHighlightRectangle"), { .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .backgroundColor = Clay__debugViewHighlightColor }) {}
|
||||
}
|
||||
}
|
||||
return layoutData;
|
||||
|
|
@ -3370,17 +3368,17 @@ void Clay__RenderDebugViewElementConfigHeader(Clay_String elementId, Clay__Eleme
|
|||
Clay__DebugElementConfigTypeLabelConfig config = Clay__DebugGetElementConfigTypeLabel(type);
|
||||
Clay_Color backgroundColor = config.color;
|
||||
backgroundColor.a = 90;
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) }, .padding = CLAY_PADDING_ALL(CLAY__DEBUGVIEW_OUTER_PADDING), .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = backgroundColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = config.color, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) }, .padding = CLAY_PADDING_ALL(CLAY__DEBUGVIEW_OUTER_PADDING), .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = { 8, 8, 2, 2 } }, .backgroundColor = backgroundColor, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = config.color, .width = { 1, 1, 1, 1, 0 } } }) {
|
||||
CLAY_TEXT(config.label, CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY_TEXT(elementId, CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_3, .fontSize = 16, .wrapMode = CLAY_TEXT_WRAP_NONE }));
|
||||
}
|
||||
}
|
||||
|
||||
void Clay__RenderDebugViewColor(Clay_Color color, Clay_TextElementConfig *textConfig) {
|
||||
CLAY({ .layout = { .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ r: "), textConfig);
|
||||
CLAY_TEXT(Clay__IntToString(color.r), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", g: "), textConfig);
|
||||
|
|
@ -3390,13 +3388,13 @@ void Clay__RenderDebugViewColor(Clay_Color color, Clay_TextElementConfig *textCo
|
|||
CLAY_TEXT(CLAY_STRING(", a: "), textConfig);
|
||||
CLAY_TEXT(Clay__IntToString(color.a), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING(" }"), textConfig);
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_FIXED(10) } } }) {}
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 8), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 8)} }, .backgroundColor = color, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = CLAY__DEBUGVIEW_COLOR_4, .width = { 1, 1, 1, 1, 0 } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_FIXED(10) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 8), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 8)} }, .backgroundColor = color, .cornerRadius = CLAY_CORNER_RADIUS(4), .border = { .color = CLAY__DEBUGVIEW_COLOR_4, .width = { 1, 1, 1, 1, 0 } } }) {}
|
||||
}
|
||||
}
|
||||
|
||||
void Clay__RenderDebugViewCornerRadius(Clay_CornerRadius cornerRadius, Clay_TextElementConfig *textConfig) {
|
||||
CLAY({ .layout = { .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ topLeft: "), textConfig);
|
||||
CLAY_TEXT(Clay__IntToString(cornerRadius.topLeft), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", topRight: "), textConfig);
|
||||
|
|
@ -3455,16 +3453,16 @@ void Clay__RenderDebugView(void) {
|
|||
highlightedRow = -1;
|
||||
}
|
||||
Clay__RenderDebugLayoutData layoutData = CLAY__DEFAULT_STRUCT;
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugView"),
|
||||
CLAY(CLAY_ID("Clay__DebugView"), {
|
||||
.layout = { .sizing = { CLAY_SIZING_FIXED((float)Clay__debugViewWidth) , CLAY_SIZING_FIXED(context->layoutDimensions.height) }, .layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
.floating = { .zIndex = 32765, .attachPoints = { .element = CLAY_ATTACH_POINT_LEFT_CENTER, .parent = CLAY_ATTACH_POINT_RIGHT_CENTER }, .attachTo = CLAY_ATTACH_TO_ROOT, .clipTo = CLAY_CLIP_TO_ATTACHED_PARENT },
|
||||
.border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { .bottom = 1 } }
|
||||
}) {
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_2 }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_2 }) {
|
||||
CLAY_TEXT(CLAY_STRING("Clay Debug Tools"), infoTextConfig);
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
// Close button
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 10), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT - 10)}, .childAlignment = {CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER} },
|
||||
.backgroundColor = {217,91,67,80},
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4),
|
||||
|
|
@ -3474,18 +3472,18 @@ void Clay__RenderDebugView(void) {
|
|||
CLAY_TEXT(CLAY_STRING("x"), CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16 }));
|
||||
}
|
||||
}
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(1)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3 } ) {}
|
||||
CLAY({ .id = scrollId, .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .clip = { .horizontal = true, .vertical = true, .childOffset = Clay_GetScrollOffset() } }) {
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)}, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = ((initialElementsLength + initialRootsLength) & 1) == 0 ? CLAY__DEBUGVIEW_COLOR_2 : CLAY__DEBUGVIEW_COLOR_1 }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(1)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3 } ) {}
|
||||
CLAY(scrollId, { .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .clip = { .horizontal = true, .vertical = true, .childOffset = Clay_GetScrollOffset() } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)}, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = ((initialElementsLength + initialRootsLength) & 1) == 0 ? CLAY__DEBUGVIEW_COLOR_2 : CLAY__DEBUGVIEW_COLOR_1 }) {
|
||||
Clay_ElementId panelContentsId = Clay__HashString(CLAY_STRING("Clay__DebugViewPaneOuter"), 0);
|
||||
// Element list
|
||||
CLAY({ .id = panelContentsId, .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .floating = { .zIndex = 32766, .pointerCaptureMode = CLAY_POINTER_CAPTURE_MODE_PASSTHROUGH, .attachTo = CLAY_ATTACH_TO_PARENT, .clipTo = CLAY_CLIP_TO_ATTACHED_PARENT } }) {
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)}, .padding = { CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY(panelContentsId, { .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)} }, .floating = { .zIndex = 32766, .pointerCaptureMode = CLAY_POINTER_CAPTURE_MODE_PASSTHROUGH, .attachTo = CLAY_ATTACH_TO_PARENT, .clipTo = CLAY_CLIP_TO_ATTACHED_PARENT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0)}, .padding = { CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
layoutData = Clay__RenderDebugLayoutElementsList((int32_t)initialRootsLength, highlightedRow);
|
||||
}
|
||||
}
|
||||
float contentWidth = Clay__GetHashMapItem(panelContentsId.id)->layoutElement->dimensions.width;
|
||||
CLAY({ .layout = { .sizing = {.width = CLAY_SIZING_FIXED(contentWidth) }, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {.width = CLAY_SIZING_FIXED(contentWidth) }, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {}
|
||||
for (int32_t i = 0; i < layoutData.rowCount; i++) {
|
||||
Clay_Color rowColor = (i & 1) == 0 ? CLAY__DEBUGVIEW_COLOR_2 : CLAY__DEBUGVIEW_COLOR_1;
|
||||
if (i == layoutData.selectedElementRowIndex) {
|
||||
|
|
@ -3496,22 +3494,22 @@ void Clay__RenderDebugView(void) {
|
|||
rowColor.g *= 1.25f;
|
||||
rowColor.b *= 1.25f;
|
||||
}
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = rowColor } ) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = rowColor } ) {}
|
||||
}
|
||||
}
|
||||
}
|
||||
CLAY({ .layout = { .sizing = {.width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(1)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3 }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {.width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(1)} }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_3 }) {}
|
||||
if (context->debugSelectedElementId != 0) {
|
||||
Clay_LayoutElementHashMapItem *selectedItem = Clay__GetHashMapItem(context->debugSelectedElementId);
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(300)}, .layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
.backgroundColor = CLAY__DEBUGVIEW_COLOR_2 ,
|
||||
.clip = { .vertical = true, .childOffset = Clay_GetScrollOffset() },
|
||||
.border = { .color = CLAY__DEBUGVIEW_COLOR_3, .width = { .betweenChildren = 1 } }
|
||||
}) {
|
||||
CLAY({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT + 8)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT + 8)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Layout Config"), infoTextConfig);
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
if (selectedItem->elementId.stringId.length != 0) {
|
||||
CLAY_TEXT(selectedItem->elementId.stringId, infoTitleConfig);
|
||||
if (selectedItem->elementId.offset != 0) {
|
||||
|
|
@ -3523,10 +3521,10 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
Clay_Padding attributeConfigPadding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 8, 8};
|
||||
// Clay_LayoutConfig debug info
|
||||
CLAY({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
// .boundingBox
|
||||
CLAY_TEXT(CLAY_STRING("Bounding Box"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ x: "), infoTextConfig);
|
||||
CLAY_TEXT(Clay__IntToString(selectedItem->boundingBox.x), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", y: "), infoTextConfig);
|
||||
|
|
@ -3543,17 +3541,17 @@ void Clay__RenderDebugView(void) {
|
|||
CLAY_TEXT(layoutConfig->layoutDirection == CLAY_TOP_TO_BOTTOM ? CLAY_STRING("TOP_TO_BOTTOM") : CLAY_STRING("LEFT_TO_RIGHT"), infoTextConfig);
|
||||
// .sizing
|
||||
CLAY_TEXT(CLAY_STRING("Sizing"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("width: "), infoTextConfig);
|
||||
Clay__RenderDebugLayoutSizing(layoutConfig->sizing.width, infoTextConfig);
|
||||
}
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("height: "), infoTextConfig);
|
||||
Clay__RenderDebugLayoutSizing(layoutConfig->sizing.height, infoTextConfig);
|
||||
}
|
||||
// .padding
|
||||
CLAY_TEXT(CLAY_STRING("Padding"), infoTitleConfig);
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewElementInfoPadding") }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewElementInfoPadding"), { }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ left: "), infoTextConfig);
|
||||
CLAY_TEXT(Clay__IntToString(layoutConfig->padding.left), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", right: "), infoTextConfig);
|
||||
|
|
@ -3569,7 +3567,7 @@ void Clay__RenderDebugView(void) {
|
|||
CLAY_TEXT(Clay__IntToString(layoutConfig->childGap), infoTextConfig);
|
||||
// .childAlignment
|
||||
CLAY_TEXT(CLAY_STRING("Child Alignment"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ x: "), infoTextConfig);
|
||||
Clay_String alignX = CLAY_STRING("LEFT");
|
||||
if (layoutConfig->childAlignment.x == CLAY_ALIGN_X_CENTER) {
|
||||
|
|
@ -3595,7 +3593,7 @@ void Clay__RenderDebugView(void) {
|
|||
switch (elementConfig->type) {
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_SHARED: {
|
||||
Clay_SharedElementConfig *sharedConfig = elementConfig->config.sharedElementConfig;
|
||||
CLAY({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
// .backgroundColor
|
||||
CLAY_TEXT(CLAY_STRING("Background Color"), infoTitleConfig);
|
||||
Clay__RenderDebugViewColor(sharedConfig->backgroundColor, infoTextConfig);
|
||||
|
|
@ -3607,7 +3605,7 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_TEXT: {
|
||||
Clay_TextElementConfig *textConfig = elementConfig->config.textElementConfig;
|
||||
CLAY({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
// .fontSize
|
||||
CLAY_TEXT(CLAY_STRING("Font Size"), infoTitleConfig);
|
||||
CLAY_TEXT(Clay__IntToString(textConfig->fontSize), infoTextConfig);
|
||||
|
|
@ -3646,10 +3644,10 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_ASPECT: {
|
||||
Clay_AspectRatioElementConfig *aspectRatioConfig = elementConfig->config.aspectRatioElementConfig;
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewElementInfoAspectRatioBody"), .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewElementInfoAspectRatioBody"), { .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Aspect Ratio"), infoTitleConfig);
|
||||
// Aspect Ratio
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewElementInfoAspectRatio") }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewElementInfoAspectRatio"), { }) {
|
||||
CLAY_TEXT(Clay__IntToString(aspectRatioConfig->aspectRatio), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING("."), infoTextConfig);
|
||||
float frac = aspectRatioConfig->aspectRatio - (int)(aspectRatioConfig->aspectRatio);
|
||||
|
|
@ -3668,16 +3666,16 @@ void Clay__RenderDebugView(void) {
|
|||
if (Clay__ElementHasConfig(selectedItem->layoutElement, CLAY__ELEMENT_CONFIG_TYPE_ASPECT)) {
|
||||
aspectConfig = *Clay__FindElementConfigWithType(selectedItem->layoutElement, CLAY__ELEMENT_CONFIG_TYPE_ASPECT).aspectRatioElementConfig;
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewElementInfoImageBody"), .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewElementInfoImageBody"), { .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
// Image Preview
|
||||
CLAY_TEXT(CLAY_STRING("Preview"), infoTitleConfig);
|
||||
CLAY({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(64, 128), .height = CLAY_SIZING_GROW(64, 128) }}, .aspectRatio = aspectConfig, .image = *imageConfig }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { .width = CLAY_SIZING_GROW(64, 128), .height = CLAY_SIZING_GROW(64, 128) }}, .aspectRatio = aspectConfig, .image = *imageConfig }) {}
|
||||
}
|
||||
break;
|
||||
}
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_CLIP: {
|
||||
Clay_ClipElementConfig *clipConfig = elementConfig->config.clipElementConfig;
|
||||
CLAY({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
// .vertical
|
||||
CLAY_TEXT(CLAY_STRING("Vertical"), infoTitleConfig);
|
||||
CLAY_TEXT(clipConfig->vertical ? CLAY_STRING("true") : CLAY_STRING("false") , infoTextConfig);
|
||||
|
|
@ -3689,10 +3687,10 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_FLOATING: {
|
||||
Clay_FloatingElementConfig *floatingConfig = elementConfig->config.floatingElementConfig;
|
||||
CLAY({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
// .offset
|
||||
CLAY_TEXT(CLAY_STRING("Offset"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ x: "), infoTextConfig);
|
||||
CLAY_TEXT(Clay__IntToString(floatingConfig->offset.x), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", y: "), infoTextConfig);
|
||||
|
|
@ -3701,7 +3699,7 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
// .expand
|
||||
CLAY_TEXT(CLAY_STRING("Expand"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ width: "), infoTextConfig);
|
||||
CLAY_TEXT(Clay__IntToString(floatingConfig->expand.width), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", height: "), infoTextConfig);
|
||||
|
|
@ -3717,7 +3715,7 @@ void Clay__RenderDebugView(void) {
|
|||
CLAY_TEXT(hashItem->elementId.stringId, infoTextConfig);
|
||||
// .attachPoints
|
||||
CLAY_TEXT(CLAY_STRING("Attach Points"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ element: "), infoTextConfig);
|
||||
Clay_String attachPointElement = CLAY_STRING("LEFT_TOP");
|
||||
if (floatingConfig->attachPoints.element == CLAY_ATTACH_POINT_LEFT_CENTER) {
|
||||
|
|
@ -3790,9 +3788,9 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
case CLAY__ELEMENT_CONFIG_TYPE_BORDER: {
|
||||
Clay_BorderElementConfig *borderConfig = elementConfig->config.borderElementConfig;
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewElementInfoBorderBody"), .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewElementInfoBorderBody"), { .layout = { .padding = attributeConfigPadding, .childGap = 8, .layoutDirection = CLAY_TOP_TO_BOTTOM } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Border Widths"), infoTitleConfig);
|
||||
CLAY({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .layoutDirection = CLAY_LEFT_TO_RIGHT } }) {
|
||||
CLAY_TEXT(CLAY_STRING("{ left: "), infoTextConfig);
|
||||
CLAY_TEXT(Clay__IntToString(borderConfig->width.left), infoTextConfig);
|
||||
CLAY_TEXT(CLAY_STRING(", right: "), infoTextConfig);
|
||||
|
|
@ -3815,16 +3813,16 @@ void Clay__RenderDebugView(void) {
|
|||
}
|
||||
}
|
||||
} else {
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewWarningsScrollPane"), .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(300)}, .childGap = 6, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_2, .clip = { .horizontal = true, .vertical = true, .childOffset = Clay_GetScrollOffset() } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewWarningsScrollPane"), { .layout = { .sizing = {CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(300)}, .childGap = 6, .layoutDirection = CLAY_TOP_TO_BOTTOM }, .backgroundColor = CLAY__DEBUGVIEW_COLOR_2, .clip = { .horizontal = true, .vertical = true, .childOffset = Clay_GetScrollOffset() } }) {
|
||||
Clay_TextElementConfig *warningConfig = CLAY_TEXT_CONFIG({ .textColor = CLAY__DEBUGVIEW_COLOR_4, .fontSize = 16, .wrapMode = CLAY_TEXT_WRAP_NONE });
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewWarningItemHeader"), .layout = { .sizing = {.height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childGap = 8, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY(CLAY_ID("Clay__DebugViewWarningItemHeader"), { .layout = { .sizing = {.height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childGap = 8, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Warnings"), warningConfig);
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("Clay__DebugViewWarningsTopBorder"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(1)} }, .backgroundColor = {200, 200, 200, 255} }) {}
|
||||
CLAY(CLAY_ID("Clay__DebugViewWarningsTopBorder"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(1)} }, .backgroundColor = {200, 200, 200, 255} }) {}
|
||||
int32_t previousWarningsLength = context->warnings.length;
|
||||
for (int32_t i = 0; i < previousWarningsLength; i++) {
|
||||
Clay__Warning warning = context->warnings.internalArray[i];
|
||||
CLAY({ .id = CLAY_IDI("Clay__DebugViewWarningItem", i), .layout = { .sizing = {.height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childGap = 8, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY(CLAY_IDI("Clay__DebugViewWarningItem", i), { .layout = { .sizing = {.height = CLAY_SIZING_FIXED(CLAY__DEBUGVIEW_ROW_HEIGHT)}, .padding = {CLAY__DEBUGVIEW_OUTER_PADDING, CLAY__DEBUGVIEW_OUTER_PADDING, 0, 0 }, .childGap = 8, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} } }) {
|
||||
CLAY_TEXT(warning.baseMessage, warningConfig);
|
||||
if (warning.dynamicMessage.length > 0) {
|
||||
CLAY_TEXT(warning.dynamicMessage, warningConfig);
|
||||
|
|
@ -3995,10 +3993,6 @@ void Clay_SetPointerState(Clay_Vector2 position, bool isPointerDown) {
|
|||
}
|
||||
Clay_ElementIdArray_Add(&context->pointerOverIds, mapItem->elementId);
|
||||
found = true;
|
||||
|
||||
if (mapItem->idAlias != 0) {
|
||||
Clay_ElementIdArray_Add(&context->pointerOverIds, CLAY__INIT(Clay_ElementId) { .id = mapItem->idAlias });
|
||||
}
|
||||
}
|
||||
if (Clay__ElementHasConfig(currentElement, CLAY__ELEMENT_CONFIG_TYPE_TEXT)) {
|
||||
dfsBuffer.length--;
|
||||
|
|
@ -4222,10 +4216,9 @@ void Clay_BeginLayout(void) {
|
|||
rootDimensions.width -= (float)Clay__debugViewWidth;
|
||||
}
|
||||
context->booleanWarnings = CLAY__INIT(Clay_BooleanWarnings) CLAY__DEFAULT_STRUCT;
|
||||
Clay__OpenElement();
|
||||
Clay__OpenElementWithId(CLAY_ID("Clay__RootContainer"));
|
||||
Clay__ConfigureOpenElement(CLAY__INIT(Clay_ElementDeclaration) {
|
||||
.id = CLAY_ID("Clay__RootContainer"),
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED((rootDimensions.width)), CLAY_SIZING_FIXED(rootDimensions.height)} }
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED((rootDimensions.width)), CLAY_SIZING_FIXED(rootDimensions.height)} }
|
||||
});
|
||||
Clay__int32_tArray_Add(&context->openLayoutElementStack, 0);
|
||||
Clay__LayoutElementTreeRootArray_Add(&context->layoutElementTreeRoots, CLAY__INIT(Clay__LayoutElementTreeRoot) { .layoutElementIndex = 0 });
|
||||
|
|
@ -4253,9 +4246,14 @@ Clay_RenderCommandArray Clay_EndLayout(void) {
|
|||
.renderData = { .text = { .stringContents = CLAY__INIT(Clay_StringSlice) { .length = message.length, .chars = message.chars, .baseChars = message.chars }, .textColor = {255, 0, 0, 255}, .fontSize = 16 } },
|
||||
.commandType = CLAY_RENDER_COMMAND_TYPE_TEXT
|
||||
});
|
||||
} else {
|
||||
Clay__CalculateFinalLayout();
|
||||
}
|
||||
if (context->openLayoutElementStack.length > 1) {
|
||||
context->errorHandler.errorHandlerFunction(CLAY__INIT(Clay_ErrorData) {
|
||||
.errorType = CLAY_ERROR_TYPE_UNBALANCED_OPEN_CLOSE,
|
||||
.errorText = CLAY_STRING("There were still open layout elements when EndLayout was called. This results from an unequal number of calls to Clay__OpenElement and Clay__CloseElement."),
|
||||
.userData = context->errorHandler.userData });
|
||||
}
|
||||
Clay__CalculateFinalLayout();
|
||||
return context->renderCommands;
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -53,7 +53,7 @@ Clay_RenderCommandArray ClayImageSample_CreateLayout() {
|
|||
.height = CLAY_SIZING_GROW(0)
|
||||
};
|
||||
|
||||
CLAY({ .id = CLAY_ID("OuterContainer"),
|
||||
CLAY(CLAY_ID("OuterContainer"), {
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.sizing = layoutExpand,
|
||||
|
|
@ -61,8 +61,7 @@ Clay_RenderCommandArray ClayImageSample_CreateLayout() {
|
|||
.childGap = 16
|
||||
}
|
||||
}) {
|
||||
CLAY({
|
||||
.id = CLAY_ID("SampleImage"),
|
||||
CLAY(CLAY_ID("SampleImage"), {
|
||||
.layout = {
|
||||
.sizing = layoutExpand
|
||||
},
|
||||
|
|
|
|||
|
|
@ -40,12 +40,12 @@ void Layout() {
|
|||
static Clay_Color BACKGROUND = { 0xF4, 0xEB, 0xE6, 255 };
|
||||
static Clay_Color ACCENT = { 0xFA, 0xE0, 0xD4, 255 };
|
||||
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) },
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
.backgroundColor = BACKGROUND
|
||||
}) {
|
||||
CLAY({ .id = CLAY_ID("PageMargins"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) },
|
||||
CLAY(CLAY_ID("PageMargins"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) },
|
||||
.padding = { 70, 70, 50, 50 }, // Some nice looking page margins
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.childGap = 10}
|
||||
|
|
@ -54,9 +54,9 @@ void Layout() {
|
|||
CLAY_TEXT(CLAY_STRING("Features Overview"), CLAY_TEXT_CONFIG({ .fontId = FONT_CALLISTOGA, .textColor = PRIMARY, .fontSize = 24 }));
|
||||
|
||||
// Feature Box
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(0) }, .childGap = 10 }}) {
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(0) }}, .backgroundColor = ACCENT, .cornerRadius = CLAY_CORNER_RADIUS(12) }) {
|
||||
CLAY({ .layout = {.padding = CLAY_PADDING_ALL(20), .childGap = 4, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(0) }, .childGap = 10 }}) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(0) }}, .backgroundColor = ACCENT, .cornerRadius = CLAY_CORNER_RADIUS(12) }) {
|
||||
CLAY_AUTO_ID({ .layout = {.padding = CLAY_PADDING_ALL(20), .childGap = 4, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
CLAY_TEXT(CLAY_STRING("- High performance"),
|
||||
CLAY_TEXT_CONFIG({ .textColor = PRIMARY, .fontSize = 14, .fontId = FONT_QUICKSAND }));
|
||||
CLAY_TEXT(CLAY_STRING("- Declarative syntax"),
|
||||
|
|
@ -69,7 +69,7 @@ void Layout() {
|
|||
CLAY_TEXT_CONFIG({ .textColor = PRIMARY, .fontSize = 14, .fontId = FONT_QUICKSAND }));
|
||||
}
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {CLAY_SIZING_FIT(0), CLAY_SIZING_GROW(0)},
|
||||
.padding = CLAY_PADDING_ALL(10),
|
||||
|
|
@ -81,23 +81,23 @@ void Layout() {
|
|||
.cornerRadius = CLAY_CORNER_RADIUS(8)
|
||||
}) {
|
||||
// Profile picture
|
||||
CLAY({ .layout = {
|
||||
CLAY_AUTO_ID({ .layout = {
|
||||
.sizing = {CLAY_SIZING_FIT(0), CLAY_SIZING_GROW(0)},
|
||||
.padding = { 30, 30, 0, 0 },
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.childAlignment = { CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER }},
|
||||
.border = { .color = PRIMARY, .width = 2, 2, 2, 2 }, .cornerRadius = 10
|
||||
}) {
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_FIXED(32), CLAY_SIZING_FIXED(32) } }, .image = { .imageData = "resources/check.png" }});
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_FIXED(32), CLAY_SIZING_FIXED(32) } }, .image = { .imageData = "resources/check.png" }});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(16) } }});
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(16) } }});
|
||||
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childGap = 10, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childGap = 10, .layoutDirection = CLAY_TOP_TO_BOTTOM }}) {
|
||||
CLAY_TEXT(CLAY_STRING("Cairo"), CLAY_TEXT_CONFIG({ .fontId = FONT_CALLISTOGA, .fontSize = 24, .textColor = PRIMARY }));
|
||||
CLAY({ .layout = { .padding = CLAY_PADDING_ALL(10) }, .backgroundColor = ACCENT, .cornerRadius = 10 }) {
|
||||
CLAY_AUTO_ID({ .layout = { .padding = CLAY_PADDING_ALL(10) }, .backgroundColor = ACCENT, .cornerRadius = 10 }) {
|
||||
CLAY_TEXT(CLAY_STRING("Officiis quia quia qui inventore ratione voluptas et. Quidem sunt unde similique. Qui est et exercitationem cumque harum illum. Numquam placeat aliquid quo voluptatem. "
|
||||
"Deleniti saepe nihil exercitationem nemo illo. Consequatur beatae repellat provident similique. Provident qui exercitationem deserunt sapiente. Quam qui dolor corporis odit. "
|
||||
"Assumenda corrupti sunt culpa pariatur. Vero sit ut minima. In est consequatur minus et cum sint illum aperiam. Qui ipsa quas nisi omnis aut quia nobis. "
|
||||
|
|
|
|||
|
|
@ -65,21 +65,21 @@ Clay_String* FrameAllocateString(Clay_String string) {
|
|||
}
|
||||
|
||||
void LandingPageBlob(int index, int fontSize, Clay_Color color, Clay_String text, Clay_String imageURL) {
|
||||
CLAY({ .id = CLAY_IDI("HeroBlob", index), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 480) }, .padding = CLAY_PADDING_ALL(16), .childGap = 16, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} }, .border = { .color = color, .width = { 2, 2, 2, 2 }}, .cornerRadius = CLAY_CORNER_RADIUS(10) }) {
|
||||
CLAY({ .id = CLAY_IDI("CheckImage", index), .layout = { .sizing = { CLAY_SIZING_FIXED(32) } }, .aspectRatio = { 1 }, .image = { .imageData = FrameAllocateString(imageURL) } }) {}
|
||||
CLAY(CLAY_IDI("HeroBlob", index), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 480) }, .padding = CLAY_PADDING_ALL(16), .childGap = 16, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER} }, .border = { .color = color, .width = { 2, 2, 2, 2 }}, .cornerRadius = CLAY_CORNER_RADIUS(10) }) {
|
||||
CLAY(CLAY_IDI("CheckImage", index), { .layout = { .sizing = { CLAY_SIZING_FIXED(32) } }, .aspectRatio = { 1 }, .image = { .imageData = FrameAllocateString(imageURL) } }) {}
|
||||
CLAY_TEXT(text, CLAY_TEXT_CONFIG({ .fontSize = fontSize, .fontId = FONT_ID_BODY_24, .textColor = color }));
|
||||
}
|
||||
}
|
||||
|
||||
void LandingPageDesktop() {
|
||||
CLAY({ .id = CLAY_ID("LandingPage1Desktop"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIT(.min = windowHeight - 70) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY({ .id = CLAY_ID("LandingPage1"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY({ .id = CLAY_ID("LeftText"), .layout = { .sizing = { .width = CLAY_SIZING_PERCENT(0.55f) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("LandingPage1Desktop"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIT(.min = windowHeight - 70) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY(CLAY_ID("LandingPage1"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY(CLAY_ID("LeftText"), { .layout = { .sizing = { .width = CLAY_SIZING_PERCENT(0.55f) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Clay is a flex-box style UI auto layout library in C, with declarative syntax and microsecond performance."), CLAY_TEXT_CONFIG({ .fontSize = 56, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("LandingPageSpacer"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY(CLAY_ID("LandingPageSpacer"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Clay is laying out this webpage right now!"), CLAY_TEXT_CONFIG({ .fontSize = 36, .fontId = FONT_ID_TITLE_36, .textColor = COLOR_ORANGE }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("HeroImageOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_PERCENT(0.45f) }, .childAlignment = { CLAY_ALIGN_X_CENTER }, .childGap = 16 } }) {
|
||||
CLAY(CLAY_ID("HeroImageOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_PERCENT(0.45f) }, .childAlignment = { CLAY_ALIGN_X_CENTER }, .childGap = 16 } }) {
|
||||
LandingPageBlob(1, 32, COLOR_BLOB_BORDER_5, CLAY_STRING("High performance"), CLAY_STRING("/clay/images/check_5.png"));
|
||||
LandingPageBlob(2, 32, COLOR_BLOB_BORDER_4, CLAY_STRING("Flexbox-style responsive layout"), CLAY_STRING("/clay/images/check_4.png"));
|
||||
LandingPageBlob(3, 32, COLOR_BLOB_BORDER_3, CLAY_STRING("Declarative syntax"), CLAY_STRING("/clay/images/check_3.png"));
|
||||
|
|
@ -91,13 +91,13 @@ void LandingPageDesktop() {
|
|||
}
|
||||
|
||||
void LandingPageMobile() {
|
||||
CLAY({ .id = CLAY_ID("LandingPage1Mobile"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIT(.min = windowHeight - 70) }, .childAlignment = {CLAY_ALIGN_X_CENTER, .y = CLAY_ALIGN_Y_CENTER}, .padding = { 16, 16, 32, 32 }, .childGap = 32 } }) {
|
||||
CLAY({ .id = CLAY_ID("LeftText"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("LandingPage1Mobile"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIT(.min = windowHeight - 70) }, .childAlignment = {CLAY_ALIGN_X_CENTER, .y = CLAY_ALIGN_Y_CENTER}, .padding = { 16, 16, 32, 32 }, .childGap = 32 } }) {
|
||||
CLAY(CLAY_ID("LeftText"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Clay is a flex-box style UI auto layout library in C, with declarative syntax and microsecond performance."), CLAY_TEXT_CONFIG({ .fontSize = 48, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("LandingPageSpacer"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY(CLAY_ID("LandingPageSpacer"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Clay is laying out this webpage right now!"), CLAY_TEXT_CONFIG({ .fontSize = 32, .fontId = FONT_ID_TITLE_36, .textColor = COLOR_ORANGE }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("HeroImageOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_GROW(0) }, .childAlignment = { CLAY_ALIGN_X_CENTER }, .childGap = 16 } }) {
|
||||
CLAY(CLAY_ID("HeroImageOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { .width = CLAY_SIZING_GROW(0) }, .childAlignment = { CLAY_ALIGN_X_CENTER }, .childGap = 16 } }) {
|
||||
LandingPageBlob(1, 28, COLOR_BLOB_BORDER_5, CLAY_STRING("High performance"), CLAY_STRING("/clay/images/check_5.png"));
|
||||
LandingPageBlob(2, 28, COLOR_BLOB_BORDER_4, CLAY_STRING("Flexbox-style responsive layout"), CLAY_STRING("/clay/images/check_4.png"));
|
||||
LandingPageBlob(3, 28, COLOR_BLOB_BORDER_3, CLAY_STRING("Declarative syntax"), CLAY_STRING("/clay/images/check_3.png"));
|
||||
|
|
@ -108,17 +108,17 @@ void LandingPageMobile() {
|
|||
}
|
||||
|
||||
void FeatureBlocksDesktop() {
|
||||
CLAY({ .id = CLAY_ID("FeatureBlocksOuter"), .layout = { .sizing = { CLAY_SIZING_GROW(0) } } }) {
|
||||
CLAY({ .id = CLAY_ID("FeatureBlocksInner"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } }, .border = { .width = { .betweenChildren = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY(CLAY_ID("FeatureBlocksOuter"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) } } }) {
|
||||
CLAY(CLAY_ID("FeatureBlocksInner"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = { .y = CLAY_ALIGN_Y_CENTER } }, .border = { .width = { .betweenChildren = 2 }, .color = COLOR_RED } }) {
|
||||
Clay_TextElementConfig *textConfig = CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_BODY_24, .textColor = COLOR_RED });
|
||||
CLAY({ .id = CLAY_ID("HFileBoxOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_PERCENT(0.5f) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {50, 50, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY({ .id = CLAY_ID("HFileIncludeOuter"), .layout = { .padding = {8, 4} }, .backgroundColor = COLOR_RED, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
CLAY(CLAY_ID("HFileBoxOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_PERCENT(0.5f) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {50, 50, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("HFileIncludeOuter"), { .layout = { .padding = {8, 4} }, .backgroundColor = COLOR_RED, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
CLAY_TEXT(CLAY_STRING("#include clay.h"), CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_BODY_24, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY_TEXT(CLAY_STRING("~2000 lines of C99."), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING("Zero dependencies, including no C standard library."), textConfig);
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("BringYourOwnRendererOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_PERCENT(0.5f) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {50, 50, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("BringYourOwnRendererOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_PERCENT(0.5f) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {50, 50, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Renderer agnostic."), CLAY_TEXT_CONFIG({ .fontId = FONT_ID_BODY_24, .fontSize = 24, .textColor = COLOR_ORANGE }));
|
||||
CLAY_TEXT(CLAY_STRING("Layout with clay, then render with Raylib, WebGL Canvas or even as HTML."), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING("Flexible output for easy compositing in your custom engine or environment."), textConfig);
|
||||
|
|
@ -128,16 +128,16 @@ void FeatureBlocksDesktop() {
|
|||
}
|
||||
|
||||
void FeatureBlocksMobile() {
|
||||
CLAY({ .id = CLAY_ID("FeatureBlocksInner"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) } }, .border = { .width = { .betweenChildren = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY(CLAY_ID("FeatureBlocksInner"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) } }, .border = { .width = { .betweenChildren = 2 }, .color = COLOR_RED } }) {
|
||||
Clay_TextElementConfig *textConfig = CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_BODY_24, .textColor = COLOR_RED });
|
||||
CLAY({ .id = CLAY_ID("HFileBoxOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY({ .id = CLAY_ID("HFileIncludeOuter"), .layout = { .padding = {8, 4} }, .backgroundColor = COLOR_RED, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
CLAY(CLAY_ID("HFileBoxOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("HFileIncludeOuter"), { .layout = { .padding = {8, 4} }, .backgroundColor = COLOR_RED, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
CLAY_TEXT(CLAY_STRING("#include clay.h"), CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_BODY_24, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY_TEXT(CLAY_STRING("~2000 lines of C99."), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING("Zero dependencies, including no C standard library."), textConfig);
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("BringYourOwnRendererOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("BringYourOwnRendererOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Renderer agnostic."), CLAY_TEXT_CONFIG({ .fontId = FONT_ID_BODY_24, .fontSize = 24, .textColor = COLOR_ORANGE }));
|
||||
CLAY_TEXT(CLAY_STRING("Layout with clay, then render with Raylib, WebGL Canvas or even as HTML."), textConfig);
|
||||
CLAY_TEXT(CLAY_STRING("Flexible output for easy compositing in your custom engine or environment."), textConfig);
|
||||
|
|
@ -146,33 +146,33 @@ void FeatureBlocksMobile() {
|
|||
}
|
||||
|
||||
void DeclarativeSyntaxPageDesktop() {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageDesktop"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPage"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED }}) {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageLeftText"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("SyntaxPageDesktop"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY(CLAY_ID("SyntaxPage"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED }}) {
|
||||
CLAY(CLAY_ID("SyntaxPageLeftText"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Declarative Syntax"), CLAY_TEXT_CONFIG({ .fontSize = 52, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("SyntaxSpacer"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) } } }) {}
|
||||
CLAY(CLAY_ID("SyntaxSpacer"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Flexible and readable declarative syntax with nested UI element hierarchies."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Mix elements with standard C code like loops, conditionals and functions."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Create your own library of re-usable components from UI primitives like text, images and rectangles."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageRightImage"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageRightImageInner"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 568) } }, .aspectRatio = { 1136.0 / 1194.0 }, .image = { .imageData = FrameAllocateString(CLAY_STRING("/clay/images/declarative.png")) } }) {}
|
||||
CLAY(CLAY_ID("SyntaxPageRightImage"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY(CLAY_ID("SyntaxPageRightImageInner"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 568) } }, .aspectRatio = { 1136.0 / 1194.0 }, .image = { .imageData = FrameAllocateString(CLAY_STRING("/clay/images/declarative.png")) } }) {}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void DeclarativeSyntaxPageMobile() {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageDesktop"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 16 } }) {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageLeftText"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("SyntaxPageDesktop"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 16 } }) {
|
||||
CLAY(CLAY_ID("SyntaxPageLeftText"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Declarative Syntax"), CLAY_TEXT_CONFIG({ .fontSize = 48, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("SyntaxSpacer"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) } } }) {}
|
||||
CLAY(CLAY_ID("SyntaxSpacer"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Flexible and readable declarative syntax with nested UI element hierarchies."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Mix elements with standard C code like loops, conditionals and functions."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Create your own library of re-usable components from UI primitives like text, images and rectangles."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageRightImage"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY({ .id = CLAY_ID("SyntaxPageRightImageInner"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 568) } }, .aspectRatio = { 1136.0 / 1194.0 }, .image = { .imageData = FrameAllocateString(CLAY_STRING("/clay/images/declarative.png")) } }) {}
|
||||
CLAY(CLAY_ID("SyntaxPageRightImage"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY(CLAY_ID("SyntaxPageRightImageInner"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 568) } }, .aspectRatio = { 1136.0 / 1194.0 }, .image = { .imageData = FrameAllocateString(CLAY_STRING("/clay/images/declarative.png")) } }) {}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
@ -189,20 +189,20 @@ Clay_Color ColorLerp(Clay_Color a, Clay_Color b, float amount) {
|
|||
Clay_String LOREM_IPSUM_TEXT = CLAY_STRING("Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua.");
|
||||
|
||||
void HighPerformancePageDesktop(float lerpValue) {
|
||||
CLAY({ .id = CLAY_ID("PerformanceOuter"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {82, 82, 32, 32}, .childGap = 64 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY({ .id = CLAY_ID("PerformanceLeftText"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("PerformanceOuter"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = {82, 82, 32, 32}, .childGap = 64 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY(CLAY_ID("PerformanceLeftText"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("High Performance"), CLAY_TEXT_CONFIG({ .fontSize = 52, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
CLAY({ .id = CLAY_ID("PerformanceSpacer"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY(CLAY_ID("PerformanceSpacer"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Fast enough to recompute your entire UI every frame."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY_TEXT(CLAY_STRING("Small memory footprint (3.5mb default) with static allocation & reuse. No malloc / free."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY_TEXT(CLAY_STRING("Simplify animations and reactive UI design by avoiding the standard performance hacks."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("PerformanceRightImageOuter"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(400) } }, .border = { .width = {2, 2, 2, 2}, .color = COLOR_LIGHT } }) {
|
||||
CLAY({ .id = CLAY_ID("AnimationDemoContainerLeft"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.3f + 0.4f * lerpValue), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32) }, .backgroundColor = ColorLerp(COLOR_RED, COLOR_ORANGE, lerpValue) }) {
|
||||
CLAY(CLAY_ID("PerformanceRightImageOuter"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(400) } }, .border = { .width = {2, 2, 2, 2}, .color = COLOR_LIGHT } }) {
|
||||
CLAY(CLAY_ID("AnimationDemoContainerLeft"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.3f + 0.4f * lerpValue), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32) }, .backgroundColor = ColorLerp(COLOR_RED, COLOR_ORANGE, lerpValue) }) {
|
||||
CLAY_TEXT(LOREM_IPSUM_TEXT, CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("AnimationDemoContainerRight"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32) }, .backgroundColor = ColorLerp(COLOR_ORANGE, COLOR_RED, lerpValue) }) {
|
||||
CLAY(CLAY_ID("AnimationDemoContainerRight"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(32) }, .backgroundColor = ColorLerp(COLOR_ORANGE, COLOR_RED, lerpValue) }) {
|
||||
CLAY_TEXT(LOREM_IPSUM_TEXT, CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
}
|
||||
|
|
@ -211,20 +211,20 @@ void HighPerformancePageDesktop(float lerpValue) {
|
|||
}
|
||||
|
||||
void HighPerformancePageMobile(float lerpValue) {
|
||||
CLAY({ .id = CLAY_ID("PerformanceOuter"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 32 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY({ .id = CLAY_ID("PerformanceLeftText"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("PerformanceOuter"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {CLAY_ALIGN_X_CENTER, CLAY_ALIGN_Y_CENTER}, .padding = {16, 16, 32, 32}, .childGap = 32 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY(CLAY_ID("PerformanceLeftText"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("High Performance"), CLAY_TEXT_CONFIG({ .fontSize = 48, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
CLAY({ .id = CLAY_ID("PerformanceSpacer"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY(CLAY_ID("PerformanceSpacer"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Fast enough to recompute your entire UI every frame."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY_TEXT(CLAY_STRING("Small memory footprint (3.5mb default) with static allocation & reuse. No malloc / free."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY_TEXT(CLAY_STRING("Simplify animations and reactive UI design by avoiding the standard performance hacks."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("PerformanceRightImageOuter"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY({ .id = CLAY_ID(""), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(400) } }, .border = { .width = { 2, 2, 2, 2 }, .color = COLOR_LIGHT }}) {
|
||||
CLAY({ .id = CLAY_ID("AnimationDemoContainerLeft"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.35f + 0.3f * lerpValue), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(16) }, .backgroundColor = ColorLerp(COLOR_RED, COLOR_ORANGE, lerpValue) }) {
|
||||
CLAY(CLAY_ID("PerformanceRightImageOuter"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(400) } }, .border = { .width = { 2, 2, 2, 2 }, .color = COLOR_LIGHT }}) {
|
||||
CLAY(CLAY_ID("AnimationDemoContainerLeft"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.35f + 0.3f * lerpValue), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(16) }, .backgroundColor = ColorLerp(COLOR_RED, COLOR_ORANGE, lerpValue) }) {
|
||||
CLAY_TEXT(LOREM_IPSUM_TEXT, CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("AnimationDemoContainerRight"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(16) }, .backgroundColor = ColorLerp(COLOR_ORANGE, COLOR_RED, lerpValue) }) {
|
||||
CLAY(CLAY_ID("AnimationDemoContainerRight"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = {.y = CLAY_ALIGN_Y_CENTER}, .padding = CLAY_PADDING_ALL(16) }, .backgroundColor = ColorLerp(COLOR_ORANGE, COLOR_RED, lerpValue) }) {
|
||||
CLAY_TEXT(LOREM_IPSUM_TEXT, CLAY_TEXT_CONFIG({ .fontSize = 24, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
}
|
||||
}
|
||||
|
|
@ -241,7 +241,7 @@ void HandleRendererButtonInteraction(Clay_ElementId elementId, Clay_PointerData
|
|||
}
|
||||
|
||||
void RendererButtonActive(Clay_String text) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED(300) }, .padding = CLAY_PADDING_ALL(16) },
|
||||
.backgroundColor = Clay_Hovered() ? COLOR_RED_HOVER : COLOR_RED,
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(10),
|
||||
|
|
@ -252,7 +252,7 @@ void RendererButtonActive(Clay_String text) {
|
|||
}
|
||||
|
||||
void RendererButtonInactive(Clay_String text, size_t rendererIndex) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED(300)}, .padding = CLAY_PADDING_ALL(16) },
|
||||
.border = { .width = {2, 2, 2, 2}, .color = COLOR_RED },
|
||||
.backgroundColor = Clay_Hovered() ? COLOR_LIGHT_HOVER : COLOR_LIGHT,
|
||||
|
|
@ -265,18 +265,18 @@ void RendererButtonInactive(Clay_String text, size_t rendererIndex) {
|
|||
}
|
||||
|
||||
void RendererPageDesktop() {
|
||||
CLAY({ .id = CLAY_ID("RendererPageDesktop"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY({ .id = CLAY_ID("RendererPage"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY({ .id = CLAY_ID("RendererLeftText"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("RendererPageDesktop"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 50, 50 } } }) {
|
||||
CLAY(CLAY_ID("RendererPage"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .padding = CLAY_PADDING_ALL(32), .childGap = 32 }, .border = { .width = { .left = 2, .right = 2 }, .color = COLOR_RED } }) {
|
||||
CLAY(CLAY_ID("RendererLeftText"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Renderer & Platform Agnostic"), CLAY_TEXT_CONFIG({ .fontSize = 52, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("RendererSpacerLeft"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY(CLAY_ID("RendererSpacerLeft"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Clay outputs a sorted array of primitive render commands, such as RECTANGLE, TEXT or IMAGE."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Write your own renderer in a few hundred lines of code, or use the provided examples for Raylib, WebGL canvas and more."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("There's even an HTML renderer - you're looking at it right now!"), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("RendererRightText"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .childAlignment = {CLAY_ALIGN_X_CENTER}, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 16 } }) {
|
||||
CLAY(CLAY_ID("RendererRightText"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .childAlignment = {CLAY_ALIGN_X_CENTER}, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 16 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Try changing renderer!"), CLAY_TEXT_CONFIG({ .fontSize = 36, .fontId = FONT_ID_BODY_36, .textColor = COLOR_ORANGE }));
|
||||
CLAY({ .id = CLAY_ID("RendererSpacerRight"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 32) } } }) {}
|
||||
CLAY(CLAY_ID("RendererSpacerRight"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 32) } } }) {}
|
||||
if (ACTIVE_RENDERER_INDEX == 0) {
|
||||
RendererButtonActive(CLAY_STRING("HTML Renderer"));
|
||||
RendererButtonInactive(CLAY_STRING("Canvas Renderer"), 1);
|
||||
|
|
@ -290,17 +290,17 @@ void RendererPageDesktop() {
|
|||
}
|
||||
|
||||
void RendererPageMobile() {
|
||||
CLAY({ .id = CLAY_ID("RendererMobile"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER, .y = CLAY_ALIGN_Y_CENTER}, .padding = { 16, 16, 32, 32}, .childGap = 32 }, .backgroundColor = COLOR_LIGHT }) {
|
||||
CLAY({ .id = CLAY_ID("RendererLeftText"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("RendererMobile"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {.x = CLAY_ALIGN_X_CENTER, .y = CLAY_ALIGN_Y_CENTER}, .padding = { 16, 16, 32, 32}, .childGap = 32 }, .backgroundColor = COLOR_LIGHT }) {
|
||||
CLAY(CLAY_ID("RendererLeftText"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Renderer & Platform Agnostic"), CLAY_TEXT_CONFIG({ .fontSize = 48, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_RED }));
|
||||
CLAY({ .id = CLAY_ID("RendererSpacerLeft"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY(CLAY_ID("RendererSpacerLeft"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Clay outputs a sorted array of primitive render commands, such as RECTANGLE, TEXT or IMAGE."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("Write your own renderer in a few hundred lines of code, or use the provided examples for Raylib, WebGL canvas and more."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
CLAY_TEXT(CLAY_STRING("There's even an HTML renderer - you're looking at it right now!"), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_RED }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("RendererRightText"), .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 16 } }) {
|
||||
CLAY(CLAY_ID("RendererRightText"), { .layout = { .sizing = { CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 16 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Try changing renderer!"), CLAY_TEXT_CONFIG({ .fontSize = 36, .fontId = FONT_ID_BODY_36, .textColor = COLOR_ORANGE }));
|
||||
CLAY({ .id = CLAY_ID("RendererSpacerRight"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 32) }} }) {}
|
||||
CLAY(CLAY_ID("RendererSpacerRight"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 32) }} }) {}
|
||||
if (ACTIVE_RENDERER_INDEX == 0) {
|
||||
RendererButtonActive(CLAY_STRING("HTML Renderer"));
|
||||
RendererButtonInactive(CLAY_STRING("Canvas Renderer"), 1);
|
||||
|
|
@ -313,17 +313,17 @@ void RendererPageMobile() {
|
|||
}
|
||||
|
||||
void DebuggerPageDesktop() {
|
||||
CLAY({ .id = CLAY_ID("DebuggerDesktop"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 82, 82, 32, 32 }, .childGap = 64 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY({ .id = CLAY_ID("DebuggerLeftText"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY(CLAY_ID("DebuggerDesktop"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIT(.min = windowHeight - 50) }, .childAlignment = {0, CLAY_ALIGN_Y_CENTER}, .padding = { 82, 82, 32, 32 }, .childGap = 64 }, .backgroundColor = COLOR_RED }) {
|
||||
CLAY(CLAY_ID("DebuggerLeftText"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.5) }, .layoutDirection = CLAY_TOP_TO_BOTTOM, .childGap = 8 } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Integrated Debug Tools"), CLAY_TEXT_CONFIG({ .fontSize = 52, .fontId = FONT_ID_TITLE_56, .textColor = COLOR_LIGHT }));
|
||||
CLAY({ .id = CLAY_ID("DebuggerSpacer"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY(CLAY_ID("DebuggerSpacer"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 16) }} }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Clay includes built in \"Chrome Inspector\"-style debug tooling."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY_TEXT(CLAY_STRING("View your layout hierarchy and config in real time."), CLAY_TEXT_CONFIG({ .fontSize = 28, .fontId = FONT_ID_BODY_36, .textColor = COLOR_LIGHT }));
|
||||
CLAY({ .id = CLAY_ID("DebuggerPageSpacer"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY(CLAY_ID("DebuggerPageSpacer"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0), .height = CLAY_SIZING_FIXED(32) } } }) {}
|
||||
CLAY_TEXT(CLAY_STRING("Press the \"d\" key to try it out now!"), CLAY_TEXT_CONFIG({ .fontSize = 32, .fontId = FONT_ID_TITLE_36, .textColor = COLOR_ORANGE }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("DebuggerRightImageOuter"), .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY({ .id = CLAY_ID("DebuggerPageRightImageInner"), .layout = { .sizing = { CLAY_SIZING_GROW(.max = 558) } }, .aspectRatio = { 1620.0 / 1474.0 }, .image = {.imageData = FrameAllocateString(CLAY_STRING("/clay/images/debugger.png")) } }) {}
|
||||
CLAY(CLAY_ID("DebuggerRightImageOuter"), { .layout = { .sizing = { CLAY_SIZING_PERCENT(0.50) }, .childAlignment = {CLAY_ALIGN_X_CENTER} } }) {
|
||||
CLAY(CLAY_ID("DebuggerPageRightImageInner"), { .layout = { .sizing = { CLAY_SIZING_GROW(.max = 558) } }, .aspectRatio = { 1620.0 / 1474.0 }, .image = {.imageData = FrameAllocateString(CLAY_STRING("/clay/images/debugger.png")) } }) {}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
@ -340,26 +340,26 @@ float animationLerpValue = -1.0f;
|
|||
|
||||
Clay_RenderCommandArray CreateLayout(bool mobileScreen, float lerpValue) {
|
||||
Clay_BeginLayout();
|
||||
CLAY({ .id = CLAY_ID("OuterContainer"), .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) } }, .backgroundColor = COLOR_LIGHT }) {
|
||||
CLAY({ .id = CLAY_ID("Header"), .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(50) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .childGap = 16, .padding = { 32, 32 } } }) {
|
||||
CLAY(CLAY_ID("OuterContainer"), { .layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM, .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) } }, .backgroundColor = COLOR_LIGHT }) {
|
||||
CLAY(CLAY_ID("Header"), { .layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(50) }, .childAlignment = { 0, CLAY_ALIGN_Y_CENTER }, .childGap = 16, .padding = { 32, 32 } } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Clay"), &headerTextConfig);
|
||||
CLAY({ .id = CLAY_ID("Spacer"), .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY(CLAY_ID("Spacer"), { .layout = { .sizing = { .width = CLAY_SIZING_GROW(0) } } }) {}
|
||||
if (!mobileScreen) {
|
||||
CLAY({ .id = CLAY_ID("LinkExamplesOuter"), .layout = { .padding = {8, 8} } }) {
|
||||
CLAY(CLAY_ID("LinkExamplesOuter"), { .layout = { .padding = {8, 8} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Examples"), CLAY_TEXT_CONFIG({
|
||||
.userData = FrameAllocateCustomData((CustomHTMLData) {
|
||||
.link = CLAY_STRING("https://github.com/nicbarker/clay/tree/main/examples")
|
||||
}),
|
||||
.fontId = FONT_ID_BODY_24, .fontSize = 24, .textColor = {61, 26, 5, 255} }));
|
||||
}
|
||||
CLAY({ .id = CLAY_ID("LinkDocsOuter"), .layout = { .padding = {8, 8} } }) {
|
||||
CLAY(CLAY_ID("LinkDocsOuter"), { .layout = { .padding = {8, 8} } }) {
|
||||
CLAY_TEXT(CLAY_STRING("Docs"), CLAY_TEXT_CONFIG({
|
||||
.userData = FrameAllocateCustomData((CustomHTMLData) { .link = CLAY_STRING("https://github.com/nicbarker/clay/blob/main/README.md") }),
|
||||
.fontId = FONT_ID_BODY_24, .fontSize = 24, .textColor = {61, 26, 5, 255} })
|
||||
);
|
||||
}
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .padding = {16, 16, 6, 6} },
|
||||
.backgroundColor = Clay_Hovered() ? COLOR_LIGHT_HOVER : COLOR_LIGHT,
|
||||
.border = { .width = {2, 2, 2, 2}, .color = COLOR_RED },
|
||||
|
|
@ -370,7 +370,7 @@ Clay_RenderCommandArray CreateLayout(bool mobileScreen, float lerpValue) {
|
|||
.userData = FrameAllocateCustomData((CustomHTMLData) { .disablePointerEvents = true }),
|
||||
.fontId = FONT_ID_BODY_24, .fontSize = 24, .textColor = {61, 26, 5, 255} }));
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .padding = {16, 16, 6, 6} },
|
||||
.backgroundColor = Clay_Hovered() ? COLOR_LIGHT_HOVER : COLOR_LIGHT,
|
||||
.border = { .width = {2, 2, 2, 2}, .color = COLOR_RED },
|
||||
|
|
@ -383,12 +383,12 @@ Clay_RenderCommandArray CreateLayout(bool mobileScreen, float lerpValue) {
|
|||
}
|
||||
}
|
||||
Clay_LayoutConfig topBorderConfig = (Clay_LayoutConfig) { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_FIXED(4) }};
|
||||
CLAY({ .id = CLAY_ID("TopBorder1"), .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_5 }) {}
|
||||
CLAY({ .id = CLAY_ID("TopBorder2"), .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_4 }) {}
|
||||
CLAY({ .id = CLAY_ID("TopBorder3"), .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_3 }) {}
|
||||
CLAY({ .id = CLAY_ID("TopBorder4"), .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_2 }) {}
|
||||
CLAY({ .id = CLAY_ID("TopBorder5"), .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_1 }) {}
|
||||
CLAY({ .id = CLAY_ID("OuterScrollContainer"),
|
||||
CLAY(CLAY_ID("TopBorder1"), { .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_5 }) {}
|
||||
CLAY(CLAY_ID("TopBorder2"), { .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_4 }) {}
|
||||
CLAY(CLAY_ID("TopBorder3"), { .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_3 }) {}
|
||||
CLAY(CLAY_ID("TopBorder4"), { .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_2 }) {}
|
||||
CLAY(CLAY_ID("TopBorder5"), { .layout = topBorderConfig, .backgroundColor = COLOR_TOP_BORDER_1 }) {}
|
||||
CLAY(CLAY_ID("OuterScrollContainer"), {
|
||||
.layout = { .sizing = { CLAY_SIZING_GROW(0), CLAY_SIZING_GROW(0) }, .layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
.clip = { .vertical = true, .childOffset = Clay_GetScrollOffset() },
|
||||
.border = { .width = { .betweenChildren = 2 }, .color = COLOR_RED }
|
||||
|
|
@ -419,8 +419,7 @@ Clay_RenderCommandArray CreateLayout(bool mobileScreen, float lerpValue) {
|
|||
scrollbarColor = (Clay_Color){225, 138, 50, 160};
|
||||
}
|
||||
float scrollHeight = scrollData.scrollContainerDimensions.height - 12;
|
||||
CLAY({
|
||||
.id = CLAY_ID("ScrollBar"),
|
||||
CLAY(CLAY_ID("ScrollBar"), {
|
||||
.floating = { .offset = { .x = -6, .y = -(scrollData.scrollPosition->y / scrollData.contentDimensions.height) * scrollHeight + 6}, .zIndex = 1, .parentId = Clay_GetElementId(CLAY_STRING("OuterScrollContainer")).id, .attachPoints = {.element = CLAY_ATTACH_POINT_RIGHT_TOP, .parent = CLAY_ATTACH_POINT_RIGHT_TOP }, .attachTo = CLAY_ATTACH_TO_PARENT },
|
||||
.layout = { .sizing = {CLAY_SIZING_FIXED(10), CLAY_SIZING_FIXED((scrollHeight / scrollData.contentDimensions.height) * scrollHeight)} },
|
||||
.backgroundColor = scrollbarColor,
|
||||
|
|
|
|||
|
|
@ -13,7 +13,7 @@ int main(void) {
|
|||
Clay_Arena clayMemory = Clay_CreateArenaWithCapacityAndMemory(totalMemorySize, (char *)malloc(totalMemorySize));
|
||||
Clay_Initialize(clayMemory, Clay_Dimensions {1024,768}, Clay_ErrorHandler { HandleClayErrors });
|
||||
Clay_BeginLayout();
|
||||
CLAY({ .layout = layoutElement, .backgroundColor = {255,255,255,0} }) {
|
||||
CLAY_AUTO_ID({ .layout = layoutElement, .backgroundColor = {255,255,255,0} }) {
|
||||
CLAY_TEXT(CLAY_STRING(""), CLAY_TEXT_CONFIG({ .fontId = 0 }));
|
||||
}
|
||||
Clay_EndLayout();
|
||||
|
|
|
|||
|
|
@ -18,7 +18,7 @@ Clay_Color COLOR_WHITE = { 255, 255, 255, 255 };
|
|||
Clay_Color COLOR_BLACK = { 0, 0, 0, 255 };
|
||||
|
||||
void RenderHeaderButton(Clay_String text) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .padding = { 8, 8, 4, 4 } },
|
||||
.backgroundColor = COLOR_BLACK,
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4)
|
||||
|
|
@ -212,8 +212,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
};
|
||||
|
||||
// Build UI here
|
||||
CLAY({
|
||||
.id = CLAY_ID("OuterContainer"),
|
||||
CLAY(CLAY_ID("OuterContainer"), {
|
||||
.backgroundColor = COLOR_WHITE,
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
|
|
@ -223,8 +222,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
}
|
||||
}) {
|
||||
// Child elements go inside braces
|
||||
CLAY({
|
||||
.id = CLAY_ID("HeaderBar"),
|
||||
CLAY(CLAY_ID("HeaderBar"), {
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.height = CLAY_SIZING_FIXED(30),
|
||||
|
|
@ -235,8 +233,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
},
|
||||
}) {
|
||||
// Header buttons go here
|
||||
CLAY({
|
||||
.id = CLAY_ID("FileButton"),
|
||||
CLAY(CLAY_ID("FileButton"), {
|
||||
.layout = {
|
||||
.padding = { 8, 8, 4, 4 }
|
||||
},
|
||||
|
|
@ -252,18 +249,16 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
);
|
||||
}
|
||||
RenderHeaderButton(CLAY_STRING("Edit"));
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0) } } }) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0) } } }) {}
|
||||
RenderHeaderButton(CLAY_STRING("Upload"));
|
||||
RenderHeaderButton(CLAY_STRING("Media"));
|
||||
RenderHeaderButton(CLAY_STRING("Support"));
|
||||
}
|
||||
|
||||
CLAY({
|
||||
.id = CLAY_ID("LowerContent"),
|
||||
CLAY(CLAY_ID("LowerContent"), {
|
||||
.layout = { .sizing = layoutExpand, .childGap = 8 },
|
||||
}) {
|
||||
CLAY({
|
||||
.id = CLAY_ID("Sidebar"),
|
||||
CLAY(CLAY_ID("Sidebar"), {
|
||||
.border = contentBorders,
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4),
|
||||
.layout = {
|
||||
|
|
@ -284,7 +279,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
};
|
||||
|
||||
if (i == selectedDocumentIndex) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = sidebarButtonLayout,
|
||||
.backgroundColor = COLOR_BLACK,
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4)
|
||||
|
|
@ -298,7 +293,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
);
|
||||
}
|
||||
} else {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = sidebarButtonLayout,
|
||||
.backgroundColor = (Clay_Color){ 0, 0, 0, Clay_Hovered() ? 120 : 0 },
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4),
|
||||
|
|
@ -316,8 +311,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
}
|
||||
}
|
||||
|
||||
CLAY({
|
||||
.id = CLAY_ID("MainContent"),
|
||||
CLAY(CLAY_ID("MainContent"), {
|
||||
.border = contentBorders,
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(4),
|
||||
.clip = { .vertical = true, .childOffset = Clay_GetScrollOffset() },
|
||||
|
|
@ -329,7 +323,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
}
|
||||
}) {
|
||||
Document selectedDocument = documents.documents[selectedDocumentIndex];
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_LEFT_TO_RIGHT,
|
||||
.childGap = 4,
|
||||
|
|
@ -340,7 +334,7 @@ Clay_RenderCommandArray ClayVideoDemoPlaydate_CreateLayout(int selectedDocumentI
|
|||
selectedDocument.title,
|
||||
CLAY_TEXT_CONFIG({ .fontId = FONT_ID_BODY, .textColor = COLOR_BLACK })
|
||||
);
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_FIXED(32),
|
||||
|
|
|
|||
File diff suppressed because one or more lines are too long
|
|
@ -3,7 +3,7 @@
|
|||
// NOTE: This file only exists to make sure that clay works when included in multiple translation units.
|
||||
|
||||
void SatisfyCompiler(void) {
|
||||
CLAY({ .id = CLAY_ID("SatisfyCompiler") }) {
|
||||
CLAY(CLAY_ID("SatisfyCompiler"), { }) {
|
||||
CLAY_TEXT(CLAY_STRING("Test"), CLAY_TEXT_CONFIG({ .fontId = 0, .fontSize = 24 }));
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@ const int FONT_ID_BODY_16 = 0;
|
|||
Clay_Color COLOR_WHITE = { 255, 255, 255, 255};
|
||||
|
||||
void RenderHeaderButton(Clay_String text) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .padding = { 16, 16, 8, 8 }},
|
||||
.backgroundColor = { 140, 140, 140, 255 },
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(5)
|
||||
|
|
@ -19,7 +19,7 @@ void RenderHeaderButton(Clay_String text) {
|
|||
}
|
||||
|
||||
void RenderDropdownMenuItem(Clay_String text) {
|
||||
CLAY({.layout = { .padding = CLAY_PADDING_ALL(16)}}) {
|
||||
CLAY_AUTO_ID({.layout = { .padding = CLAY_PADDING_ALL(16)}}) {
|
||||
CLAY_TEXT(text, CLAY_TEXT_CONFIG({
|
||||
.fontId = FONT_ID_BODY_16,
|
||||
.fontSize = 16,
|
||||
|
|
@ -102,7 +102,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
Clay_Color contentBackgroundColor = { 90, 90, 90, 255 };
|
||||
|
||||
// Build UI here
|
||||
CLAY({ .id = CLAY_ID("OuterContainer"),
|
||||
CLAY(CLAY_ID("OuterContainer"), {
|
||||
.backgroundColor = {43, 41, 51, 255 },
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
|
|
@ -112,7 +112,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
}
|
||||
}) {
|
||||
// Child elements go inside braces
|
||||
CLAY({ .id = CLAY_ID("HeaderBar"),
|
||||
CLAY(CLAY_ID("HeaderBar"), {
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.height = CLAY_SIZING_FIXED(60),
|
||||
|
|
@ -128,7 +128,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
.cornerRadius = CLAY_CORNER_RADIUS(8)
|
||||
}) {
|
||||
// Header buttons go here
|
||||
CLAY({ .id = CLAY_ID("FileButton"),
|
||||
CLAY(CLAY_ID("FileButton"), {
|
||||
.layout = { .padding = { 16, 16, 8, 8 }},
|
||||
.backgroundColor = {140, 140, 140, 255 },
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(5)
|
||||
|
|
@ -145,7 +145,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
Clay_PointerOver(Clay_GetElementId(CLAY_STRING("FileMenu")));
|
||||
|
||||
if (fileMenuVisible) { // Below has been changed slightly to fix the small bug where the menu would dismiss when mousing over the top gap
|
||||
CLAY({ .id = CLAY_ID("FileMenu"),
|
||||
CLAY(CLAY_ID("FileMenu"), {
|
||||
.floating = {
|
||||
.attachTo = CLAY_ATTACH_TO_PARENT,
|
||||
.attachPoints = {
|
||||
|
|
@ -156,7 +156,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
.padding = {0, 0, 8, 8 }
|
||||
}
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.sizing = {
|
||||
|
|
@ -175,18 +175,16 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
}
|
||||
}
|
||||
RenderHeaderButton(CLAY_STRING("Edit"));
|
||||
CLAY({ .layout = { .sizing = { CLAY_SIZING_GROW(0) }}}) {}
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = { CLAY_SIZING_GROW(0) }}}) {}
|
||||
RenderHeaderButton(CLAY_STRING("Upload"));
|
||||
RenderHeaderButton(CLAY_STRING("Media"));
|
||||
RenderHeaderButton(CLAY_STRING("Support"));
|
||||
}
|
||||
|
||||
CLAY({
|
||||
.id = CLAY_ID("LowerContent"),
|
||||
CLAY(CLAY_ID("LowerContent"), {
|
||||
.layout = { .sizing = layoutExpand, .childGap = 16 }
|
||||
}) {
|
||||
CLAY({
|
||||
.id = CLAY_ID("Sidebar"),
|
||||
CLAY(CLAY_ID("Sidebar"), {
|
||||
.backgroundColor = contentBackgroundColor,
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
|
|
@ -206,7 +204,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
};
|
||||
|
||||
if (i == data->selectedDocumentIndex) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = sidebarButtonLayout,
|
||||
.backgroundColor = {120, 120, 120, 255 },
|
||||
.cornerRadius = CLAY_CORNER_RADIUS(8)
|
||||
|
|
@ -221,7 +219,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
SidebarClickData *clickData = (SidebarClickData *)(data->frameArena.memory + data->frameArena.offset);
|
||||
*clickData = (SidebarClickData) { .requestedDocumentIndex = i, .selectedDocumentIndex = &data->selectedDocumentIndex };
|
||||
data->frameArena.offset += sizeof(SidebarClickData);
|
||||
CLAY({ .layout = sidebarButtonLayout, .backgroundColor = (Clay_Color) { 120, 120, 120, Clay_Hovered() ? 120 : 0 }, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
CLAY_AUTO_ID({ .layout = sidebarButtonLayout, .backgroundColor = (Clay_Color) { 120, 120, 120, Clay_Hovered() ? 120 : 0 }, .cornerRadius = CLAY_CORNER_RADIUS(8) }) {
|
||||
Clay_OnHover(HandleSidebarInteraction, (intptr_t)clickData);
|
||||
CLAY_TEXT(document.title, CLAY_TEXT_CONFIG({
|
||||
.fontId = FONT_ID_BODY_16,
|
||||
|
|
@ -233,7 +231,7 @@ Clay_RenderCommandArray ClayVideoDemo_CreateLayout(ClayVideoDemo_Data *data) {
|
|||
}
|
||||
}
|
||||
|
||||
CLAY({ .id = CLAY_ID("MainContent"),
|
||||
CLAY(CLAY_ID("MainContent"), {
|
||||
.backgroundColor = contentBackgroundColor,
|
||||
.clip = { .vertical = true, .childOffset = Clay_GetScrollOffset() },
|
||||
.layout = {
|
||||
|
|
|
|||
|
|
@ -33,7 +33,7 @@ Clay_RenderCommandArray CornerRadiusTest(){
|
|||
.width = CLAY_SIZING_GROW(0),
|
||||
.height = CLAY_SIZING_GROW(0)
|
||||
};
|
||||
CLAY({ .id = CLAY_ID("OuterContainer"),
|
||||
CLAY(CLAY_ID("OuterContainer"), {
|
||||
.backgroundColor = {43, 41, 51, 255},
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
|
|
@ -43,7 +43,7 @@ Clay_RenderCommandArray CornerRadiusTest(){
|
|||
}
|
||||
}) {
|
||||
for(int i = 0; i < 6; ++i){
|
||||
CLAY({ .id = CLAY_IDI("Row", i),
|
||||
CLAY(CLAY_IDI("Row", i), {
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_LEFT_TO_RIGHT,
|
||||
.sizing = layoutExpand,
|
||||
|
|
@ -52,7 +52,7 @@ Clay_RenderCommandArray CornerRadiusTest(){
|
|||
}
|
||||
}) {
|
||||
for(int j = 0; j < 6; ++j){
|
||||
CLAY({ .id = CLAY_IDI("Tile", i*6+j),
|
||||
CLAY(CLAY_IDI("Tile", i*6+j), {
|
||||
.backgroundColor = {120, 140, 255, 128},
|
||||
.cornerRadius = {(i%3)*15, (j%3)*15, (i/2)*15, (j/2)*15},
|
||||
.border = {
|
||||
|
|
|
|||
|
|
@ -70,7 +70,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
};
|
||||
Clay_TextElementConfig *textconfig =
|
||||
CLAY_TEXT_CONFIG({ .textColor = { 0xff, 0xff, 0xff, 0xff } });
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = {
|
||||
|
|
@ -82,7 +82,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
},
|
||||
}) {
|
||||
CLAY_TEXT(keytext, textconfig);
|
||||
CLAY({ .layout = { .sizing = CLAY_SIZING_GROW(1) } }) { }
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = CLAY_SIZING_GROW(1) } }) { }
|
||||
CLAY_TEXT(valtext, textconfig);
|
||||
}
|
||||
|
||||
|
|
@ -90,7 +90,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
|
||||
void component_termbox_settings(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.floating = {
|
||||
.attachTo = CLAY_ATTACH_TO_PARENT,
|
||||
.zIndex = 1,
|
||||
|
|
@ -98,7 +98,7 @@ void component_termbox_settings(void)
|
|||
.offset = { 0, 0 }
|
||||
},
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.padding = {
|
||||
|
|
@ -229,7 +229,7 @@ void component_termbox_settings(void)
|
|||
transparency = "false";
|
||||
}
|
||||
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
}) {
|
||||
component_text_pair("Color mode", color_mode);
|
||||
|
|
@ -244,7 +244,7 @@ void component_termbox_settings(void)
|
|||
|
||||
void component_color_palette(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.childGap = 16,
|
||||
.padding = {
|
||||
|
|
@ -261,7 +261,7 @@ void component_color_palette(void)
|
|||
.backgroundColor = { 0x7f, 0x7f, 0x7f, 0xff }
|
||||
}) {
|
||||
for (int type = 0; type < 2; ++type) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout ={
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
|
|
@ -269,21 +269,21 @@ void component_color_palette(void)
|
|||
},
|
||||
}) {
|
||||
for (float ri = 0; ri < 4; ri += 1) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout ={
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.childGap = Clay_Termbox_Cell_Width()
|
||||
},
|
||||
}) {
|
||||
for (float r = ri * 0x44; r < (ri + 1) * 0x44; r += 0x22) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout ={
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
},
|
||||
}) {
|
||||
for (float g = 0; g < 0xff; g += 0x22) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout ={
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
},
|
||||
|
|
@ -298,12 +298,12 @@ void component_color_palette(void)
|
|||
}
|
||||
};
|
||||
if (0 == type) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = layout,
|
||||
.backgroundColor = color
|
||||
}) {}
|
||||
} else if (1 == type) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = layout,
|
||||
}) {
|
||||
CLAY_TEXT(CLAY_STRING("#"), CLAY_TEXT_CONFIG({ .textColor = color }));
|
||||
|
|
@ -323,7 +323,7 @@ void component_color_palette(void)
|
|||
|
||||
void component_unicode_text(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.padding = {
|
||||
|
|
@ -377,7 +377,7 @@ void component_unicode_text(void)
|
|||
|
||||
void component_keybinds(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.padding = {
|
||||
|
|
@ -409,7 +409,7 @@ void component_keybinds(void)
|
|||
|
||||
void component_image(clay_tb_image *image, int width)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = (0 == width) ? CLAY_SIZING_GROW() : CLAY_SIZING_FIXED(width),
|
||||
|
|
@ -424,7 +424,7 @@ void component_image(clay_tb_image *image, int width)
|
|||
|
||||
void component_mouse_data(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -446,7 +446,7 @@ void component_mouse_data(void)
|
|||
v = (255 < v) ? 255 : v;
|
||||
Clay_Color color = (Clay_Color) { v, v, v, 0xff };
|
||||
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = layout,
|
||||
.backgroundColor = color
|
||||
}) {}
|
||||
|
|
@ -457,7 +457,7 @@ void component_mouse_data(void)
|
|||
color = (Clay_Color) { v, v, v, 0xff };
|
||||
|
||||
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = layout,
|
||||
.backgroundColor = color
|
||||
}) {}
|
||||
|
|
@ -467,7 +467,7 @@ void component_mouse_data(void)
|
|||
|
||||
void component_bordered_text(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.sizing = {
|
||||
|
|
@ -478,25 +478,25 @@ void component_bordered_text(void)
|
|||
},
|
||||
.backgroundColor = { 0x24, 0x55, 0x34, 0xff },
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.border = { .width = { 1, 1, 1, 1, 1 }, .color = { 0xaa, 0x00, 0x00, 0xff } },
|
||||
}) {
|
||||
CLAY_TEXT(
|
||||
CLAY_STRING("Test"), CLAY_TEXT_CONFIG({ .textColor = { 0xff, 0xff, 0xff, 0xff } }));
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.border = { .width = { 1, 1, 1, 1, 1 }, .color = { 0x00, 0xaa, 0x00, 0xff } },
|
||||
}) {
|
||||
CLAY_TEXT(CLAY_STRING("of the border width"),
|
||||
CLAY_TEXT_CONFIG({ .textColor = { 0xff, 0xff, 0xff, 0xff } }));
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.border = { .width = { 1, 1, 1, 1, 1 }, .color = { 0x00, 0x00, 0xaa, 0xff } },
|
||||
}) {
|
||||
CLAY_TEXT(CLAY_STRING("and overlap for multiple lines\nof text"),
|
||||
CLAY_TEXT_CONFIG({ .textColor = { 0xff, 0xff, 0xff, 0xff } }));
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.border = { .width = { 1, 1, 1, 1, 1 }, .color = { 0x00, 0x00, 0xaa, 0xff } },
|
||||
}) {
|
||||
CLAY_TEXT(CLAY_STRING("this text\nis long enough\nto display all\n borders\naround it"),
|
||||
|
|
@ -508,7 +508,7 @@ void component_bordered_text(void)
|
|||
Clay_RenderCommandArray CreateLayout(clay_tb_image *image1, clay_tb_image *image2)
|
||||
{
|
||||
Clay_BeginLayout();
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -522,7 +522,7 @@ Clay_RenderCommandArray CreateLayout(clay_tb_image *image1, clay_tb_image *image
|
|||
},
|
||||
.backgroundColor = { 0x24, 0x24, 0x24, 0xff }
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.childAlignment = {
|
||||
.x = CLAY_ALIGN_X_RIGHT,
|
||||
|
|
@ -534,7 +534,7 @@ Clay_RenderCommandArray CreateLayout(clay_tb_image *image1, clay_tb_image *image
|
|||
component_keybinds();
|
||||
component_unicode_text();
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.layoutDirection = CLAY_TOP_TO_BOTTOM,
|
||||
.childGap = 32,
|
||||
|
|
|
|||
|
|
@ -113,7 +113,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
};
|
||||
Clay_TextElementConfig *textconfig =
|
||||
CLAY_TEXT_CONFIG({ .textColor = { 0xff, 0xff, 0xff, 0xff } });
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = {
|
||||
|
|
@ -125,7 +125,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
},
|
||||
}) {
|
||||
CLAY_TEXT(keytext, textconfig);
|
||||
CLAY({ .layout = { .sizing = CLAY_SIZING_GROW(1) } }) { }
|
||||
CLAY_AUTO_ID({ .layout = { .sizing = CLAY_SIZING_GROW(1) } }) { }
|
||||
CLAY_TEXT(valtext, textconfig);
|
||||
}
|
||||
|
||||
|
|
@ -133,7 +133,7 @@ void component_text_pair(const char *key, const char *value)
|
|||
|
||||
void component_termbox_settings(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.padding = {
|
||||
|
|
@ -264,7 +264,7 @@ void component_termbox_settings(void)
|
|||
transparency = "false";
|
||||
}
|
||||
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = { .layoutDirection = CLAY_TOP_TO_BOTTOM },
|
||||
}) {
|
||||
component_text_pair("Color mode", color_mode);
|
||||
|
|
@ -278,7 +278,7 @@ void component_termbox_settings(void)
|
|||
|
||||
void component_keybinds(void)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = CLAY_SIZING_FIT(),
|
||||
.padding = {
|
||||
|
|
@ -311,7 +311,7 @@ void component_keybinds(void)
|
|||
|
||||
void component_image(img_group *img_pair)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -326,7 +326,7 @@ void component_image(img_group *img_pair)
|
|||
},
|
||||
.backgroundColor = { 0x24, 0x24, 0x24, 0xff }
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -343,7 +343,7 @@ void component_image(img_group *img_pair)
|
|||
|
||||
void component_image_small(img_group **img_pairs, int count, int selected_index)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_PERCENT(0.25),
|
||||
|
|
@ -356,7 +356,7 @@ void component_image_small(img_group **img_pairs, int count, int selected_index)
|
|||
},
|
||||
},
|
||||
}) {
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_PERCENT(0.7),
|
||||
|
|
@ -367,7 +367,7 @@ void component_image_small(img_group **img_pairs, int count, int selected_index)
|
|||
},
|
||||
.aspectRatio = { (float)img_pairs[selected_index]->width / img_pairs[selected_index]->height }
|
||||
}) { }
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -384,7 +384,7 @@ void component_image_small(img_group **img_pairs, int count, int selected_index)
|
|||
|
||||
void component_thumbnails(img_group **img_pairs, int count, int selected_index)
|
||||
{
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_PERCENT(0.1),
|
||||
|
|
@ -407,7 +407,7 @@ void component_thumbnails(img_group **img_pairs, int count, int selected_index)
|
|||
.width = CLAY_BORDER_OUTSIDE(0),
|
||||
};
|
||||
}
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
@ -428,7 +428,7 @@ const int thumbnail_count = 5;
|
|||
Clay_RenderCommandArray CreateLayout(struct img_group **imgs)
|
||||
{
|
||||
Clay_BeginLayout();
|
||||
CLAY({
|
||||
CLAY_AUTO_ID({
|
||||
.layout = {
|
||||
.sizing = {
|
||||
.width = CLAY_SIZING_GROW(),
|
||||
|
|
|
|||
Loading…
Reference in a new issue